uawdijnntqw1x1x1
IP : 216.73.216.109
Hostname : premium160.web-hosting.com
Kernel : Linux premium160.web-hosting.com 4.18.0-553.54.1.lve.el8.x86_64 #1 SMP Wed Jun 4 13:01:13 UTC 2025 x86_64
Disable Function : None :)
OS : Linux
PATH:
/
home
/
batcwwjx
/
public_html
/
wp-content
/
plugins
/
charitable
/
.
/
.
/
assets
/
js
/
libraries
/
.
/
shepherd.js
/
/
/*! shepherd.js 5.0.1 */ (function (global, factory) { typeof exports === 'object' && typeof module !== 'undefined' ? module.exports = factory() : typeof define === 'function' && define.amd ? define(factory) : (global = global || self, global.Shepherd = factory()); }(this, function () { 'use strict'; function _extends() { _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return _extends.apply(this, arguments); } function _inheritsLoose(subClass, superClass) { subClass.prototype = Object.create(superClass.prototype); subClass.prototype.constructor = subClass; subClass.__proto__ = superClass; } function _assertThisInitialized(self) { if (self === void 0) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return self; } var validTypes = { object: true, symbol: true }; var isImplemented = function () { var symbol; if (typeof Symbol !== 'function') return false; symbol = Symbol('test symbol'); try { String(symbol); } catch (e) { return false; } // Return 'true' also for polyfills if (!validTypes[typeof Symbol.iterator]) return false; if (!validTypes[typeof Symbol.toPrimitive]) return false; if (!validTypes[typeof Symbol.toStringTag]) return false; return true; }; var global$1 = (function () { if (this) return this; // Unexpected strict mode (may happen if e.g. bundled into ESM module) be nice // Thanks @mathiasbynens -> https://mathiasbynens.be/notes/globalthis // In all ES5 engines global object inherits from Object.prototype // (if you approached one that doesn't please report) Object.defineProperty(Object.prototype, "__global__", { get: function () { return this; }, configurable: true }); try { return __global__; } finally { delete Object.prototype.__global__; } })(); var commonjsGlobal = typeof globalThis !== 'undefined' ? globalThis : typeof window !== 'undefined' ? window : typeof global !== 'undefined' ? global : typeof self !== 'undefined' ? self : {}; function unwrapExports (x) { return x && x.__esModule && Object.prototype.hasOwnProperty.call(x, 'default') ? x['default'] : x; } function createCommonjsModule(fn, module) { return module = { exports: {} }, fn(module, module.exports), module.exports; } // ES3 safe var _undefined = void 0; var is = function (value) { return value !== _undefined && value !== null; }; // prettier-ignore var possibleTypes = { "object": true, "function": true, "undefined": true /* document.all */ }; var is$1 = function (value) { if (!is(value)) return false; return hasOwnProperty.call(possibleTypes, typeof value); }; var is$2 = function (value) { if (!is$1(value)) return false; try { if (!value.constructor) return false; return value.constructor.prototype === value; } catch (error) { return false; } }; var is$3 = function (value) { if (typeof value !== "function") return false; if (!hasOwnProperty.call(value, "length")) return false; try { if (typeof value.length !== "number") return false; if (typeof value.call !== "function") return false; if (typeof value.apply !== "function") return false; } catch (error) { return false; } return !is$2(value); }; var classRe = /^\s*class[\s{/}]/, functionToString = Function.prototype.toString; var is$4 = function (value) { if (!is$3(value)) return false; if (classRe.test(functionToString.call(value))) return false; return true; }; var isImplemented$1 = function () { var assign = Object.assign, obj; if (typeof assign !== "function") return false; obj = { foo: "raz" }; assign(obj, { bar: "dwa" }, { trzy: "trzy" }); return (obj.foo + obj.bar + obj.trzy) === "razdwatrzy"; }; var isImplemented$2 = function () { try { Object.keys("primitive"); return true; } catch (e) { return false; } }; // eslint-disable-next-line no-empty-function var noop = function () {}; var _undefined$1 = noop(); // Support ES3 engines var isValue = function (val) { return (val !== _undefined$1) && (val !== null); }; var keys = Object.keys; var shim = function (object) { return keys(isValue(object) ? Object(object) : object); }; var keys$1 = isImplemented$2() ? Object.keys : shim; var validValue = function (value) { if (!isValue(value)) throw new TypeError("Cannot use null or undefined"); return value; }; var max = Math.max; var shim$1 = function (dest, src /*, …srcn*/) { var error, i, length = max(arguments.length, 2), assign; dest = Object(validValue(dest)); assign = function (key) { try { dest[key] = src[key]; } catch (e) { if (!error) error = e; } }; for (i = 1; i < length; ++i) { src = arguments[i]; keys$1(src).forEach(assign); } if (error !== undefined) throw error; return dest; }; var assign = isImplemented$1() ? Object.assign : shim$1; var forEach = Array.prototype.forEach, create = Object.create; var process = function (src, obj) { var key; for (key in src) obj[key] = src[key]; }; // eslint-disable-next-line no-unused-vars var normalizeOptions = function (opts1 /*, …options*/) { var result = create(null); forEach.call(arguments, function (options) { if (!isValue(options)) return; process(Object(options), result); }); return result; }; var str = "razdwatrzy"; var isImplemented$3 = function () { if (typeof str.contains !== "function") return false; return (str.contains("dwa") === true) && (str.contains("foo") === false); }; var indexOf = String.prototype.indexOf; var shim$2 = function (searchString/*, position*/) { return indexOf.call(this, searchString, arguments[1]) > -1; }; var contains = isImplemented$3() ? String.prototype.contains : shim$2; var d_1 = createCommonjsModule(function (module) { var d = (module.exports = function (dscr, value/*, options*/) { var c, e, w, options, desc; if (arguments.length < 2 || typeof dscr !== "string") { options = value; value = dscr; dscr = null; } else { options = arguments[2]; } if (is(dscr)) { c = contains.call(dscr, "c"); e = contains.call(dscr, "e"); w = contains.call(dscr, "w"); } else { c = w = true; e = false; } desc = { value: value, configurable: c, enumerable: e, writable: w }; return !options ? desc : assign(normalizeOptions(options), desc); }); d.gs = function (dscr, get, set/*, options*/) { var c, e, options, desc; if (typeof dscr !== "string") { options = set; set = get; get = dscr; dscr = null; } else { options = arguments[3]; } if (!is(get)) { get = undefined; } else if (!is$4(get)) { options = get; get = set = undefined; } else if (!is(set)) { set = undefined; } else if (!is$4(set)) { options = set; set = undefined; } if (is(dscr)) { c = contains.call(dscr, "c"); e = contains.call(dscr, "e"); } else { c = true; e = false; } desc = { get: get, set: set, configurable: c, enumerable: e }; return !options ? desc : assign(normalizeOptions(options), desc); }; }); var isSymbol = function (x) { if (!x) return false; if (typeof x === 'symbol') return true; if (!x.constructor) return false; if (x.constructor.name !== 'Symbol') return false; return (x[x.constructor.toStringTag] === 'Symbol'); }; var validateSymbol = function (value) { if (!isSymbol(value)) throw new TypeError(value + " is not a symbol"); return value; }; var create$1 = Object.create, defineProperties = Object.defineProperties , defineProperty = Object.defineProperty, objPrototype = Object.prototype , NativeSymbol, SymbolPolyfill, HiddenSymbol, globalSymbols = create$1(null) , isNativeSafe; if (typeof Symbol === 'function') { NativeSymbol = Symbol; try { String(NativeSymbol()); isNativeSafe = true; } catch (ignore) {} } var generateName = (function () { var created = create$1(null); return function (desc) { var postfix = 0, name, ie11BugWorkaround; while (created[desc + (postfix || '')]) ++postfix; desc += (postfix || ''); created[desc] = true; name = '@@' + desc; defineProperty(objPrototype, name, d_1.gs(null, function (value) { // For IE11 issue see: // https://connect.microsoft.com/IE/feedbackdetail/view/1928508/ // ie11-broken-getters-on-dom-objects // https://github.com/medikoo/es6-symbol/issues/12 if (ie11BugWorkaround) return; ie11BugWorkaround = true; defineProperty(this, name, d_1(value)); ie11BugWorkaround = false; })); return name; }; }()); // Internal constructor (not one exposed) for creating Symbol instances. // This one is used to ensure that `someSymbol instanceof Symbol` always return false HiddenSymbol = function Symbol(description) { if (this instanceof HiddenSymbol) throw new TypeError('Symbol is not a constructor'); return SymbolPolyfill(description); }; // Exposed `Symbol` constructor // (returns instances of HiddenSymbol) var polyfill = SymbolPolyfill = function Symbol(description) { var symbol; if (this instanceof Symbol) throw new TypeError('Symbol is not a constructor'); if (isNativeSafe) return NativeSymbol(description); symbol = create$1(HiddenSymbol.prototype); description = (description === undefined ? '' : String(description)); return defineProperties(symbol, { __description__: d_1('', description), __name__: d_1('', generateName(description)) }); }; defineProperties(SymbolPolyfill, { for: d_1(function (key) { if (globalSymbols[key]) return globalSymbols[key]; return (globalSymbols[key] = SymbolPolyfill(String(key))); }), keyFor: d_1(function (s) { var key; validateSymbol(s); for (key in globalSymbols) if (globalSymbols[key] === s) return key; }), // To ensure proper interoperability with other native functions (e.g. Array.from) // fallback to eventual native implementation of given symbol hasInstance: d_1('', (NativeSymbol && NativeSymbol.hasInstance) || SymbolPolyfill('hasInstance')), isConcatSpreadable: d_1('', (NativeSymbol && NativeSymbol.isConcatSpreadable) || SymbolPolyfill('isConcatSpreadable')), iterator: d_1('', (NativeSymbol && NativeSymbol.iterator) || SymbolPolyfill('iterator')), match: d_1('', (NativeSymbol && NativeSymbol.match) || SymbolPolyfill('match')), replace: d_1('', (NativeSymbol && NativeSymbol.replace) || SymbolPolyfill('replace')), search: d_1('', (NativeSymbol && NativeSymbol.search) || SymbolPolyfill('search')), species: d_1('', (NativeSymbol && NativeSymbol.species) || SymbolPolyfill('species')), split: d_1('', (NativeSymbol && NativeSymbol.split) || SymbolPolyfill('split')), toPrimitive: d_1('', (NativeSymbol && NativeSymbol.toPrimitive) || SymbolPolyfill('toPrimitive')), toStringTag: d_1('', (NativeSymbol && NativeSymbol.toStringTag) || SymbolPolyfill('toStringTag')), unscopables: d_1('', (NativeSymbol && NativeSymbol.unscopables) || SymbolPolyfill('unscopables')) }); // Internal tweaks for real symbol producer defineProperties(HiddenSymbol.prototype, { constructor: d_1(SymbolPolyfill), toString: d_1('', function () { return this.__name__; }) }); // Proper implementation of methods exposed on Symbol.prototype // They won't be accessible on produced symbol instances as they derive from HiddenSymbol.prototype defineProperties(SymbolPolyfill.prototype, { toString: d_1(function () { return 'Symbol (' + validateSymbol(this).__description__ + ')'; }), valueOf: d_1(function () { return validateSymbol(this); }) }); defineProperty(SymbolPolyfill.prototype, SymbolPolyfill.toPrimitive, d_1('', function () { var symbol = validateSymbol(this); if (typeof symbol === 'symbol') return symbol; return symbol.toString(); })); defineProperty(SymbolPolyfill.prototype, SymbolPolyfill.toStringTag, d_1('c', 'Symbol')); // Proper implementaton of toPrimitive and toStringTag for returned symbol instances defineProperty(HiddenSymbol.prototype, SymbolPolyfill.toStringTag, d_1('c', SymbolPolyfill.prototype[SymbolPolyfill.toStringTag])); // Note: It's important to define `toPrimitive` as last one, as some implementations // implement `toPrimitive` natively without implementing `toStringTag` (or other specified symbols) // And that may invoke error in definition flow: // See: https://github.com/medikoo/es6-symbol/issues/13#issuecomment-164146149 defineProperty(HiddenSymbol.prototype, SymbolPolyfill.toPrimitive, d_1('c', SymbolPolyfill.prototype[SymbolPolyfill.toPrimitive])); if (!isImplemented()) { Object.defineProperty(global$1, 'Symbol', { value: polyfill, configurable: true, enumerable: false, writable: true }); } /*! * isobject <https://github.com/jonschlinkert/isobject> * * Copyright (c) 2014-2017, Jon Schlinkert. * Released under the MIT License. */ var isobject = function isObject(val) { return val != null && typeof val === 'object' && Array.isArray(val) === false; }; /*! * get-value <https://github.com/jonschlinkert/get-value> * * Copyright (c) 2014-2018, Jon Schlinkert. * Released under the MIT License. */ var getValue = function(target, path, options) { if (!isobject(options)) { options = { default: options }; } if (!isValidObject(target)) { return typeof options.default !== 'undefined' ? options.default : target; } if (typeof path === 'number') { path = String(path); } const isArray = Array.isArray(path); const isString = typeof path === 'string'; const splitChar = options.separator || '.'; const joinChar = options.joinChar || (typeof splitChar === 'string' ? splitChar : '.'); if (!isString && !isArray) { return target; } if (isString && path in target) { return isValid(path, target, options) ? target[path] : options.default; } let segs = isArray ? path : split(path, splitChar, options); let len = segs.length; let idx = 0; do { let prop = segs[idx]; if (typeof prop === 'number') { prop = String(prop); } while (prop && prop.slice(-1) === '\\') { prop = join([prop.slice(0, -1), segs[++idx] || ''], joinChar, options); } if (prop in target) { if (!isValid(prop, target, options)) { return options.default; } target = target[prop]; } else { let hasProp = false; let n = idx + 1; while (n < len) { prop = join([prop, segs[n++]], joinChar, options); if ((hasProp = prop in target)) { if (!isValid(prop, target, options)) { return options.default; } target = target[prop]; idx = n - 1; break; } } if (!hasProp) { return options.default; } } } while (++idx < len && isValidObject(target)); if (idx === len) { return target; } return options.default; }; function join(segs, joinChar, options) { if (typeof options.join === 'function') { return options.join(segs); } return segs[0] + joinChar + segs[1]; } function split(path, splitChar, options) { if (typeof options.split === 'function') { return options.split(path); } return path.split(splitChar); } function isValid(key, target, options) { if (typeof options.isValid === 'function') { return options.isValid(key, target); } return true; } function isValidObject(val) { return isobject(val) || Array.isArray(val) || typeof val === 'function'; } var VNode = function VNode() {}; var options = {}; var stack = []; var EMPTY_CHILDREN = []; function h(nodeName, attributes) { var children = EMPTY_CHILDREN, lastSimple, child, simple, i; for (i = arguments.length; i-- > 2;) { stack.push(arguments[i]); } if (attributes && attributes.children != null) { if (!stack.length) stack.push(attributes.children); delete attributes.children; } while (stack.length) { if ((child = stack.pop()) && child.pop !== undefined) { for (i = child.length; i--;) { stack.push(child[i]); } } else { if (typeof child === 'boolean') child = null; if (simple = typeof nodeName !== 'function') { if (child == null) child = '';else if (typeof child === 'number') child = String(child);else if (typeof child !== 'string') simple = false; } if (simple && lastSimple) { children[children.length - 1] += child; } else if (children === EMPTY_CHILDREN) { children = [child]; } else { children.push(child); } lastSimple = simple; } } var p = new VNode(); p.nodeName = nodeName; p.children = children; p.attributes = attributes == null ? undefined : attributes; p.key = attributes == null ? undefined : attributes.key; return p; } function extend(obj, props) { for (var i in props) { obj[i] = props[i]; }return obj; } function applyRef(ref, value) { if (ref) { if (typeof ref == 'function') ref(value);else ref.current = value; } } var defer = typeof Promise == 'function' ? Promise.resolve().then.bind(Promise.resolve()) : setTimeout; function cloneElement(vnode, props) { return h(vnode.nodeName, extend(extend({}, vnode.attributes), props), arguments.length > 2 ? [].slice.call(arguments, 2) : vnode.children); } var IS_NON_DIMENSIONAL = /acit|ex(?:s|g|n|p|$)|rph|ows|mnc|ntw|ine[ch]|zoo|^ord/i; var items = []; function enqueueRender(component) { if (!component._dirty && (component._dirty = true) && items.push(component) == 1) { ( defer)(rerender); } } function rerender() { var p; while (p = items.pop()) { if (p._dirty) renderComponent(p); } } function isSameNodeType(node, vnode, hydrating) { if (typeof vnode === 'string' || typeof vnode === 'number') { return node.splitText !== undefined; } if (typeof vnode.nodeName === 'string') { return !node._componentConstructor && isNamedNode(node, vnode.nodeName); } return hydrating || node._componentConstructor === vnode.nodeName; } function isNamedNode(node, nodeName) { return node.normalizedNodeName === nodeName || node.nodeName.toLowerCase() === nodeName.toLowerCase(); } function getNodeProps(vnode) { var props = extend({}, vnode.attributes); props.children = vnode.children; var defaultProps = vnode.nodeName.defaultProps; if (defaultProps !== undefined) { for (var i in defaultProps) { if (props[i] === undefined) { props[i] = defaultProps[i]; } } } return props; } function createNode(nodeName, isSvg) { var node = isSvg ? document.createElementNS('http://www.w3.org/2000/svg', nodeName) : document.createElement(nodeName); node.normalizedNodeName = nodeName; return node; } function removeNode(node) { var parentNode = node.parentNode; if (parentNode) parentNode.removeChild(node); } function setAccessor(node, name, old, value, isSvg) { if (name === 'className') name = 'class'; if (name === 'key') ; else if (name === 'ref') { applyRef(old, null); applyRef(value, node); } else if (name === 'class' && !isSvg) { node.className = value || ''; } else if (name === 'style') { if (!value || typeof value === 'string' || typeof old === 'string') { node.style.cssText = value || ''; } if (value && typeof value === 'object') { if (typeof old !== 'string') { for (var i in old) { if (!(i in value)) node.style[i] = ''; } } for (var i in value) { node.style[i] = typeof value[i] === 'number' && IS_NON_DIMENSIONAL.test(i) === false ? value[i] + 'px' : value[i]; } } } else if (name === 'dangerouslySetInnerHTML') { if (value) node.innerHTML = value.__html || ''; } else if (name[0] == 'o' && name[1] == 'n') { var useCapture = name !== (name = name.replace(/Capture$/, '')); name = name.toLowerCase().substring(2); if (value) { if (!old) node.addEventListener(name, eventProxy, useCapture); } else { node.removeEventListener(name, eventProxy, useCapture); } (node._listeners || (node._listeners = {}))[name] = value; } else if (name !== 'list' && name !== 'type' && !isSvg && name in node) { try { node[name] = value == null ? '' : value; } catch (e) {} if ((value == null || value === false) && name != 'spellcheck') node.removeAttribute(name); } else { var ns = isSvg && name !== (name = name.replace(/^xlink:?/, '')); if (value == null || value === false) { if (ns) node.removeAttributeNS('http://www.w3.org/1999/xlink', name.toLowerCase());else node.removeAttribute(name); } else if (typeof value !== 'function') { if (ns) node.setAttributeNS('http://www.w3.org/1999/xlink', name.toLowerCase(), value);else node.setAttribute(name, value); } } } function eventProxy(e) { return this._listeners[e.type]( e); } var mounts = []; var diffLevel = 0; var isSvgMode = false; var hydrating = false; function flushMounts() { var c; while (c = mounts.shift()) { if (c.componentDidMount) c.componentDidMount(); } } function diff(dom, vnode, context, mountAll, parent, componentRoot) { if (!diffLevel++) { isSvgMode = parent != null && parent.ownerSVGElement !== undefined; hydrating = dom != null && !('__preactattr_' in dom); } var ret = idiff(dom, vnode, context, mountAll, componentRoot); if (parent && ret.parentNode !== parent) parent.appendChild(ret); if (! --diffLevel) { hydrating = false; if (!componentRoot) flushMounts(); } return ret; } function idiff(dom, vnode, context, mountAll, componentRoot) { var out = dom, prevSvgMode = isSvgMode; if (vnode == null || typeof vnode === 'boolean') vnode = ''; if (typeof vnode === 'string' || typeof vnode === 'number') { if (dom && dom.splitText !== undefined && dom.parentNode && (!dom._component || componentRoot)) { if (dom.nodeValue != vnode) { dom.nodeValue = vnode; } } else { out = document.createTextNode(vnode); if (dom) { if (dom.parentNode) dom.parentNode.replaceChild(out, dom); recollectNodeTree(dom, true); } } out['__preactattr_'] = true; return out; } var vnodeName = vnode.nodeName; if (typeof vnodeName === 'function') { return buildComponentFromVNode(dom, vnode, context, mountAll); } isSvgMode = vnodeName === 'svg' ? true : vnodeName === 'foreignObject' ? false : isSvgMode; vnodeName = String(vnodeName); if (!dom || !isNamedNode(dom, vnodeName)) { out = createNode(vnodeName, isSvgMode); if (dom) { while (dom.firstChild) { out.appendChild(dom.firstChild); } if (dom.parentNode) dom.parentNode.replaceChild(out, dom); recollectNodeTree(dom, true); } } var fc = out.firstChild, props = out['__preactattr_'], vchildren = vnode.children; if (props == null) { props = out['__preactattr_'] = {}; for (var a = out.attributes, i = a.length; i--;) { props[a[i].name] = a[i].value; } } if (!hydrating && vchildren && vchildren.length === 1 && typeof vchildren[0] === 'string' && fc != null && fc.splitText !== undefined && fc.nextSibling == null) { if (fc.nodeValue != vchildren[0]) { fc.nodeValue = vchildren[0]; } } else if (vchildren && vchildren.length || fc != null) { innerDiffNode(out, vchildren, context, mountAll, hydrating || props.dangerouslySetInnerHTML != null); } diffAttributes(out, vnode.attributes, props); isSvgMode = prevSvgMode; return out; } function innerDiffNode(dom, vchildren, context, mountAll, isHydrating) { var originalChildren = dom.childNodes, children = [], keyed = {}, keyedLen = 0, min = 0, len = originalChildren.length, childrenLen = 0, vlen = vchildren ? vchildren.length : 0, j, c, f, vchild, child; if (len !== 0) { for (var i = 0; i < len; i++) { var _child = originalChildren[i], props = _child['__preactattr_'], key = vlen && props ? _child._component ? _child._component.__key : props.key : null; if (key != null) { keyedLen++; keyed[key] = _child; } else if (props || (_child.splitText !== undefined ? isHydrating ? _child.nodeValue.trim() : true : isHydrating)) { children[childrenLen++] = _child; } } } if (vlen !== 0) { for (var i = 0; i < vlen; i++) { vchild = vchildren[i]; child = null; var key = vchild.key; if (key != null) { if (keyedLen && keyed[key] !== undefined) { child = keyed[key]; keyed[key] = undefined; keyedLen--; } } else if (min < childrenLen) { for (j = min; j < childrenLen; j++) { if (children[j] !== undefined && isSameNodeType(c = children[j], vchild, isHydrating)) { child = c; children[j] = undefined; if (j === childrenLen - 1) childrenLen--; if (j === min) min++; break; } } } child = idiff(child, vchild, context, mountAll); f = originalChildren[i]; if (child && child !== dom && child !== f) { if (f == null) { dom.appendChild(child); } else if (child === f.nextSibling) { removeNode(f); } else { dom.insertBefore(child, f); } } } } if (keyedLen) { for (var i in keyed) { if (keyed[i] !== undefined) recollectNodeTree(keyed[i], false); } } while (min <= childrenLen) { if ((child = children[childrenLen--]) !== undefined) recollectNodeTree(child, false); } } function recollectNodeTree(node, unmountOnly) { var component = node._component; if (component) { unmountComponent(component); } else { if (node['__preactattr_'] != null) applyRef(node['__preactattr_'].ref, null); if (unmountOnly === false || node['__preactattr_'] == null) { removeNode(node); } removeChildren(node); } } function removeChildren(node) { node = node.lastChild; while (node) { var next = node.previousSibling; recollectNodeTree(node, true); node = next; } } function diffAttributes(dom, attrs, old) { var name; for (name in old) { if (!(attrs && attrs[name] != null) && old[name] != null) { setAccessor(dom, name, old[name], old[name] = undefined, isSvgMode); } } for (name in attrs) { if (name !== 'children' && name !== 'innerHTML' && (!(name in old) || attrs[name] !== (name === 'value' || name === 'checked' ? dom[name] : old[name]))) { setAccessor(dom, name, old[name], old[name] = attrs[name], isSvgMode); } } } var recyclerComponents = []; function createComponent(Ctor, props, context) { var inst, i = recyclerComponents.length; if (Ctor.prototype && Ctor.prototype.render) { inst = new Ctor(props, context); Component.call(inst, props, context); } else { inst = new Component(props, context); inst.constructor = Ctor; inst.render = doRender; } while (i--) { if (recyclerComponents[i].constructor === Ctor) { inst.nextBase = recyclerComponents[i].nextBase; recyclerComponents.splice(i, 1); return inst; } } return inst; } function doRender(props, state, context) { return this.constructor(props, context); } function setComponentProps(component, props, renderMode, context, mountAll) { if (component._disable) return; component._disable = true; component.__ref = props.ref; component.__key = props.key; delete props.ref; delete props.key; if (typeof component.constructor.getDerivedStateFromProps === 'undefined') { if (!component.base || mountAll) { if (component.componentWillMount) component.componentWillMount(); } else if (component.componentWillReceiveProps) { component.componentWillReceiveProps(props, context); } } if (context && context !== component.context) { if (!component.prevContext) component.prevContext = component.context; component.context = context; } if (!component.prevProps) component.prevProps = component.props; component.props = props; component._disable = false; if (renderMode !== 0) { if (renderMode === 1 || options.syncComponentUpdates !== false || !component.base) { renderComponent(component, 1, mountAll); } else { enqueueRender(component); } } applyRef(component.__ref, component); } function renderComponent(component, renderMode, mountAll, isChild) { if (component._disable) return; var props = component.props, state = component.state, context = component.context, previousProps = component.prevProps || props, previousState = component.prevState || state, previousContext = component.prevContext || context, isUpdate = component.base, nextBase = component.nextBase, initialBase = isUpdate || nextBase, initialChildComponent = component._component, skip = false, snapshot = previousContext, rendered, inst, cbase; if (component.constructor.getDerivedStateFromProps) { state = extend(extend({}, state), component.constructor.getDerivedStateFromProps(props, state)); component.state = state; } if (isUpdate) { component.props = previousProps; component.state = previousState; component.context = previousContext; if (renderMode !== 2 && component.shouldComponentUpdate && component.shouldComponentUpdate(props, state, context) === false) { skip = true; } else if (component.componentWillUpdate) { component.componentWillUpdate(props, state, context); } component.props = props; component.state = state; component.context = context; } component.prevProps = component.prevState = component.prevContext = component.nextBase = null; component._dirty = false; if (!skip) { rendered = component.render(props, state, context); if (component.getChildContext) { context = extend(extend({}, context), component.getChildContext()); } if (isUpdate && component.getSnapshotBeforeUpdate) { snapshot = component.getSnapshotBeforeUpdate(previousProps, previousState); } var childComponent = rendered && rendered.nodeName, toUnmount, base; if (typeof childComponent === 'function') { var childProps = getNodeProps(rendered); inst = initialChildComponent; if (inst && inst.constructor === childComponent && childProps.key == inst.__key) { setComponentProps(inst, childProps, 1, context, false); } else { toUnmount = inst; component._component = inst = createComponent(childComponent, childProps, context); inst.nextBase = inst.nextBase || nextBase; inst._parentComponent = component; setComponentProps(inst, childProps, 0, context, false); renderComponent(inst, 1, mountAll, true); } base = inst.base; } else { cbase = initialBase; toUnmount = initialChildComponent; if (toUnmount) { cbase = component._component = null; } if (initialBase || renderMode === 1) { if (cbase) cbase._component = null; base = diff(cbase, rendered, context, mountAll || !isUpdate, initialBase && initialBase.parentNode, true); } } if (initialBase && base !== initialBase && inst !== initialChildComponent) { var baseParent = initialBase.parentNode; if (baseParent && base !== baseParent) { baseParent.replaceChild(base, initialBase); if (!toUnmount) { initialBase._component = null; recollectNodeTree(initialBase, false); } } } if (toUnmount) { unmountComponent(toUnmount); } component.base = base; if (base && !isChild) { var componentRef = component, t = component; while (t = t._parentComponent) { (componentRef = t).base = base; } base._component = componentRef; base._componentConstructor = componentRef.constructor; } } if (!isUpdate || mountAll) { mounts.push(component); } else if (!skip) { if (component.componentDidUpdate) { component.componentDidUpdate(previousProps, previousState, snapshot); } } while (component._renderCallbacks.length) { component._renderCallbacks.pop().call(component); }if (!diffLevel && !isChild) flushMounts(); } function buildComponentFromVNode(dom, vnode, context, mountAll) { var c = dom && dom._component, originalComponent = c, oldDom = dom, isDirectOwner = c && dom._componentConstructor === vnode.nodeName, isOwner = isDirectOwner, props = getNodeProps(vnode); while (c && !isOwner && (c = c._parentComponent)) { isOwner = c.constructor === vnode.nodeName; } if (c && isOwner && (!mountAll || c._component)) { setComponentProps(c, props, 3, context, mountAll); dom = c.base; } else { if (originalComponent && !isDirectOwner) { unmountComponent(originalComponent); dom = oldDom = null; } c = createComponent(vnode.nodeName, props, context); if (dom && !c.nextBase) { c.nextBase = dom; oldDom = null; } setComponentProps(c, props, 1, context, mountAll); dom = c.base; if (oldDom && dom !== oldDom) { oldDom._component = null; recollectNodeTree(oldDom, false); } } return dom; } function unmountComponent(component) { var base = component.base; component._disable = true; if (component.componentWillUnmount) component.componentWillUnmount(); component.base = null; var inner = component._component; if (inner) { unmountComponent(inner); } else if (base) { if (base['__preactattr_'] != null) applyRef(base['__preactattr_'].ref, null); component.nextBase = base; removeNode(base); recyclerComponents.push(component); removeChildren(base); } applyRef(component.__ref, null); } function Component(props, context) { this._dirty = true; this.context = context; this.props = props; this.state = this.state || {}; this._renderCallbacks = []; } extend(Component.prototype, { setState: function setState(state, callback) { if (!this.prevState) this.prevState = this.state; this.state = extend(extend({}, this.state), typeof state === 'function' ? state(this.state, this.props) : state); if (callback) this._renderCallbacks.push(callback); enqueueRender(this); }, forceUpdate: function forceUpdate(callback) { if (callback) this._renderCallbacks.push(callback); renderComponent(this, 2); }, render: function render() {} }); function render(vnode, parent, merge) { return diff(merge, vnode, {}, false, parent, false); } function createRef() { return {}; } var preact = { h: h, createElement: h, cloneElement: cloneElement, createRef: createRef, Component: Component, render: render, rerender: rerender, options: options }; /** * Checks if `value` is classified as an `HTMLElement`. * @param {*} value The param to check if it is an HTMLElement */ function isElement(value) { return value instanceof HTMLElement; } /** * Checks if `value` is classified as a `Function` object. * @param {*} value The param to check if it is a function */ function isFunction(value) { return typeof value === 'function'; } /** * Checks if `value` is classified as a `String` object. * @param {*} value The param to check if it is a string */ function isString(value) { return typeof value === 'string'; } /** * Checks if `value` is undefined. * @param {*} value The param to check if it is undefined */ function isUndefined(value) { return value === undefined; } var Evented = /*#__PURE__*/ function () { function Evented() {} var _proto = Evented.prototype; _proto.on = function on(event, handler, ctx) { var once = arguments.length <= 3 || arguments[3] === undefined ? false : arguments[3]; if (isUndefined(this.bindings)) { this.bindings = {}; } if (isUndefined(this.bindings[event])) { this.bindings[event] = []; } this.bindings[event].push({ handler: handler, ctx: ctx, once: once }); }; _proto.once = function once(event, handler, ctx) { this.on(event, handler, ctx, true); }; _proto.off = function off(event, handler) { var _this = this; if (isUndefined(this.bindings) || isUndefined(this.bindings[event])) { return false; } if (isUndefined(handler)) { delete this.bindings[event]; } else { this.bindings[event].forEach(function (binding, index) { if (binding.handler === handler) { _this.bindings[event].splice(index, 1); } }); } }; _proto.trigger = function trigger(event) { var _this2 = this; if (!isUndefined(this.bindings) && this.bindings[event]) { var args = Array.prototype.slice.call(arguments, 1); this.bindings[event].forEach(function (binding, index) { var ctx = binding.ctx, handler = binding.handler, once = binding.once; var context = ctx || _this2; handler.apply(context, args); if (once) { _this2.bindings[event].splice(index, 1); } }); } }; return Evented; }(); /** * Binds all the methods on a JS Class to the `this` context of the class. * Adapted from https://github.com/sindresorhus/auto-bind * @param {object} self The `this` context of the class * @return {object} The `this` context of the class */ function autoBind(self) { var keys = Object.getOwnPropertyNames(self.constructor.prototype); for (var i = 0; i < keys.length; i++) { var key = keys[i]; var val = self[key]; if (key !== 'constructor' && typeof val === 'function') { self[key] = val.bind(self); } } return self; } /** * Sets up the handler to determine if we should advance the tour * @param {string} selector * @param {Step} step The step instance * @return {Function} * @private */ function _setupAdvanceOnHandler(selector, step) { return function (event) { if (step.isOpen()) { var targetIsEl = step.el && event.currentTarget === step.el; var targetIsSelector = !isUndefined(selector) && event.currentTarget.matches(selector); if (targetIsSelector || targetIsEl) { step.tour.next(); } } }; } /** * Bind the event handler for advanceOn * @param {Step} step The step instance */ function bindAdvance(step) { // An empty selector matches the step element var _ref = step.options.advanceOn || {}, event = _ref.event, selector = _ref.selector; if (event) { var handler = _setupAdvanceOnHandler(selector, step); // TODO: this should also bind/unbind on show/hide var el; try { el = document.querySelector(selector); } catch (e) {// TODO } if (!isUndefined(selector) && !el) { return console.error("No element was found for the selector supplied to advanceOn: " + selector); } else if (el) { el.addEventListener(event, handler); step.on('destroy', function () { return el.removeEventListener(event, handler); }); } else { document.body.addEventListener(event, handler, true); step.on('destroy', function () { return document.body.removeEventListener(event, handler, true); }); } } else { return console.error('advanceOn was defined, but no event name was passed.'); } } var addHasTitleClass = function addHasTitleClass(step) { return { addHasTitleClass: _createClassModifier(step.classPrefix + "shepherd-has-title") }; }; /** * Create a popper modifier for adding the passed className to the popper * @param {string} className The class to add to the popper * @return {{fn(*): *, enabled: boolean}|*} * @private */ function _createClassModifier(className) { return { enabled: true, fn: function fn(data) { data.instance.popper.classList.add(className); return data; } }; } function _getCenteredStylePopperModifier(styles) { return { computeStyle: { enabled: true, fn: function fn(data) { data.styles = _extends({}, data.styles, { left: '50%', top: '50%', transform: 'translate(-50%, -50%)' }); return data; } }, addShepherdClass: _createClassModifier(styles.shepherd.trim()) }; } /** * Used to compose settings for tippyOptions.popperOptions (https://atomiks.github.io/tippyjs/#popper-options-option) * @private */ function _getDefaultPopperOptions(styles) { return { positionFixed: true, modifiers: { addShepherdClass: _createClassModifier(styles.shepherd.trim()) } }; } /** * Generates the hash of options that will be passed to `Tippy` instances * target an element in the DOM. * * @param {Object} attachToOptions The local `attachTo` options * @param {Step} step The step instance * @return {Object} The final tippy options object */ function makeAttachedTippyOptions(attachToOptions, step) { var _makeCommonTippyOptio = _makeCommonTippyOptions(step), popperOptions = _makeCommonTippyOptio.popperOptions, tippyOptions = _makeCommonTippyOptio.tippyOptions; tippyOptions.flipOnUpdate = true; tippyOptions.placement = attachToOptions.on || 'right'; var stepPopperOptions = getValue(step, 'options.tippyOptions.popperOptions'); if (stepPopperOptions) { popperOptions = _extends({}, popperOptions, {}, stepPopperOptions, { modifiers: _extends({}, popperOptions.modifiers, {}, stepPopperOptions.modifiers) }); } tippyOptions.popperOptions = popperOptions; return tippyOptions; } /** * Generates the hash of options for a tooltip that doesn't have a * target element in the DOM -- and thus is positioned in the center * of the view * * @param {Step} step The step instance * @return {Object} The final tippy options object */ function makeCenteredTippy(step) { var centeredStylePopperModifier = _getCenteredStylePopperModifier(step.styles); var _makeCommonTippyOptio2 = _makeCommonTippyOptions(step), popperOptions = _makeCommonTippyOptio2.popperOptions, tippyOptions = _makeCommonTippyOptio2.tippyOptions; tippyOptions.placement = 'top'; tippyOptions.arrow = false; tippyOptions.popperOptions = tippyOptions.popperOptions || {}; popperOptions = _extends({}, popperOptions, {}, tippyOptions.popperOptions, { modifiers: _extends({}, popperOptions.modifiers, {}, centeredStylePopperModifier, {}, tippyOptions.popperOptions.modifiers) }); tippyOptions.popperOptions = popperOptions; return tippyOptions; } function _makeCommonTippyOptions(step) { var popperOptions = _getDefaultPopperOptions(step.styles); var tippyOptions = _extends({ content: step.el }, step.options.tippyOptions); var shepherdElementZIndex = getValue(step, 'tour.options.styleVariables.shepherdElementZIndex'); if (shepherdElementZIndex) { tippyOptions.zIndex = shepherdElementZIndex; } if (step.options.title) { popperOptions.modifiers = _extends({}, popperOptions.modifiers, {}, addHasTitleClass(step)); } return { popperOptions: popperOptions, tippyOptions: tippyOptions }; } /**! * tippy.js v5.0.0-beta.1 * (c) 2017-2019 atomiks * MIT License */ function _extends$1() { _extends$1 = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return _extends$1.apply(this, arguments); } var isBrowser = typeof window !== 'undefined' && typeof document !== 'undefined'; var ua = isBrowser ? navigator.userAgent : ''; var isIE = /MSIE |Trident\//.test(ua); var isUCBrowser = /UCBrowser\//.test(ua); var isIOS = isBrowser && /iPhone|iPad|iPod/.test(navigator.platform); var defaultProps = { allowHTML: true, animateFill: false, animation: 'fade', appendTo: function appendTo() { return document.body; }, aria: 'describedby', arrow: true, boundary: 'scrollParent', content: '', delay: 0, distance: 10, duration: [325, 275], flip: true, flipBehavior: 'flip', flipOnUpdate: false, followCursor: false, hideOnClick: true, ignoreAttributes: false, inertia: false, interactive: false, interactiveBorder: 2, interactiveDebounce: 0, lazy: true, maxWidth: 750, // TODO: Dunno. multiple: false, offset: 0, onCreate: function onCreate() {}, onHidden: function onHidden() {}, onHide: function onHide() {}, onMount: function onMount() {}, onShow: function onShow() {}, onShown: function onShown() {}, onTrigger: function onTrigger() {}, onUntrigger: function onUntrigger() {}, placement: 'top', popperOptions: {}, role: 'tooltip', showOnCreate: false, sticky: false, theme: '', touch: true, trigger: 'mouseenter focus', triggerTarget: null, updateDuration: 0, zIndex: 999901 /** * If the setProps() method encounters one of these, the popperInstance must be * recreated */ }; var POPPER_INSTANCE_DEPENDENCIES = ['arrow', 'boundary', 'distance', 'flip', 'flipBehavior', 'flipOnUpdate', 'offset', 'placement', 'popperOptions']; var PASSIVE = { passive: true }; var PREVENT_OVERFLOW_PADDING = 5; var ROUND_ARROW_INNER_HTML = '<svg viewBox="0 0 18 7" xmlns="http://www.w3.org/2000/svg"><path d="M0 7s2.021-.015 5.253-4.218C6.584 1.051 7.797.007 9 0c1.203-.007 2.416 1.035 3.761 2.782C16.012 7.005 18 7 18 7H0z"/></svg>'; var IOS_CLASS = "tippy-iOS"; var POPPER_CLASS = "tippy-popper"; var TOOLTIP_CLASS = "tippy-tooltip"; var CONTENT_CLASS = "tippy-content"; var BACKDROP_CLASS = "tippy-backdrop"; var ARROW_CLASS = "tippy-arrow"; var SVG_ARROW_CLASS = "tippy-svg-arrow"; var POPPER_SELECTOR = "." + POPPER_CLASS; var TOOLTIP_SELECTOR = "." + TOOLTIP_CLASS; var CONTENT_SELECTOR = "." + CONTENT_CLASS; var BACKDROP_SELECTOR = "." + BACKDROP_CLASS; var ARROW_SELECTOR = "." + ARROW_CLASS; var SVG_ARROW_SELECTOR = "." + SVG_ARROW_CLASS; // TODO: Work out best way to make these updateable var currentInput = { isTouch: false }; var lastMouseMoveTime = 0; /** * When a `touchstart` event is fired, it's assumed the user is using touch * input. We'll bind a `mousemove` event listener to listen for mouse input in * the future. This way, the `isTouch` property is fully dynamic and will handle * hybrid devices that use a mix of touch + mouse input. */ function onDocumentTouchStart() { if (currentInput.isTouch) { return; } currentInput.isTouch = true; if (isIOS) { document.body.classList.add(IOS_CLASS); } if (window.performance) { document.addEventListener('mousemove', onDocumentMouseMove); } } /** * When two `mousemove` event are fired consecutively within 20ms, it's assumed * the user is using mouse input again. `mousemove` can fire on touch devices as * well, but very rarely that quickly. */ function onDocumentMouseMove() { var now = performance.now(); if (now - lastMouseMoveTime < 20) { currentInput.isTouch = false; document.removeEventListener('mousemove', onDocumentMouseMove); if (!isIOS) { document.body.classList.remove(IOS_CLASS); } } lastMouseMoveTime = now; } /** * When an element is in focus and has a tippy, leaving the tab/window and * returning causes it to show again. For mouse users this is unexpected, but * for keyboard use it makes sense. * TODO: find a better technique to solve this problem */ function onWindowBlur() { var _document = document, activeElement = _document.activeElement; var instance = activeElement._tippy; if (activeElement && activeElement.blur && instance && !instance.state.isVisible) { activeElement.blur(); } } /** * Adds the needed global event listeners */ function bindGlobalEventListeners() { document.addEventListener('touchstart', onDocumentTouchStart, _extends$1({}, PASSIVE, { capture: true })); window.addEventListener('blur', onWindowBlur); } var keys$2 = Object.keys(defaultProps); /** * Returns an object of optional props from data-tippy-* attributes */ function getDataAttributeProps(reference) { var props = keys$2.reduce(function (acc, key) { var valueAsString = (reference.getAttribute("data-tippy-" + key) || '').trim(); if (!valueAsString) { return acc; } if (key === 'content') { acc[key] = valueAsString; } else { try { acc[key] = JSON.parse(valueAsString); } catch (e) { acc[key] = valueAsString; } } return acc; }, {}); return props; } /** * Determines if the value is a reference element */ function isReferenceElement(value) { return !!(value && value._tippy && !value.classList.contains(POPPER_CLASS)); } /** * Safe .hasOwnProperty check, for prototype-less objects */ function hasOwnProperty$1(obj, key) { return {}.hasOwnProperty.call(obj, key); } /** * Returns an array of elements based on the value */ function getArrayOfElements(value) { if (isRealElement(value)) { return [value]; } if (value instanceof NodeList) { return arrayFrom(value); } if (Array.isArray(value)) { return value; } return arrayFrom(document.querySelectorAll(value)); } /** * Returns a value at a given index depending on if it's an array or number */ function getValueAtIndexOrReturn(value, index, defaultValue) { if (Array.isArray(value)) { var v = value[index]; return v == null ? Array.isArray(defaultValue) ? defaultValue[index] : defaultValue : v; } return value; } /** * Prevents errors from being thrown while accessing nested modifier objects * in `popperOptions` */ function getModifier(obj, key) { return obj && obj.modifiers && obj.modifiers[key]; } /** * Determines if the value is a real element */ function isRealElement(value) { return value instanceof Element; } /** * Firefox extensions don't allow setting .innerHTML directly, this will trick * it */ function innerHTML() { return 'innerHTML'; } /** * Evaluates a function if one, or returns the value */ function invokeWithArgsOrReturn(value, args) { return typeof value === 'function' ? value.apply(null, args) : value; } /** * Sets a popperInstance `flip` modifier's enabled state */ function setFlipModifierEnabled(modifiers, value) { modifiers.filter(function (m) { return m.name === 'flip'; })[0].enabled = value; } /** * Returns a new `div` element */ function div() { return document.createElement('div'); } /** * Applies a transition duration to a list of elements */ function setTransitionDuration(els, value) { els.forEach(function (el) { if (el) { el.style.transitionDuration = value + "ms"; } }); } /** * Sets the visibility state to elements so they can begin to transition */ function setVisibilityState(els, state) { els.forEach(function (el) { if (el) { el.setAttribute('data-state', state); } }); } /** * Evaluates the props object by merging data attributes and disabling * conflicting props where necessary */ function evaluateProps(reference, props) { var out = _extends$1({}, props, { content: invokeWithArgsOrReturn(props.content, [reference]) }, props.ignoreAttributes ? {} : getDataAttributeProps(reference)); if (out.animateFill) { out.arrow = false; } if (out.arrow || isUCBrowser) { out.animateFill = false; } return out; } /** * Debounce utility. To avoid bloating bundle size, we're only passing 1 * argument here, a more generic function would pass all arguments. Only * `onMouseMove` uses this which takes the event object for now. */ function debounce(fn, ms) { // Avoid wrapping in `setTimeout` if ms is 0 anyway if (ms === 0) { return fn; } var timeout; return function (arg) { clearTimeout(timeout); timeout = setTimeout(function () { fn(arg); }, ms); }; } /** * Preserves the original function invocation when another function replaces it */ function preserveInvocation(originalFn, currentFn, args) { if (originalFn && originalFn !== currentFn) { originalFn.apply(null, args); } } /** * Ponyfill for Array.from - converts iterable values to an array */ function arrayFrom(value) { return [].slice.call(value); } /** * Works like Element.prototype.closest, but uses a callback instead */ function closestCallback(element, callback) { while (element) { if (callback(element)) { return element; } element = element.parentElement; } return null; } /** * Determines if an array or string includes a string */ function includes(a, b) { return a.indexOf(b) > -1; } /** * Sets the innerHTML of an element */ function setInnerHTML(element, html) { element[innerHTML()] = isRealElement(html) ? html[innerHTML()] : html; } /** * Sets the content of a tooltip */ function setContent(contentEl, props) { if (isRealElement(props.content)) { setInnerHTML(contentEl, ''); contentEl.appendChild(props.content); } else if (typeof props.content !== 'function') { var key = props.allowHTML ? 'innerHTML' : 'textContent'; contentEl[key] = props.content; } } /** * Returns the child elements of a popper element */ function getChildren(popper) { return { tooltip: popper.querySelector(TOOLTIP_SELECTOR), backdrop: popper.querySelector(BACKDROP_SELECTOR), content: popper.querySelector(CONTENT_SELECTOR), arrow: popper.querySelector(ARROW_SELECTOR) || popper.querySelector(SVG_ARROW_SELECTOR) }; } /** * Adds `data-inertia` attribute */ function addInertia(tooltip) { tooltip.setAttribute('data-inertia', ''); } /** * Removes `data-inertia` attribute */ function removeInertia(tooltip) { tooltip.removeAttribute('data-inertia'); } /** * Creates an arrow element and returns it */ function createArrowElement(arrow) { var arrowElement = div(); if (arrow === true) { arrowElement.className = ARROW_CLASS; } else { arrowElement.className = SVG_ARROW_CLASS; if (isRealElement(arrow)) { arrowElement.appendChild(arrow); } else { setInnerHTML(arrowElement, arrow === 'round' ? ROUND_ARROW_INNER_HTML : arrow); } } return arrowElement; } /** * Creates a backdrop element and returns it */ function createBackdropElement(isVisible) { var backdrop = div(); backdrop.className = BACKDROP_CLASS; backdrop.setAttribute('data-state', isVisible ? 'visible' : 'hidden'); return backdrop; } /** * Adds interactive-related attributes */ function addInteractive(tooltip) { tooltip.setAttribute('data-interactive', ''); } /** * Removes interactive-related attributes */ function removeInteractive(tooltip) { tooltip.removeAttribute('data-interactive'); } /** * Add/remove transitionend listener from tooltip */ function updateTransitionEndListener(tooltip, action, listener) { var eventName = isUCBrowser && document.body.style.webkitTransition !== undefined ? 'webkitTransitionEnd' : 'transitionend'; tooltip[action + 'EventListener'](eventName, listener); } /** * Returns the popper's placement, ignoring shifting (top-start, etc) */ function getBasePlacement(placement) { return placement.split('-')[0]; } /** * Triggers reflow */ function reflow(popper) { void popper.offsetHeight; } /** * Adds/removes theme from tooltip's classList */ function updateTheme(tooltip, action, theme) { theme.split(' ').forEach(function (name) { if (name) { tooltip.classList[action](name + "-theme"); } }); } /** * Constructs the popper element and returns it */ function createPopperElement(id, props) { var popper = div(); popper.className = POPPER_CLASS; popper.style.position = 'absolute'; popper.style.top = '0'; popper.style.left = '0'; var tooltip = div(); tooltip.className = TOOLTIP_CLASS; tooltip.id = "tippy-" + id; tooltip.setAttribute('data-state', 'hidden'); tooltip.setAttribute('tabindex', '-1'); updateTheme(tooltip, 'add', props.theme); var content = div(); content.className = CONTENT_CLASS; content.setAttribute('data-state', 'hidden'); if (props.interactive) { addInteractive(tooltip); } if (props.arrow) { tooltip.setAttribute('data-arrow', ''); tooltip.appendChild(createArrowElement(props.arrow)); } if (props.animateFill) { tooltip.appendChild(createBackdropElement(false)); tooltip.setAttribute('data-animatefill', ''); } if (props.inertia) { addInertia(tooltip); } setContent(content, props); tooltip.appendChild(content); popper.appendChild(tooltip); updatePopperElement(popper, props, props, false); return popper; } /** * Updates the popper element based on the new props */ function updatePopperElement(popper, prevProps, nextProps, isVisible) { var _getChildren = getChildren(popper), tooltip = _getChildren.tooltip, content = _getChildren.content, backdrop = _getChildren.backdrop, arrow = _getChildren.arrow; popper.style.zIndex = '' + nextProps.zIndex; tooltip.setAttribute('data-animation', nextProps.animation); tooltip.style.maxWidth = nextProps.maxWidth + (typeof nextProps.maxWidth === 'number' ? 'px' : ''); if (nextProps.role) { tooltip.setAttribute('role', nextProps.role); } else { tooltip.removeAttribute('role'); } if (prevProps.content !== nextProps.content) { setContent(content, nextProps); } // animateFill if (!prevProps.animateFill && nextProps.animateFill) { tooltip.appendChild(createBackdropElement(isVisible)); tooltip.setAttribute('data-animatefill', ''); } else if (prevProps.animateFill && !nextProps.animateFill) { tooltip.removeChild(backdrop); tooltip.removeAttribute('data-animatefill'); } // arrow if (!prevProps.arrow && nextProps.arrow) { // false to true tooltip.appendChild(createArrowElement(nextProps.arrow)); tooltip.setAttribute('data-arrow', ''); } else if (prevProps.arrow && !nextProps.arrow) { // true to false tooltip.removeChild(arrow); tooltip.removeAttribute('data-arrow'); } else if (prevProps.arrow !== nextProps.arrow) { // true to 'round' or vice-versa tooltip.removeChild(arrow); tooltip.appendChild(createArrowElement(nextProps.arrow)); } // interactive if (!prevProps.interactive && nextProps.interactive) { addInteractive(tooltip); } else if (prevProps.interactive && !nextProps.interactive) { removeInteractive(tooltip); } // inertia if (!prevProps.inertia && nextProps.inertia) { addInertia(tooltip); } else if (prevProps.inertia && !nextProps.inertia) { removeInertia(tooltip); } // theme if (prevProps.theme !== nextProps.theme) { updateTheme(tooltip, 'remove', prevProps.theme); updateTheme(tooltip, 'add', nextProps.theme); } } /** * Determines if the mouse cursor is outside of the popper's interactive border * region */ function isCursorOutsideInteractiveBorder(popperPlacement, popperRect, event, props) { if (!popperPlacement) { return true; } var x = event.clientX, y = event.clientY; var interactiveBorder = props.interactiveBorder, distance = props.distance; var exceedsTop = popperRect.top - y > (popperPlacement === 'top' ? interactiveBorder + distance : interactiveBorder); var exceedsBottom = y - popperRect.bottom > (popperPlacement === 'bottom' ? interactiveBorder + distance : interactiveBorder); var exceedsLeft = popperRect.left - x > (popperPlacement === 'left' ? interactiveBorder + distance : interactiveBorder); var exceedsRight = x - popperRect.right > (popperPlacement === 'right' ? interactiveBorder + distance : interactiveBorder); return exceedsTop || exceedsBottom || exceedsLeft || exceedsRight; } /**! * @fileOverview Kickass library to create and place poppers near their reference elements. * @version 1.15.0 * @license * Copyright (c) 2016 Federico Zivolo and contributors * * Permission is hereby granted, free of charge, to any person obtaining a copy * of this software and associated documentation files (the "Software"), to deal * in the Software without restriction, including without limitation the rights * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell * copies of the Software, and to permit persons to whom the Software is * furnished to do so, subject to the following conditions: * * The above copyright notice and this permission notice shall be included in all * copies or substantial portions of the Software. * * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE * SOFTWARE. */ var isBrowser$1 = typeof window !== 'undefined' && typeof document !== 'undefined'; var longerTimeoutBrowsers = ['Edge', 'Trident', 'Firefox']; var timeoutDuration = 0; for (var i = 0; i < longerTimeoutBrowsers.length; i += 1) { if (isBrowser$1 && navigator.userAgent.indexOf(longerTimeoutBrowsers[i]) >= 0) { timeoutDuration = 1; break; } } function microtaskDebounce(fn) { var called = false; return function () { if (called) { return; } called = true; window.Promise.resolve().then(function () { called = false; fn(); }); }; } function taskDebounce(fn) { var scheduled = false; return function () { if (!scheduled) { scheduled = true; setTimeout(function () { scheduled = false; fn(); }, timeoutDuration); } }; } var supportsMicroTasks = isBrowser$1 && window.Promise; /** * Create a debounced version of a method, that's asynchronously deferred * but called in the minimum time possible. * * @method * @memberof Popper.Utils * @argument {Function} fn * @returns {Function} */ var debounce$1 = supportsMicroTasks ? microtaskDebounce : taskDebounce; /** * Check if the given variable is a function * @method * @memberof Popper.Utils * @argument {Any} functionToCheck - variable to check * @returns {Boolean} answer to: is a function? */ function isFunction$1(functionToCheck) { var getType = {}; return functionToCheck && getType.toString.call(functionToCheck) === '[object Function]'; } /** * Get CSS computed property of the given element * @method * @memberof Popper.Utils * @argument {Eement} element * @argument {String} property */ function getStyleComputedProperty(element, property) { if (element.nodeType !== 1) { return []; } // NOTE: 1 DOM access here var window = element.ownerDocument.defaultView; var css = window.getComputedStyle(element, null); return property ? css[property] : css; } /** * Returns the parentNode or the host of the element * @method * @memberof Popper.Utils * @argument {Element} element * @returns {Element} parent */ function getParentNode(element) { if (element.nodeName === 'HTML') { return element; } return element.parentNode || element.host; } /** * Returns the scrolling parent of the given element * @method * @memberof Popper.Utils * @argument {Element} element * @returns {Element} scroll parent */ function getScrollParent(element) { // Return body, `getScroll` will take care to get the correct `scrollTop` from it if (!element) { return document.body; } switch (element.nodeName) { case 'HTML': case 'BODY': return element.ownerDocument.body; case '#document': return element.body; } // Firefox want us to check `-x` and `-y` variations as well var _getStyleComputedProp = getStyleComputedProperty(element), overflow = _getStyleComputedProp.overflow, overflowX = _getStyleComputedProp.overflowX, overflowY = _getStyleComputedProp.overflowY; if (/(auto|scroll|overlay)/.test(overflow + overflowY + overflowX)) { return element; } return getScrollParent(getParentNode(element)); } var isIE11 = isBrowser$1 && !!(window.MSInputMethodContext && document.documentMode); var isIE10 = isBrowser$1 && /MSIE 10/.test(navigator.userAgent); /** * Determines if the browser is Internet Explorer * @method * @memberof Popper.Utils * @param {Number} version to check * @returns {Boolean} isIE */ function isIE$1(version) { if (version === 11) { return isIE11; } if (version === 10) { return isIE10; } return isIE11 || isIE10; } /** * Returns the offset parent of the given element * @method * @memberof Popper.Utils * @argument {Element} element * @returns {Element} offset parent */ function getOffsetParent(element) { if (!element) { return document.documentElement; } var noOffsetParent = isIE$1(10) ? document.body : null; // NOTE: 1 DOM access here var offsetParent = element.offsetParent || null; // Skip hidden elements which don't have an offsetParent while (offsetParent === noOffsetParent && element.nextElementSibling) { offsetParent = (element = element.nextElementSibling).offsetParent; } var nodeName = offsetParent && offsetParent.nodeName; if (!nodeName || nodeName === 'BODY' || nodeName === 'HTML') { return element ? element.ownerDocument.documentElement : document.documentElement; } // .offsetParent will return the closest TH, TD or TABLE in case // no offsetParent is present, I hate this job... if (['TH', 'TD', 'TABLE'].indexOf(offsetParent.nodeName) !== -1 && getStyleComputedProperty(offsetParent, 'position') === 'static') { return getOffsetParent(offsetParent); } return offsetParent; } function isOffsetContainer(element) { var nodeName = element.nodeName; if (nodeName === 'BODY') { return false; } return nodeName === 'HTML' || getOffsetParent(element.firstElementChild) === element; } /** * Finds the root node (document, shadowDOM root) of the given element * @method * @memberof Popper.Utils * @argument {Element} node * @returns {Element} root node */ function getRoot(node) { if (node.parentNode !== null) { return getRoot(node.parentNode); } return node; } /** * Finds the offset parent common to the two provided nodes * @method * @memberof Popper.Utils * @argument {Element} element1 * @argument {Element} element2 * @returns {Element} common offset parent */ function findCommonOffsetParent(element1, element2) { // This check is needed to avoid errors in case one of the elements isn't defined for any reason if (!element1 || !element1.nodeType || !element2 || !element2.nodeType) { return document.documentElement; } // Here we make sure to give as "start" the element that comes first in the DOM var order = element1.compareDocumentPosition(element2) & Node.DOCUMENT_POSITION_FOLLOWING; var start = order ? element1 : element2; var end = order ? element2 : element1; // Get common ancestor container var range = document.createRange(); range.setStart(start, 0); range.setEnd(end, 0); var commonAncestorContainer = range.commonAncestorContainer; // Both nodes are inside #document if (element1 !== commonAncestorContainer && element2 !== commonAncestorContainer || start.contains(end)) { if (isOffsetContainer(commonAncestorContainer)) { return commonAncestorContainer; } return getOffsetParent(commonAncestorContainer); } // one of the nodes is inside shadowDOM, find which one var element1root = getRoot(element1); if (element1root.host) { return findCommonOffsetParent(element1root.host, element2); } else { return findCommonOffsetParent(element1, getRoot(element2).host); } } /** * Gets the scroll value of the given element in the given side (top and left) * @method * @memberof Popper.Utils * @argument {Element} element * @argument {String} side `top` or `left` * @returns {number} amount of scrolled pixels */ function getScroll(element) { var side = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 'top'; var upperSide = side === 'top' ? 'scrollTop' : 'scrollLeft'; var nodeName = element.nodeName; if (nodeName === 'BODY' || nodeName === 'HTML') { var html = element.ownerDocument.documentElement; var scrollingElement = element.ownerDocument.scrollingElement || html; return scrollingElement[upperSide]; } return element[upperSide]; } /* * Sum or subtract the element scroll values (left and top) from a given rect object * @method * @memberof Popper.Utils * @param {Object} rect - Rect object you want to change * @param {HTMLElement} element - The element from the function reads the scroll values * @param {Boolean} subtract - set to true if you want to subtract the scroll values * @return {Object} rect - The modifier rect object */ function includeScroll(rect, element) { var subtract = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false; var scrollTop = getScroll(element, 'top'); var scrollLeft = getScroll(element, 'left'); var modifier = subtract ? -1 : 1; rect.top += scrollTop * modifier; rect.bottom += scrollTop * modifier; rect.left += scrollLeft * modifier; rect.right += scrollLeft * modifier; return rect; } /* * Helper to detect borders of a given element * @method * @memberof Popper.Utils * @param {CSSStyleDeclaration} styles * Result of `getStyleComputedProperty` on the given element * @param {String} axis - `x` or `y` * @return {number} borders - The borders size of the given axis */ function getBordersSize(styles, axis) { var sideA = axis === 'x' ? 'Left' : 'Top'; var sideB = sideA === 'Left' ? 'Right' : 'Bottom'; return parseFloat(styles['border' + sideA + 'Width'], 10) + parseFloat(styles['border' + sideB + 'Width'], 10); } function getSize(axis, body, html, computedStyle) { return Math.max(body['offset' + axis], body['scroll' + axis], html['client' + axis], html['offset' + axis], html['scroll' + axis], isIE$1(10) ? parseInt(html['offset' + axis]) + parseInt(computedStyle['margin' + (axis === 'Height' ? 'Top' : 'Left')]) + parseInt(computedStyle['margin' + (axis === 'Height' ? 'Bottom' : 'Right')]) : 0); } function getWindowSizes(document) { var body = document.body; var html = document.documentElement; var computedStyle = isIE$1(10) && getComputedStyle(html); return { height: getSize('Height', body, html, computedStyle), width: getSize('Width', body, html, computedStyle) }; } var classCallCheck = function (instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } }; var createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); var defineProperty$1 = function (obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }; var _extends$2 = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; /** * Given element offsets, generate an output similar to getBoundingClientRect * @method * @memberof Popper.Utils * @argument {Object} offsets * @returns {Object} ClientRect like output */ function getClientRect(offsets) { return _extends$2({}, offsets, { right: offsets.left + offsets.width, bottom: offsets.top + offsets.height }); } /** * Get bounding client rect of given element * @method * @memberof Popper.Utils * @param {HTMLElement} element * @return {Object} client rect */ function getBoundingClientRect(element) { var rect = {}; // IE10 10 FIX: Please, don't ask, the element isn't // considered in DOM in some circumstances... // This isn't reproducible in IE10 compatibility mode of IE11 try { if (isIE$1(10)) { rect = element.getBoundingClientRect(); var scrollTop = getScroll(element, 'top'); var scrollLeft = getScroll(element, 'left'); rect.top += scrollTop; rect.left += scrollLeft; rect.bottom += scrollTop; rect.right += scrollLeft; } else { rect = element.getBoundingClientRect(); } } catch (e) {} var result = { left: rect.left, top: rect.top, width: rect.right - rect.left, height: rect.bottom - rect.top }; // subtract scrollbar size from sizes var sizes = element.nodeName === 'HTML' ? getWindowSizes(element.ownerDocument) : {}; var width = sizes.width || element.clientWidth || result.right - result.left; var height = sizes.height || element.clientHeight || result.bottom - result.top; var horizScrollbar = element.offsetWidth - width; var vertScrollbar = element.offsetHeight - height; // if an hypothetical scrollbar is detected, we must be sure it's not a `border` // we make this check conditional for performance reasons if (horizScrollbar || vertScrollbar) { var styles = getStyleComputedProperty(element); horizScrollbar -= getBordersSize(styles, 'x'); vertScrollbar -= getBordersSize(styles, 'y'); result.width -= horizScrollbar; result.height -= vertScrollbar; } return getClientRect(result); } function getOffsetRectRelativeToArbitraryNode(children, parent) { var fixedPosition = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false; var isIE10 = isIE$1(10); var isHTML = parent.nodeName === 'HTML'; var childrenRect = getBoundingClientRect(children); var parentRect = getBoundingClientRect(parent); var scrollParent = getScrollParent(children); var styles = getStyleComputedProperty(parent); var borderTopWidth = parseFloat(styles.borderTopWidth, 10); var borderLeftWidth = parseFloat(styles.borderLeftWidth, 10); // In cases where the parent is fixed, we must ignore negative scroll in offset calc if (fixedPosition && isHTML) { parentRect.top = Math.max(parentRect.top, 0); parentRect.left = Math.max(parentRect.left, 0); } var offsets = getClientRect({ top: childrenRect.top - parentRect.top - borderTopWidth, left: childrenRect.left - parentRect.left - borderLeftWidth, width: childrenRect.width, height: childrenRect.height }); offsets.marginTop = 0; offsets.marginLeft = 0; // Subtract margins of documentElement in case it's being used as parent // we do this only on HTML because it's the only element that behaves // differently when margins are applied to it. The margins are included in // the box of the documentElement, in the other cases not. if (!isIE10 && isHTML) { var marginTop = parseFloat(styles.marginTop, 10); var marginLeft = parseFloat(styles.marginLeft, 10); offsets.top -= borderTopWidth - marginTop; offsets.bottom -= borderTopWidth - marginTop; offsets.left -= borderLeftWidth - marginLeft; offsets.right -= borderLeftWidth - marginLeft; // Attach marginTop and marginLeft because in some circumstances we may need them offsets.marginTop = marginTop; offsets.marginLeft = marginLeft; } if (isIE10 && !fixedPosition ? parent.contains(scrollParent) : parent === scrollParent && scrollParent.nodeName !== 'BODY') { offsets = includeScroll(offsets, parent); } return offsets; } function getViewportOffsetRectRelativeToArtbitraryNode(element) { var excludeScroll = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false; var html = element.ownerDocument.documentElement; var relativeOffset = getOffsetRectRelativeToArbitraryNode(element, html); var width = Math.max(html.clientWidth, window.innerWidth || 0); var height = Math.max(html.clientHeight, window.innerHeight || 0); var scrollTop = !excludeScroll ? getScroll(html) : 0; var scrollLeft = !excludeScroll ? getScroll(html, 'left') : 0; var offset = { top: scrollTop - relativeOffset.top + relativeOffset.marginTop, left: scrollLeft - relativeOffset.left + relativeOffset.marginLeft, width: width, height: height }; return getClientRect(offset); } /** * Check if the given element is fixed or is inside a fixed parent * @method * @memberof Popper.Utils * @argument {Element} element * @argument {Element} customContainer * @returns {Boolean} answer to "isFixed?" */ function isFixed(element) { var nodeName = element.nodeName; if (nodeName === 'BODY' || nodeName === 'HTML') { return false; } if (getStyleComputedProperty(element, 'position') === 'fixed') { return true; } var parentNode = getParentNode(element); if (!parentNode) { return false; } return isFixed(parentNode); } /** * Finds the first parent of an element that has a transformed property defined * @method * @memberof Popper.Utils * @argument {Element} element * @returns {Element} first transformed parent or documentElement */ function getFixedPositionOffsetParent(element) { // This check is needed to avoid errors in case one of the elements isn't defined for any reason if (!element || !element.parentElement || isIE$1()) { return document.documentElement; } var el = element.parentElement; while (el && getStyleComputedProperty(el, 'transform') === 'none') { el = el.parentElement; } return el || document.documentElement; } /** * Computed the boundaries limits and return them * @method * @memberof Popper.Utils * @param {HTMLElement} popper * @param {HTMLElement} reference * @param {number} padding * @param {HTMLElement} boundariesElement - Element used to define the boundaries * @param {Boolean} fixedPosition - Is in fixed position mode * @returns {Object} Coordinates of the boundaries */ function getBoundaries(popper, reference, padding, boundariesElement) { var fixedPosition = arguments.length > 4 && arguments[4] !== undefined ? arguments[4] : false; // NOTE: 1 DOM access here var boundaries = { top: 0, left: 0 }; var offsetParent = fixedPosition ? getFixedPositionOffsetParent(popper) : findCommonOffsetParent(popper, reference); // Handle viewport case if (boundariesElement === 'viewport') { boundaries = getViewportOffsetRectRelativeToArtbitraryNode(offsetParent, fixedPosition); } else { // Handle other cases based on DOM element used as boundaries var boundariesNode = void 0; if (boundariesElement === 'scrollParent') { boundariesNode = getScrollParent(getParentNode(reference)); if (boundariesNode.nodeName === 'BODY') { boundariesNode = popper.ownerDocument.documentElement; } } else if (boundariesElement === 'window') { boundariesNode = popper.ownerDocument.documentElement; } else { boundariesNode = boundariesElement; } var offsets = getOffsetRectRelativeToArbitraryNode(boundariesNode, offsetParent, fixedPosition); // In case of HTML, we need a different computation if (boundariesNode.nodeName === 'HTML' && !isFixed(offsetParent)) { var _getWindowSizes = getWindowSizes(popper.ownerDocument), height = _getWindowSizes.height, width = _getWindowSizes.width; boundaries.top += offsets.top - offsets.marginTop; boundaries.bottom = height + offsets.top; boundaries.left += offsets.left - offsets.marginLeft; boundaries.right = width + offsets.left; } else { // for all the other DOM elements, this one is good boundaries = offsets; } } // Add paddings padding = padding || 0; var isPaddingNumber = typeof padding === 'number'; boundaries.left += isPaddingNumber ? padding : padding.left || 0; boundaries.top += isPaddingNumber ? padding : padding.top || 0; boundaries.right -= isPaddingNumber ? padding : padding.right || 0; boundaries.bottom -= isPaddingNumber ? padding : padding.bottom || 0; return boundaries; } function getArea(_ref) { var width = _ref.width, height = _ref.height; return width * height; } /** * Utility used to transform the `auto` placement to the placement with more * available space. * @method * @memberof Popper.Utils * @argument {Object} data - The data object generated by update method * @argument {Object} options - Modifiers configuration and options * @returns {Object} The data object, properly modified */ function computeAutoPlacement(placement, refRect, popper, reference, boundariesElement) { var padding = arguments.length > 5 && arguments[5] !== undefined ? arguments[5] : 0; if (placement.indexOf('auto') === -1) { return placement; } var boundaries = getBoundaries(popper, reference, padding, boundariesElement); var rects = { top: { width: boundaries.width, height: refRect.top - boundaries.top }, right: { width: boundaries.right - refRect.right, height: boundaries.height }, bottom: { width: boundaries.width, height: boundaries.bottom - refRect.bottom }, left: { width: refRect.left - boundaries.left, height: boundaries.height } }; var sortedAreas = Object.keys(rects).map(function (key) { return _extends$2({ key: key }, rects[key], { area: getArea(rects[key]) }); }).sort(function (a, b) { return b.area - a.area; }); var filteredAreas = sortedAreas.filter(function (_ref2) { var width = _ref2.width, height = _ref2.height; return width >= popper.clientWidth && height >= popper.clientHeight; }); var computedPlacement = filteredAreas.length > 0 ? filteredAreas[0].key : sortedAreas[0].key; var variation = placement.split('-')[1]; return computedPlacement + (variation ? '-' + variation : ''); } /** * Get offsets to the reference element * @method * @memberof Popper.Utils * @param {Object} state * @param {Element} popper - the popper element * @param {Element} reference - the reference element (the popper will be relative to this) * @param {Element} fixedPosition - is in fixed position mode * @returns {Object} An object containing the offsets which will be applied to the popper */ function getReferenceOffsets(state, popper, reference) { var fixedPosition = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : null; var commonOffsetParent = fixedPosition ? getFixedPositionOffsetParent(popper) : findCommonOffsetParent(popper, reference); return getOffsetRectRelativeToArbitraryNode(reference, commonOffsetParent, fixedPosition); } /** * Get the outer sizes of the given element (offset size + margins) * @method * @memberof Popper.Utils * @argument {Element} element * @returns {Object} object containing width and height properties */ function getOuterSizes(element) { var window = element.ownerDocument.defaultView; var styles = window.getComputedStyle(element); var x = parseFloat(styles.marginTop || 0) + parseFloat(styles.marginBottom || 0); var y = parseFloat(styles.marginLeft || 0) + parseFloat(styles.marginRight || 0); var result = { width: element.offsetWidth + y, height: element.offsetHeight + x }; return result; } /** * Get the opposite placement of the given one * @method * @memberof Popper.Utils * @argument {String} placement * @returns {String} flipped placement */ function getOppositePlacement(placement) { var hash = { left: 'right', right: 'left', bottom: 'top', top: 'bottom' }; return placement.replace(/left|right|bottom|top/g, function (matched) { return hash[matched]; }); } /** * Get offsets to the popper * @method * @memberof Popper.Utils * @param {Object} position - CSS position the Popper will get applied * @param {HTMLElement} popper - the popper element * @param {Object} referenceOffsets - the reference offsets (the popper will be relative to this) * @param {String} placement - one of the valid placement options * @returns {Object} popperOffsets - An object containing the offsets which will be applied to the popper */ function getPopperOffsets(popper, referenceOffsets, placement) { placement = placement.split('-')[0]; // Get popper node sizes var popperRect = getOuterSizes(popper); // Add position, width and height to our offsets object var popperOffsets = { width: popperRect.width, height: popperRect.height }; // depending by the popper placement we have to compute its offsets slightly differently var isHoriz = ['right', 'left'].indexOf(placement) !== -1; var mainSide = isHoriz ? 'top' : 'left'; var secondarySide = isHoriz ? 'left' : 'top'; var measurement = isHoriz ? 'height' : 'width'; var secondaryMeasurement = !isHoriz ? 'height' : 'width'; popperOffsets[mainSide] = referenceOffsets[mainSide] + referenceOffsets[measurement] / 2 - popperRect[measurement] / 2; if (placement === secondarySide) { popperOffsets[secondarySide] = referenceOffsets[secondarySide] - popperRect[secondaryMeasurement]; } else { popperOffsets[secondarySide] = referenceOffsets[getOppositePlacement(secondarySide)]; } return popperOffsets; } /** * Mimics the `find` method of Array * @method * @memberof Popper.Utils * @argument {Array} arr * @argument prop * @argument value * @returns index or -1 */ function find(arr, check) { // use native find if supported if (Array.prototype.find) { return arr.find(check); } // use `filter` to obtain the same behavior of `find` return arr.filter(check)[0]; } /** * Return the index of the matching object * @method * @memberof Popper.Utils * @argument {Array} arr * @argument prop * @argument value * @returns index or -1 */ function findIndex(arr, prop, value) { // use native findIndex if supported if (Array.prototype.findIndex) { return arr.findIndex(function (cur) { return cur[prop] === value; }); } // use `find` + `indexOf` if `findIndex` isn't supported var match = find(arr, function (obj) { return obj[prop] === value; }); return arr.indexOf(match); } /** * Loop trough the list of modifiers and run them in order, * each of them will then edit the data object. * @method * @memberof Popper.Utils * @param {dataObject} data * @param {Array} modifiers * @param {String} ends - Optional modifier name used as stopper * @returns {dataObject} */ function runModifiers(modifiers, data, ends) { var modifiersToRun = ends === undefined ? modifiers : modifiers.slice(0, findIndex(modifiers, 'name', ends)); modifiersToRun.forEach(function (modifier) { if (modifier['function']) { // eslint-disable-line dot-notation console.warn('`modifier.function` is deprecated, use `modifier.fn`!'); } var fn = modifier['function'] || modifier.fn; // eslint-disable-line dot-notation if (modifier.enabled && isFunction$1(fn)) { // Add properties to offsets to make them a complete clientRect object // we do this before each modifier to make sure the previous one doesn't // mess with these values data.offsets.popper = getClientRect(data.offsets.popper); data.offsets.reference = getClientRect(data.offsets.reference); data = fn(data, modifier); } }); return data; } /** * Updates the position of the popper, computing the new offsets and applying * the new style.<br /> * Prefer `scheduleUpdate` over `update` because of performance reasons. * @method * @memberof Popper */ function update() { // if popper is destroyed, don't perform any further update if (this.state.isDestroyed) { return; } var data = { instance: this, styles: {}, arrowStyles: {}, attributes: {}, flipped: false, offsets: {} }; // compute reference element offsets data.offsets.reference = getReferenceOffsets(this.state, this.popper, this.reference, this.options.positionFixed); // compute auto placement, store placement inside the data object, // modifiers will be able to edit `placement` if needed // and refer to originalPlacement to know the original value data.placement = computeAutoPlacement(this.options.placement, data.offsets.reference, this.popper, this.reference, this.options.modifiers.flip.boundariesElement, this.options.modifiers.flip.padding); // store the computed placement inside `originalPlacement` data.originalPlacement = data.placement; data.positionFixed = this.options.positionFixed; // compute the popper offsets data.offsets.popper = getPopperOffsets(this.popper, data.offsets.reference, data.placement); data.offsets.popper.position = this.options.positionFixed ? 'fixed' : 'absolute'; // run the modifiers data = runModifiers(this.modifiers, data); // the first `update` will call `onCreate` callback // the other ones will call `onUpdate` callback if (!this.state.isCreated) { this.state.isCreated = true; this.options.onCreate(data); } else { this.options.onUpdate(data); } } /** * Helper used to know if the given modifier is enabled. * @method * @memberof Popper.Utils * @returns {Boolean} */ function isModifierEnabled(modifiers, modifierName) { return modifiers.some(function (_ref) { var name = _ref.name, enabled = _ref.enabled; return enabled && name === modifierName; }); } /** * Get the prefixed supported property name * @method * @memberof Popper.Utils * @argument {String} property (camelCase) * @returns {String} prefixed property (camelCase or PascalCase, depending on the vendor prefix) */ function getSupportedPropertyName(property) { var prefixes = [false, 'ms', 'Webkit', 'Moz', 'O']; var upperProp = property.charAt(0).toUpperCase() + property.slice(1); for (var i = 0; i < prefixes.length; i++) { var prefix = prefixes[i]; var toCheck = prefix ? '' + prefix + upperProp : property; if (typeof document.body.style[toCheck] !== 'undefined') { return toCheck; } } return null; } /** * Destroys the popper. * @method * @memberof Popper */ function destroy() { this.state.isDestroyed = true; // touch DOM only if `applyStyle` modifier is enabled if (isModifierEnabled(this.modifiers, 'applyStyle')) { this.popper.removeAttribute('x-placement'); this.popper.style.position = ''; this.popper.style.top = ''; this.popper.style.left = ''; this.popper.style.right = ''; this.popper.style.bottom = ''; this.popper.style.willChange = ''; this.popper.style[getSupportedPropertyName('transform')] = ''; } this.disableEventListeners(); // remove the popper if user explicity asked for the deletion on destroy // do not use `remove` because IE11 doesn't support it if (this.options.removeOnDestroy) { this.popper.parentNode.removeChild(this.popper); } return this; } /** * Get the window associated with the element * @argument {Element} element * @returns {Window} */ function getWindow(element) { var ownerDocument = element.ownerDocument; return ownerDocument ? ownerDocument.defaultView : window; } function attachToScrollParents(scrollParent, event, callback, scrollParents) { var isBody = scrollParent.nodeName === 'BODY'; var target = isBody ? scrollParent.ownerDocument.defaultView : scrollParent; target.addEventListener(event, callback, { passive: true }); if (!isBody) { attachToScrollParents(getScrollParent(target.parentNode), event, callback, scrollParents); } scrollParents.push(target); } /** * Setup needed event listeners used to update the popper position * @method * @memberof Popper.Utils * @private */ function setupEventListeners(reference, options, state, updateBound) { // Resize event listener on window state.updateBound = updateBound; getWindow(reference).addEventListener('resize', state.updateBound, { passive: true }); // Scroll event listener on scroll parents var scrollElement = getScrollParent(reference); attachToScrollParents(scrollElement, 'scroll', state.updateBound, state.scrollParents); state.scrollElement = scrollElement; state.eventsEnabled = true; return state; } /** * It will add resize/scroll events and start recalculating * position of the popper element when they are triggered. * @method * @memberof Popper */ function enableEventListeners() { if (!this.state.eventsEnabled) { this.state = setupEventListeners(this.reference, this.options, this.state, this.scheduleUpdate); } } /** * Remove event listeners used to update the popper position * @method * @memberof Popper.Utils * @private */ function removeEventListeners(reference, state) { // Remove resize event listener on window getWindow(reference).removeEventListener('resize', state.updateBound); // Remove scroll event listener on scroll parents state.scrollParents.forEach(function (target) { target.removeEventListener('scroll', state.updateBound); }); // Reset state state.updateBound = null; state.scrollParents = []; state.scrollElement = null; state.eventsEnabled = false; return state; } /** * It will remove resize/scroll events and won't recalculate popper position * when they are triggered. It also won't trigger `onUpdate` callback anymore, * unless you call `update` method manually. * @method * @memberof Popper */ function disableEventListeners() { if (this.state.eventsEnabled) { cancelAnimationFrame(this.scheduleUpdate); this.state = removeEventListeners(this.reference, this.state); } } /** * Tells if a given input is a number * @method * @memberof Popper.Utils * @param {*} input to check * @return {Boolean} */ function isNumeric(n) { return n !== '' && !isNaN(parseFloat(n)) && isFinite(n); } /** * Set the style to the given popper * @method * @memberof Popper.Utils * @argument {Element} element - Element to apply the style to * @argument {Object} styles * Object with a list of properties and values which will be applied to the element */ function setStyles(element, styles) { Object.keys(styles).forEach(function (prop) { var unit = ''; // add unit if the value is numeric and is one of the following if (['width', 'height', 'top', 'right', 'bottom', 'left'].indexOf(prop) !== -1 && isNumeric(styles[prop])) { unit = 'px'; } element.style[prop] = styles[prop] + unit; }); } /** * Set the attributes to the given popper * @method * @memberof Popper.Utils * @argument {Element} element - Element to apply the attributes to * @argument {Object} styles * Object with a list of properties and values which will be applied to the element */ function setAttributes(element, attributes) { Object.keys(attributes).forEach(function (prop) { var value = attributes[prop]; if (value !== false) { element.setAttribute(prop, attributes[prop]); } else { element.removeAttribute(prop); } }); } /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by `update` method * @argument {Object} data.styles - List of style properties - values to apply to popper element * @argument {Object} data.attributes - List of attribute properties - values to apply to popper element * @argument {Object} options - Modifiers configuration and options * @returns {Object} The same data object */ function applyStyle(data) { // any property present in `data.styles` will be applied to the popper, // in this way we can make the 3rd party modifiers add custom styles to it // Be aware, modifiers could override the properties defined in the previous // lines of this modifier! setStyles(data.instance.popper, data.styles); // any property present in `data.attributes` will be applied to the popper, // they will be set as HTML attributes of the element setAttributes(data.instance.popper, data.attributes); // if arrowElement is defined and arrowStyles has some properties if (data.arrowElement && Object.keys(data.arrowStyles).length) { setStyles(data.arrowElement, data.arrowStyles); } return data; } /** * Set the x-placement attribute before everything else because it could be used * to add margins to the popper margins needs to be calculated to get the * correct popper offsets. * @method * @memberof Popper.modifiers * @param {HTMLElement} reference - The reference element used to position the popper * @param {HTMLElement} popper - The HTML element used as popper * @param {Object} options - Popper.js options */ function applyStyleOnLoad(reference, popper, options, modifierOptions, state) { // compute reference element offsets var referenceOffsets = getReferenceOffsets(state, popper, reference, options.positionFixed); // compute auto placement, store placement inside the data object, // modifiers will be able to edit `placement` if needed // and refer to originalPlacement to know the original value var placement = computeAutoPlacement(options.placement, referenceOffsets, popper, reference, options.modifiers.flip.boundariesElement, options.modifiers.flip.padding); popper.setAttribute('x-placement', placement); // Apply `position` to popper before anything else because // without the position applied we can't guarantee correct computations setStyles(popper, { position: options.positionFixed ? 'fixed' : 'absolute' }); return options; } /** * @function * @memberof Popper.Utils * @argument {Object} data - The data object generated by `update` method * @argument {Boolean} shouldRound - If the offsets should be rounded at all * @returns {Object} The popper's position offsets rounded * * The tale of pixel-perfect positioning. It's still not 100% perfect, but as * good as it can be within reason. * Discussion here: https://github.com/FezVrasta/popper.js/pull/715 * * Low DPI screens cause a popper to be blurry if not using full pixels (Safari * as well on High DPI screens). * * Firefox prefers no rounding for positioning and does not have blurriness on * high DPI screens. * * Only horizontal placement and left/right values need to be considered. */ function getRoundedOffsets(data, shouldRound) { var _data$offsets = data.offsets, popper = _data$offsets.popper, reference = _data$offsets.reference; var round = Math.round, floor = Math.floor; var noRound = function noRound(v) { return v; }; var referenceWidth = round(reference.width); var popperWidth = round(popper.width); var isVertical = ['left', 'right'].indexOf(data.placement) !== -1; var isVariation = data.placement.indexOf('-') !== -1; var sameWidthParity = referenceWidth % 2 === popperWidth % 2; var bothOddWidth = referenceWidth % 2 === 1 && popperWidth % 2 === 1; var horizontalToInteger = !shouldRound ? noRound : isVertical || isVariation || sameWidthParity ? round : floor; var verticalToInteger = !shouldRound ? noRound : round; return { left: horizontalToInteger(bothOddWidth && !isVariation && shouldRound ? popper.left - 1 : popper.left), top: verticalToInteger(popper.top), bottom: verticalToInteger(popper.bottom), right: horizontalToInteger(popper.right) }; } var isFirefox = isBrowser$1 && /Firefox/i.test(navigator.userAgent); /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by `update` method * @argument {Object} options - Modifiers configuration and options * @returns {Object} The data object, properly modified */ function computeStyle(data, options) { var x = options.x, y = options.y; var popper = data.offsets.popper; // Remove this legacy support in Popper.js v2 var legacyGpuAccelerationOption = find(data.instance.modifiers, function (modifier) { return modifier.name === 'applyStyle'; }).gpuAcceleration; if (legacyGpuAccelerationOption !== undefined) { console.warn('WARNING: `gpuAcceleration` option moved to `computeStyle` modifier and will not be supported in future versions of Popper.js!'); } var gpuAcceleration = legacyGpuAccelerationOption !== undefined ? legacyGpuAccelerationOption : options.gpuAcceleration; var offsetParent = getOffsetParent(data.instance.popper); var offsetParentRect = getBoundingClientRect(offsetParent); // Styles var styles = { position: popper.position }; var offsets = getRoundedOffsets(data, window.devicePixelRatio < 2 || !isFirefox); var sideA = x === 'bottom' ? 'top' : 'bottom'; var sideB = y === 'right' ? 'left' : 'right'; // if gpuAcceleration is set to `true` and transform is supported, // we use `translate3d` to apply the position to the popper we // automatically use the supported prefixed version if needed var prefixedProperty = getSupportedPropertyName('transform'); // now, let's make a step back and look at this code closely (wtf?) // If the content of the popper grows once it's been positioned, it // may happen that the popper gets misplaced because of the new content // overflowing its reference element // To avoid this problem, we provide two options (x and y), which allow // the consumer to define the offset origin. // If we position a popper on top of a reference element, we can set // `x` to `top` to make the popper grow towards its top instead of // its bottom. var left = void 0, top = void 0; if (sideA === 'bottom') { // when offsetParent is <html> the positioning is relative to the bottom of the screen (excluding the scrollbar) // and not the bottom of the html element if (offsetParent.nodeName === 'HTML') { top = -offsetParent.clientHeight + offsets.bottom; } else { top = -offsetParentRect.height + offsets.bottom; } } else { top = offsets.top; } if (sideB === 'right') { if (offsetParent.nodeName === 'HTML') { left = -offsetParent.clientWidth + offsets.right; } else { left = -offsetParentRect.width + offsets.right; } } else { left = offsets.left; } if (gpuAcceleration && prefixedProperty) { styles[prefixedProperty] = 'translate3d(' + left + 'px, ' + top + 'px, 0)'; styles[sideA] = 0; styles[sideB] = 0; styles.willChange = 'transform'; } else { // othwerise, we use the standard `top`, `left`, `bottom` and `right` properties var invertTop = sideA === 'bottom' ? -1 : 1; var invertLeft = sideB === 'right' ? -1 : 1; styles[sideA] = top * invertTop; styles[sideB] = left * invertLeft; styles.willChange = sideA + ', ' + sideB; } // Attributes var attributes = { 'x-placement': data.placement }; // Update `data` attributes, styles and arrowStyles data.attributes = _extends$2({}, attributes, data.attributes); data.styles = _extends$2({}, styles, data.styles); data.arrowStyles = _extends$2({}, data.offsets.arrow, data.arrowStyles); return data; } /** * Helper used to know if the given modifier depends from another one.<br /> * It checks if the needed modifier is listed and enabled. * @method * @memberof Popper.Utils * @param {Array} modifiers - list of modifiers * @param {String} requestingName - name of requesting modifier * @param {String} requestedName - name of requested modifier * @returns {Boolean} */ function isModifierRequired(modifiers, requestingName, requestedName) { var requesting = find(modifiers, function (_ref) { var name = _ref.name; return name === requestingName; }); var isRequired = !!requesting && modifiers.some(function (modifier) { return modifier.name === requestedName && modifier.enabled && modifier.order < requesting.order; }); if (!isRequired) { var _requesting = '`' + requestingName + '`'; var requested = '`' + requestedName + '`'; console.warn(requested + ' modifier is required by ' + _requesting + ' modifier in order to work, be sure to include it before ' + _requesting + '!'); } return isRequired; } /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by update method * @argument {Object} options - Modifiers configuration and options * @returns {Object} The data object, properly modified */ function arrow(data, options) { var _data$offsets$arrow; // arrow depends on keepTogether in order to work if (!isModifierRequired(data.instance.modifiers, 'arrow', 'keepTogether')) { return data; } var arrowElement = options.element; // if arrowElement is a string, suppose it's a CSS selector if (typeof arrowElement === 'string') { arrowElement = data.instance.popper.querySelector(arrowElement); // if arrowElement is not found, don't run the modifier if (!arrowElement) { return data; } } else { // if the arrowElement isn't a query selector we must check that the // provided DOM node is child of its popper node if (!data.instance.popper.contains(arrowElement)) { console.warn('WARNING: `arrow.element` must be child of its popper element!'); return data; } } var placement = data.placement.split('-')[0]; var _data$offsets = data.offsets, popper = _data$offsets.popper, reference = _data$offsets.reference; var isVertical = ['left', 'right'].indexOf(placement) !== -1; var len = isVertical ? 'height' : 'width'; var sideCapitalized = isVertical ? 'Top' : 'Left'; var side = sideCapitalized.toLowerCase(); var altSide = isVertical ? 'left' : 'top'; var opSide = isVertical ? 'bottom' : 'right'; var arrowElementSize = getOuterSizes(arrowElement)[len]; // // extends keepTogether behavior making sure the popper and its // reference have enough pixels in conjunction // // top/left side if (reference[opSide] - arrowElementSize < popper[side]) { data.offsets.popper[side] -= popper[side] - (reference[opSide] - arrowElementSize); } // bottom/right side if (reference[side] + arrowElementSize > popper[opSide]) { data.offsets.popper[side] += reference[side] + arrowElementSize - popper[opSide]; } data.offsets.popper = getClientRect(data.offsets.popper); // compute center of the popper var center = reference[side] + reference[len] / 2 - arrowElementSize / 2; // Compute the sideValue using the updated popper offsets // take popper margin in account because we don't have this info available var css = getStyleComputedProperty(data.instance.popper); var popperMarginSide = parseFloat(css['margin' + sideCapitalized], 10); var popperBorderSide = parseFloat(css['border' + sideCapitalized + 'Width'], 10); var sideValue = center - data.offsets.popper[side] - popperMarginSide - popperBorderSide; // prevent arrowElement from being placed not contiguously to its popper sideValue = Math.max(Math.min(popper[len] - arrowElementSize, sideValue), 0); data.arrowElement = arrowElement; data.offsets.arrow = (_data$offsets$arrow = {}, defineProperty$1(_data$offsets$arrow, side, Math.round(sideValue)), defineProperty$1(_data$offsets$arrow, altSide, ''), _data$offsets$arrow); return data; } /** * Get the opposite placement variation of the given one * @method * @memberof Popper.Utils * @argument {String} placement variation * @returns {String} flipped placement variation */ function getOppositeVariation(variation) { if (variation === 'end') { return 'start'; } else if (variation === 'start') { return 'end'; } return variation; } /** * List of accepted placements to use as values of the `placement` option.<br /> * Valid placements are: * - `auto` * - `top` * - `right` * - `bottom` * - `left` * * Each placement can have a variation from this list: * - `-start` * - `-end` * * Variations are interpreted easily if you think of them as the left to right * written languages. Horizontally (`top` and `bottom`), `start` is left and `end` * is right.<br /> * Vertically (`left` and `right`), `start` is top and `end` is bottom. * * Some valid examples are: * - `top-end` (on top of reference, right aligned) * - `right-start` (on right of reference, top aligned) * - `bottom` (on bottom, centered) * - `auto-end` (on the side with more space available, alignment depends by placement) * * @static * @type {Array} * @enum {String} * @readonly * @method placements * @memberof Popper */ var placements = ['auto-start', 'auto', 'auto-end', 'top-start', 'top', 'top-end', 'right-start', 'right', 'right-end', 'bottom-end', 'bottom', 'bottom-start', 'left-end', 'left', 'left-start']; // Get rid of `auto` `auto-start` and `auto-end` var validPlacements = placements.slice(3); /** * Given an initial placement, returns all the subsequent placements * clockwise (or counter-clockwise). * * @method * @memberof Popper.Utils * @argument {String} placement - A valid placement (it accepts variations) * @argument {Boolean} counter - Set to true to walk the placements counterclockwise * @returns {Array} placements including their variations */ function clockwise(placement) { var counter = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false; var index = validPlacements.indexOf(placement); var arr = validPlacements.slice(index + 1).concat(validPlacements.slice(0, index)); return counter ? arr.reverse() : arr; } var BEHAVIORS = { FLIP: 'flip', CLOCKWISE: 'clockwise', COUNTERCLOCKWISE: 'counterclockwise' }; /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by update method * @argument {Object} options - Modifiers configuration and options * @returns {Object} The data object, properly modified */ function flip(data, options) { // if `inner` modifier is enabled, we can't use the `flip` modifier if (isModifierEnabled(data.instance.modifiers, 'inner')) { return data; } if (data.flipped && data.placement === data.originalPlacement) { // seems like flip is trying to loop, probably there's not enough space on any of the flippable sides return data; } var boundaries = getBoundaries(data.instance.popper, data.instance.reference, options.padding, options.boundariesElement, data.positionFixed); var placement = data.placement.split('-')[0]; var placementOpposite = getOppositePlacement(placement); var variation = data.placement.split('-')[1] || ''; var flipOrder = []; switch (options.behavior) { case BEHAVIORS.FLIP: flipOrder = [placement, placementOpposite]; break; case BEHAVIORS.CLOCKWISE: flipOrder = clockwise(placement); break; case BEHAVIORS.COUNTERCLOCKWISE: flipOrder = clockwise(placement, true); break; default: flipOrder = options.behavior; } flipOrder.forEach(function (step, index) { if (placement !== step || flipOrder.length === index + 1) { return data; } placement = data.placement.split('-')[0]; placementOpposite = getOppositePlacement(placement); var popperOffsets = data.offsets.popper; var refOffsets = data.offsets.reference; // using floor because the reference offsets may contain decimals we are not going to consider here var floor = Math.floor; var overlapsRef = placement === 'left' && floor(popperOffsets.right) > floor(refOffsets.left) || placement === 'right' && floor(popperOffsets.left) < floor(refOffsets.right) || placement === 'top' && floor(popperOffsets.bottom) > floor(refOffsets.top) || placement === 'bottom' && floor(popperOffsets.top) < floor(refOffsets.bottom); var overflowsLeft = floor(popperOffsets.left) < floor(boundaries.left); var overflowsRight = floor(popperOffsets.right) > floor(boundaries.right); var overflowsTop = floor(popperOffsets.top) < floor(boundaries.top); var overflowsBottom = floor(popperOffsets.bottom) > floor(boundaries.bottom); var overflowsBoundaries = placement === 'left' && overflowsLeft || placement === 'right' && overflowsRight || placement === 'top' && overflowsTop || placement === 'bottom' && overflowsBottom; // flip the variation if required var isVertical = ['top', 'bottom'].indexOf(placement) !== -1; // flips variation if reference element overflows boundaries var flippedVariationByRef = !!options.flipVariations && (isVertical && variation === 'start' && overflowsLeft || isVertical && variation === 'end' && overflowsRight || !isVertical && variation === 'start' && overflowsTop || !isVertical && variation === 'end' && overflowsBottom); // flips variation if popper content overflows boundaries var flippedVariationByContent = !!options.flipVariationsByContent && (isVertical && variation === 'start' && overflowsRight || isVertical && variation === 'end' && overflowsLeft || !isVertical && variation === 'start' && overflowsBottom || !isVertical && variation === 'end' && overflowsTop); var flippedVariation = flippedVariationByRef || flippedVariationByContent; if (overlapsRef || overflowsBoundaries || flippedVariation) { // this boolean to detect any flip loop data.flipped = true; if (overlapsRef || overflowsBoundaries) { placement = flipOrder[index + 1]; } if (flippedVariation) { variation = getOppositeVariation(variation); } data.placement = placement + (variation ? '-' + variation : ''); // this object contains `position`, we want to preserve it along with // any additional property we may add in the future data.offsets.popper = _extends$2({}, data.offsets.popper, getPopperOffsets(data.instance.popper, data.offsets.reference, data.placement)); data = runModifiers(data.instance.modifiers, data, 'flip'); } }); return data; } /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by update method * @argument {Object} options - Modifiers configuration and options * @returns {Object} The data object, properly modified */ function keepTogether(data) { var _data$offsets = data.offsets, popper = _data$offsets.popper, reference = _data$offsets.reference; var placement = data.placement.split('-')[0]; var floor = Math.floor; var isVertical = ['top', 'bottom'].indexOf(placement) !== -1; var side = isVertical ? 'right' : 'bottom'; var opSide = isVertical ? 'left' : 'top'; var measurement = isVertical ? 'width' : 'height'; if (popper[side] < floor(reference[opSide])) { data.offsets.popper[opSide] = floor(reference[opSide]) - popper[measurement]; } if (popper[opSide] > floor(reference[side])) { data.offsets.popper[opSide] = floor(reference[side]); } return data; } /** * Converts a string containing value + unit into a px value number * @function * @memberof {modifiers~offset} * @private * @argument {String} str - Value + unit string * @argument {String} measurement - `height` or `width` * @argument {Object} popperOffsets * @argument {Object} referenceOffsets * @returns {Number|String} * Value in pixels, or original string if no values were extracted */ function toValue(str, measurement, popperOffsets, referenceOffsets) { // separate value from unit var split = str.match(/((?:\-|\+)?\d*\.?\d*)(.*)/); var value = +split[1]; var unit = split[2]; // If it's not a number it's an operator, I guess if (!value) { return str; } if (unit.indexOf('%') === 0) { var element = void 0; switch (unit) { case '%p': element = popperOffsets; break; case '%': case '%r': default: element = referenceOffsets; } var rect = getClientRect(element); return rect[measurement] / 100 * value; } else if (unit === 'vh' || unit === 'vw') { // if is a vh or vw, we calculate the size based on the viewport var size = void 0; if (unit === 'vh') { size = Math.max(document.documentElement.clientHeight, window.innerHeight || 0); } else { size = Math.max(document.documentElement.clientWidth, window.innerWidth || 0); } return size / 100 * value; } else { // if is an explicit pixel unit, we get rid of the unit and keep the value // if is an implicit unit, it's px, and we return just the value return value; } } /** * Parse an `offset` string to extrapolate `x` and `y` numeric offsets. * @function * @memberof {modifiers~offset} * @private * @argument {String} offset * @argument {Object} popperOffsets * @argument {Object} referenceOffsets * @argument {String} basePlacement * @returns {Array} a two cells array with x and y offsets in numbers */ function parseOffset(offset, popperOffsets, referenceOffsets, basePlacement) { var offsets = [0, 0]; // Use height if placement is left or right and index is 0 otherwise use width // in this way the first offset will use an axis and the second one // will use the other one var useHeight = ['right', 'left'].indexOf(basePlacement) !== -1; // Split the offset string to obtain a list of values and operands // The regex addresses values with the plus or minus sign in front (+10, -20, etc) var fragments = offset.split(/(\+|\-)/).map(function (frag) { return frag.trim(); }); // Detect if the offset string contains a pair of values or a single one // they could be separated by comma or space var divider = fragments.indexOf(find(fragments, function (frag) { return frag.search(/,|\s/) !== -1; })); if (fragments[divider] && fragments[divider].indexOf(',') === -1) { console.warn('Offsets separated by white space(s) are deprecated, use a comma (,) instead.'); } // If divider is found, we divide the list of values and operands to divide // them by ofset X and Y. var splitRegex = /\s*,\s*|\s+/; var ops = divider !== -1 ? [fragments.slice(0, divider).concat([fragments[divider].split(splitRegex)[0]]), [fragments[divider].split(splitRegex)[1]].concat(fragments.slice(divider + 1))] : [fragments]; // Convert the values with units to absolute pixels to allow our computations ops = ops.map(function (op, index) { // Most of the units rely on the orientation of the popper var measurement = (index === 1 ? !useHeight : useHeight) ? 'height' : 'width'; var mergeWithPrevious = false; return op // This aggregates any `+` or `-` sign that aren't considered operators // e.g.: 10 + +5 => [10, +, +5] .reduce(function (a, b) { if (a[a.length - 1] === '' && ['+', '-'].indexOf(b) !== -1) { a[a.length - 1] = b; mergeWithPrevious = true; return a; } else if (mergeWithPrevious) { a[a.length - 1] += b; mergeWithPrevious = false; return a; } else { return a.concat(b); } }, []) // Here we convert the string values into number values (in px) .map(function (str) { return toValue(str, measurement, popperOffsets, referenceOffsets); }); }); // Loop trough the offsets arrays and execute the operations ops.forEach(function (op, index) { op.forEach(function (frag, index2) { if (isNumeric(frag)) { offsets[index] += frag * (op[index2 - 1] === '-' ? -1 : 1); } }); }); return offsets; } /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by update method * @argument {Object} options - Modifiers configuration and options * @argument {Number|String} options.offset=0 * The offset value as described in the modifier description * @returns {Object} The data object, properly modified */ function offset(data, _ref) { var offset = _ref.offset; var placement = data.placement, _data$offsets = data.offsets, popper = _data$offsets.popper, reference = _data$offsets.reference; var basePlacement = placement.split('-')[0]; var offsets = void 0; if (isNumeric(+offset)) { offsets = [+offset, 0]; } else { offsets = parseOffset(offset, popper, reference, basePlacement); } if (basePlacement === 'left') { popper.top += offsets[0]; popper.left -= offsets[1]; } else if (basePlacement === 'right') { popper.top += offsets[0]; popper.left += offsets[1]; } else if (basePlacement === 'top') { popper.left += offsets[0]; popper.top -= offsets[1]; } else if (basePlacement === 'bottom') { popper.left += offsets[0]; popper.top += offsets[1]; } data.popper = popper; return data; } /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by `update` method * @argument {Object} options - Modifiers configuration and options * @returns {Object} The data object, properly modified */ function preventOverflow(data, options) { var boundariesElement = options.boundariesElement || getOffsetParent(data.instance.popper); // If offsetParent is the reference element, we really want to // go one step up and use the next offsetParent as reference to // avoid to make this modifier completely useless and look like broken if (data.instance.reference === boundariesElement) { boundariesElement = getOffsetParent(boundariesElement); } // NOTE: DOM access here // resets the popper's position so that the document size can be calculated excluding // the size of the popper element itself var transformProp = getSupportedPropertyName('transform'); var popperStyles = data.instance.popper.style; // assignment to help minification var top = popperStyles.top, left = popperStyles.left, transform = popperStyles[transformProp]; popperStyles.top = ''; popperStyles.left = ''; popperStyles[transformProp] = ''; var boundaries = getBoundaries(data.instance.popper, data.instance.reference, options.padding, boundariesElement, data.positionFixed); // NOTE: DOM access here // restores the original style properties after the offsets have been computed popperStyles.top = top; popperStyles.left = left; popperStyles[transformProp] = transform; options.boundaries = boundaries; var order = options.priority; var popper = data.offsets.popper; var check = { primary: function primary(placement) { var value = popper[placement]; if (popper[placement] < boundaries[placement] && !options.escapeWithReference) { value = Math.max(popper[placement], boundaries[placement]); } return defineProperty$1({}, placement, value); }, secondary: function secondary(placement) { var mainSide = placement === 'right' ? 'left' : 'top'; var value = popper[mainSide]; if (popper[placement] > boundaries[placement] && !options.escapeWithReference) { value = Math.min(popper[mainSide], boundaries[placement] - (placement === 'right' ? popper.width : popper.height)); } return defineProperty$1({}, mainSide, value); } }; order.forEach(function (placement) { var side = ['left', 'top'].indexOf(placement) !== -1 ? 'primary' : 'secondary'; popper = _extends$2({}, popper, check[side](placement)); }); data.offsets.popper = popper; return data; } /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by `update` method * @argument {Object} options - Modifiers configuration and options * @returns {Object} The data object, properly modified */ function shift(data) { var placement = data.placement; var basePlacement = placement.split('-')[0]; var shiftvariation = placement.split('-')[1]; // if shift shiftvariation is specified, run the modifier if (shiftvariation) { var _data$offsets = data.offsets, reference = _data$offsets.reference, popper = _data$offsets.popper; var isVertical = ['bottom', 'top'].indexOf(basePlacement) !== -1; var side = isVertical ? 'left' : 'top'; var measurement = isVertical ? 'width' : 'height'; var shiftOffsets = { start: defineProperty$1({}, side, reference[side]), end: defineProperty$1({}, side, reference[side] + reference[measurement] - popper[measurement]) }; data.offsets.popper = _extends$2({}, popper, shiftOffsets[shiftvariation]); } return data; } /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by update method * @argument {Object} options - Modifiers configuration and options * @returns {Object} The data object, properly modified */ function hide(data) { if (!isModifierRequired(data.instance.modifiers, 'hide', 'preventOverflow')) { return data; } var refRect = data.offsets.reference; var bound = find(data.instance.modifiers, function (modifier) { return modifier.name === 'preventOverflow'; }).boundaries; if (refRect.bottom < bound.top || refRect.left > bound.right || refRect.top > bound.bottom || refRect.right < bound.left) { // Avoid unnecessary DOM access if visibility hasn't changed if (data.hide === true) { return data; } data.hide = true; data.attributes['x-out-of-boundaries'] = ''; } else { // Avoid unnecessary DOM access if visibility hasn't changed if (data.hide === false) { return data; } data.hide = false; data.attributes['x-out-of-boundaries'] = false; } return data; } /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by `update` method * @argument {Object} options - Modifiers configuration and options * @returns {Object} The data object, properly modified */ function inner(data) { var placement = data.placement; var basePlacement = placement.split('-')[0]; var _data$offsets = data.offsets, popper = _data$offsets.popper, reference = _data$offsets.reference; var isHoriz = ['left', 'right'].indexOf(basePlacement) !== -1; var subtractLength = ['top', 'left'].indexOf(basePlacement) === -1; popper[isHoriz ? 'left' : 'top'] = reference[basePlacement] - (subtractLength ? popper[isHoriz ? 'width' : 'height'] : 0); data.placement = getOppositePlacement(placement); data.offsets.popper = getClientRect(popper); return data; } /** * Modifier function, each modifier can have a function of this type assigned * to its `fn` property.<br /> * These functions will be called on each update, this means that you must * make sure they are performant enough to avoid performance bottlenecks. * * @function ModifierFn * @argument {dataObject} data - The data object generated by `update` method * @argument {Object} options - Modifiers configuration and options * @returns {dataObject} The data object, properly modified */ /** * Modifiers are plugins used to alter the behavior of your poppers.<br /> * Popper.js uses a set of 9 modifiers to provide all the basic functionalities * needed by the library. * * Usually you don't want to override the `order`, `fn` and `onLoad` props. * All the other properties are configurations that could be tweaked. * @namespace modifiers */ var modifiers = { /** * Modifier used to shift the popper on the start or end of its reference * element.<br /> * It will read the variation of the `placement` property.<br /> * It can be one either `-end` or `-start`. * @memberof modifiers * @inner */ shift: { /** @prop {number} order=100 - Index used to define the order of execution */ order: 100, /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ enabled: true, /** @prop {ModifierFn} */ fn: shift }, /** * The `offset` modifier can shift your popper on both its axis. * * It accepts the following units: * - `px` or unit-less, interpreted as pixels * - `%` or `%r`, percentage relative to the length of the reference element * - `%p`, percentage relative to the length of the popper element * - `vw`, CSS viewport width unit * - `vh`, CSS viewport height unit * * For length is intended the main axis relative to the placement of the popper.<br /> * This means that if the placement is `top` or `bottom`, the length will be the * `width`. In case of `left` or `right`, it will be the `height`. * * You can provide a single value (as `Number` or `String`), or a pair of values * as `String` divided by a comma or one (or more) white spaces.<br /> * The latter is a deprecated method because it leads to confusion and will be * removed in v2.<br /> * Additionally, it accepts additions and subtractions between different units. * Note that multiplications and divisions aren't supported. * * Valid examples are: * ``` * 10 * '10%' * '10, 10' * '10%, 10' * '10 + 10%' * '10 - 5vh + 3%' * '-10px + 5vh, 5px - 6%' * ``` * > **NB**: If you desire to apply offsets to your poppers in a way that may make them overlap * > with their reference element, unfortunately, you will have to disable the `flip` modifier. * > You can read more on this at this [issue](https://github.com/FezVrasta/popper.js/issues/373). * * @memberof modifiers * @inner */ offset: { /** @prop {number} order=200 - Index used to define the order of execution */ order: 200, /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ enabled: true, /** @prop {ModifierFn} */ fn: offset, /** @prop {Number|String} offset=0 * The offset value as described in the modifier description */ offset: 0 }, /** * Modifier used to prevent the popper from being positioned outside the boundary. * * A scenario exists where the reference itself is not within the boundaries.<br /> * We can say it has "escaped the boundaries" — or just "escaped".<br /> * In this case we need to decide whether the popper should either: * * - detach from the reference and remain "trapped" in the boundaries, or * - if it should ignore the boundary and "escape with its reference" * * When `escapeWithReference` is set to`true` and reference is completely * outside its boundaries, the popper will overflow (or completely leave) * the boundaries in order to remain attached to the edge of the reference. * * @memberof modifiers * @inner */ preventOverflow: { /** @prop {number} order=300 - Index used to define the order of execution */ order: 300, /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ enabled: true, /** @prop {ModifierFn} */ fn: preventOverflow, /** * @prop {Array} [priority=['left','right','top','bottom']] * Popper will try to prevent overflow following these priorities by default, * then, it could overflow on the left and on top of the `boundariesElement` */ priority: ['left', 'right', 'top', 'bottom'], /** * @prop {number} padding=5 * Amount of pixel used to define a minimum distance between the boundaries * and the popper. This makes sure the popper always has a little padding * between the edges of its container */ padding: 5, /** * @prop {String|HTMLElement} boundariesElement='scrollParent' * Boundaries used by the modifier. Can be `scrollParent`, `window`, * `viewport` or any DOM element. */ boundariesElement: 'scrollParent' }, /** * Modifier used to make sure the reference and its popper stay near each other * without leaving any gap between the two. Especially useful when the arrow is * enabled and you want to ensure that it points to its reference element. * It cares only about the first axis. You can still have poppers with margin * between the popper and its reference element. * @memberof modifiers * @inner */ keepTogether: { /** @prop {number} order=400 - Index used to define the order of execution */ order: 400, /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ enabled: true, /** @prop {ModifierFn} */ fn: keepTogether }, /** * This modifier is used to move the `arrowElement` of the popper to make * sure it is positioned between the reference element and its popper element. * It will read the outer size of the `arrowElement` node to detect how many * pixels of conjunction are needed. * * It has no effect if no `arrowElement` is provided. * @memberof modifiers * @inner */ arrow: { /** @prop {number} order=500 - Index used to define the order of execution */ order: 500, /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ enabled: true, /** @prop {ModifierFn} */ fn: arrow, /** @prop {String|HTMLElement} element='[x-arrow]' - Selector or node used as arrow */ element: '[x-arrow]' }, /** * Modifier used to flip the popper's placement when it starts to overlap its * reference element. * * Requires the `preventOverflow` modifier before it in order to work. * * **NOTE:** this modifier will interrupt the current update cycle and will * restart it if it detects the need to flip the placement. * @memberof modifiers * @inner */ flip: { /** @prop {number} order=600 - Index used to define the order of execution */ order: 600, /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ enabled: true, /** @prop {ModifierFn} */ fn: flip, /** * @prop {String|Array} behavior='flip' * The behavior used to change the popper's placement. It can be one of * `flip`, `clockwise`, `counterclockwise` or an array with a list of valid * placements (with optional variations) */ behavior: 'flip', /** * @prop {number} padding=5 * The popper will flip if it hits the edges of the `boundariesElement` */ padding: 5, /** * @prop {String|HTMLElement} boundariesElement='viewport' * The element which will define the boundaries of the popper position. * The popper will never be placed outside of the defined boundaries * (except if `keepTogether` is enabled) */ boundariesElement: 'viewport', /** * @prop {Boolean} flipVariations=false * The popper will switch placement variation between `-start` and `-end` when * the reference element overlaps its boundaries. * * The original placement should have a set variation. */ flipVariations: false, /** * @prop {Boolean} flipVariationsByContent=false * The popper will switch placement variation between `-start` and `-end` when * the popper element overlaps its reference boundaries. * * The original placement should have a set variation. */ flipVariationsByContent: false }, /** * Modifier used to make the popper flow toward the inner of the reference element. * By default, when this modifier is disabled, the popper will be placed outside * the reference element. * @memberof modifiers * @inner */ inner: { /** @prop {number} order=700 - Index used to define the order of execution */ order: 700, /** @prop {Boolean} enabled=false - Whether the modifier is enabled or not */ enabled: false, /** @prop {ModifierFn} */ fn: inner }, /** * Modifier used to hide the popper when its reference element is outside of the * popper boundaries. It will set a `x-out-of-boundaries` attribute which can * be used to hide with a CSS selector the popper when its reference is * out of boundaries. * * Requires the `preventOverflow` modifier before it in order to work. * @memberof modifiers * @inner */ hide: { /** @prop {number} order=800 - Index used to define the order of execution */ order: 800, /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ enabled: true, /** @prop {ModifierFn} */ fn: hide }, /** * Computes the style that will be applied to the popper element to gets * properly positioned. * * Note that this modifier will not touch the DOM, it just prepares the styles * so that `applyStyle` modifier can apply it. This separation is useful * in case you need to replace `applyStyle` with a custom implementation. * * This modifier has `850` as `order` value to maintain backward compatibility * with previous versions of Popper.js. Expect the modifiers ordering method * to change in future major versions of the library. * * @memberof modifiers * @inner */ computeStyle: { /** @prop {number} order=850 - Index used to define the order of execution */ order: 850, /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ enabled: true, /** @prop {ModifierFn} */ fn: computeStyle, /** * @prop {Boolean} gpuAcceleration=true * If true, it uses the CSS 3D transformation to position the popper. * Otherwise, it will use the `top` and `left` properties */ gpuAcceleration: true, /** * @prop {string} [x='bottom'] * Where to anchor the X axis (`bottom` or `top`). AKA X offset origin. * Change this if your popper should grow in a direction different from `bottom` */ x: 'bottom', /** * @prop {string} [x='left'] * Where to anchor the Y axis (`left` or `right`). AKA Y offset origin. * Change this if your popper should grow in a direction different from `right` */ y: 'right' }, /** * Applies the computed styles to the popper element. * * All the DOM manipulations are limited to this modifier. This is useful in case * you want to integrate Popper.js inside a framework or view library and you * want to delegate all the DOM manipulations to it. * * Note that if you disable this modifier, you must make sure the popper element * has its position set to `absolute` before Popper.js can do its work! * * Just disable this modifier and define your own to achieve the desired effect. * * @memberof modifiers * @inner */ applyStyle: { /** @prop {number} order=900 - Index used to define the order of execution */ order: 900, /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ enabled: true, /** @prop {ModifierFn} */ fn: applyStyle, /** @prop {Function} */ onLoad: applyStyleOnLoad, /** * @deprecated since version 1.10.0, the property moved to `computeStyle` modifier * @prop {Boolean} gpuAcceleration=true * If true, it uses the CSS 3D transformation to position the popper. * Otherwise, it will use the `top` and `left` properties */ gpuAcceleration: undefined } }; /** * The `dataObject` is an object containing all the information used by Popper.js. * This object is passed to modifiers and to the `onCreate` and `onUpdate` callbacks. * @name dataObject * @property {Object} data.instance The Popper.js instance * @property {String} data.placement Placement applied to popper * @property {String} data.originalPlacement Placement originally defined on init * @property {Boolean} data.flipped True if popper has been flipped by flip modifier * @property {Boolean} data.hide True if the reference element is out of boundaries, useful to know when to hide the popper * @property {HTMLElement} data.arrowElement Node used as arrow by arrow modifier * @property {Object} data.styles Any CSS property defined here will be applied to the popper. It expects the JavaScript nomenclature (eg. `marginBottom`) * @property {Object} data.arrowStyles Any CSS property defined here will be applied to the popper arrow. It expects the JavaScript nomenclature (eg. `marginBottom`) * @property {Object} data.boundaries Offsets of the popper boundaries * @property {Object} data.offsets The measurements of popper, reference and arrow elements * @property {Object} data.offsets.popper `top`, `left`, `width`, `height` values * @property {Object} data.offsets.reference `top`, `left`, `width`, `height` values * @property {Object} data.offsets.arrow] `top` and `left` offsets, only one of them will be different from 0 */ /** * Default options provided to Popper.js constructor.<br /> * These can be overridden using the `options` argument of Popper.js.<br /> * To override an option, simply pass an object with the same * structure of the `options` object, as the 3rd argument. For example: * ``` * new Popper(ref, pop, { * modifiers: { * preventOverflow: { enabled: false } * } * }) * ``` * @type {Object} * @static * @memberof Popper */ var Defaults = { /** * Popper's placement. * @prop {Popper.placements} placement='bottom' */ placement: 'bottom', /** * Set this to true if you want popper to position it self in 'fixed' mode * @prop {Boolean} positionFixed=false */ positionFixed: false, /** * Whether events (resize, scroll) are initially enabled. * @prop {Boolean} eventsEnabled=true */ eventsEnabled: true, /** * Set to true if you want to automatically remove the popper when * you call the `destroy` method. * @prop {Boolean} removeOnDestroy=false */ removeOnDestroy: false, /** * Callback called when the popper is created.<br /> * By default, it is set to no-op.<br /> * Access Popper.js instance with `data.instance`. * @prop {onCreate} */ onCreate: function onCreate() {}, /** * Callback called when the popper is updated. This callback is not called * on the initialization/creation of the popper, but only on subsequent * updates.<br /> * By default, it is set to no-op.<br /> * Access Popper.js instance with `data.instance`. * @prop {onUpdate} */ onUpdate: function onUpdate() {}, /** * List of modifiers used to modify the offsets before they are applied to the popper. * They provide most of the functionalities of Popper.js. * @prop {modifiers} */ modifiers: modifiers }; /** * @callback onCreate * @param {dataObject} data */ /** * @callback onUpdate * @param {dataObject} data */ // Utils // Methods var Popper = function () { /** * Creates a new Popper.js instance. * @class Popper * @param {Element|referenceObject} reference - The reference element used to position the popper * @param {Element} popper - The HTML / XML element used as the popper * @param {Object} options - Your custom options to override the ones defined in [Defaults](#defaults) * @return {Object} instance - The generated Popper.js instance */ function Popper(reference, popper) { var _this = this; var options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {}; classCallCheck(this, Popper); this.scheduleUpdate = function () { return requestAnimationFrame(_this.update); }; // make update() debounced, so that it only runs at most once-per-tick this.update = debounce$1(this.update.bind(this)); // with {} we create a new object with the options inside it this.options = _extends$2({}, Popper.Defaults, options); // init state this.state = { isDestroyed: false, isCreated: false, scrollParents: [] }; // get reference and popper elements (allow jQuery wrappers) this.reference = reference && reference.jquery ? reference[0] : reference; this.popper = popper && popper.jquery ? popper[0] : popper; // Deep merge modifiers options this.options.modifiers = {}; Object.keys(_extends$2({}, Popper.Defaults.modifiers, options.modifiers)).forEach(function (name) { _this.options.modifiers[name] = _extends$2({}, Popper.Defaults.modifiers[name] || {}, options.modifiers ? options.modifiers[name] : {}); }); // Refactoring modifiers' list (Object => Array) this.modifiers = Object.keys(this.options.modifiers).map(function (name) { return _extends$2({ name: name }, _this.options.modifiers[name]); }) // sort the modifiers by order .sort(function (a, b) { return a.order - b.order; }); // modifiers have the ability to execute arbitrary code when Popper.js get inited // such code is executed in the same order of its modifier // they could add new properties to their options configuration // BE AWARE: don't add options to `options.modifiers.name` but to `modifierOptions`! this.modifiers.forEach(function (modifierOptions) { if (modifierOptions.enabled && isFunction$1(modifierOptions.onLoad)) { modifierOptions.onLoad(_this.reference, _this.popper, _this.options, modifierOptions, _this.state); } }); // fire the first update to position the popper in the right place this.update(); var eventsEnabled = this.options.eventsEnabled; if (eventsEnabled) { // setup event listeners, they will take care of update the position in specific situations this.enableEventListeners(); } this.state.eventsEnabled = eventsEnabled; } // We can't use class properties because they don't get listed in the // class prototype and break stuff like Sinon stubs createClass(Popper, [{ key: 'update', value: function update$$1() { return update.call(this); } }, { key: 'destroy', value: function destroy$$1() { return destroy.call(this); } }, { key: 'enableEventListeners', value: function enableEventListeners$$1() { return enableEventListeners.call(this); } }, { key: 'disableEventListeners', value: function disableEventListeners$$1() { return disableEventListeners.call(this); } /** * Schedules an update. It will run on the next UI update available. * @method scheduleUpdate * @memberof Popper */ /** * Collection of utilities useful when writing custom modifiers. * Starting from version 1.7, this method is available only if you * include `popper-utils.js` before `popper.js`. * * **DEPRECATION**: This way to access PopperUtils is deprecated * and will be removed in v2! Use the PopperUtils module directly instead. * Due to the high instability of the methods contained in Utils, we can't * guarantee them to follow semver. Use them at your own risk! * @static * @private * @type {Object} * @deprecated since version 1.8 * @member Utils * @memberof Popper */ }]); return Popper; }(); /** * The `referenceObject` is an object that provides an interface compatible with Popper.js * and lets you use it as replacement of a real DOM node.<br /> * You can use this method to position a popper relatively to a set of coordinates * in case you don't have a DOM node to use as reference. * * ``` * new Popper(referenceObject, popperNode); * ``` * * NB: This feature isn't supported in Internet Explorer 10. * @name referenceObject * @property {Function} data.getBoundingClientRect * A function that returns a set of coordinates compatible with the native `getBoundingClientRect` method. * @property {number} data.clientWidth * An ES6 getter that will return the width of the virtual reference element. * @property {number} data.clientHeight * An ES6 getter that will return the height of the virtual reference element. */ Popper.Utils = (typeof window !== 'undefined' ? window : global).PopperUtils; Popper.placements = placements; Popper.Defaults = Defaults; /**! * tippy.js v5.0.0-beta.1 * (c) 2017-2019 atomiks * MIT License */ var version = "5.0.0-beta.1"; var idCounter = 1; // Workaround for IE11's lack of new MouseEvent constructor var mouseMoveListeners = []; /** * Creates and returns a Tippy object. We're using a closure pattern instead of * a class so that the exposed object API is clean without private members * prefixed with `_`. */ function createTippy(reference, collectionProps) { var props = evaluateProps(reference, collectionProps); // If the reference shouldn't have multiple tippys, return null early if (!props.multiple && reference._tippy) { return null; } /* ======================= 🔒 Private members 🔒 ======================= */ var lastTriggerEventType; var showTimeout; var hideTimeout; var scheduleHideAnimationFrame; var isBeingDestroyed = false; var hasMountCallbackRun = false; var didHideDueToDocumentMouseDown = false; var currentMountCallback; var currentTransitionEndListener; var listeners = []; var debouncedOnMouseMove = debounce(onMouseMove, props.interactiveDebounce); /* ======================= 🔑 Public members 🔑 ======================= */ var id = idCounter++; var popper = createPopperElement(id, props); var popperChildren = getChildren(popper); var popperInstance = null; // These two elements are static var tooltip = popperChildren.tooltip, content = popperChildren.content; var state = { // The current real placement (`data-placement` attribute) currentPlacement: props.placement, // Does the instance have a pending timeout for show()? isScheduledToShow: false, // Is the instance currently enabled? isEnabled: true, // Is the tippy currently showing and not transitioning out? isVisible: false, // Has the instance been destroyed? isDestroyed: false, // Is the tippy currently mounted to the DOM? isMounted: false, // Has the tippy finished transitioning in? isShown: false }; var instance = { // properties id: id, reference: reference, popper: popper, popperChildren: popperChildren, popperInstance: popperInstance, props: props, state: state, // methods clearDelayTimeouts: clearDelayTimeouts, setProps: setProps, setContent: setContent, show: show, hide: hide, enable: enable, disable: disable, destroy: destroy }; /* ==================== Initial instance mutations =================== */ reference._tippy = instance; popper._tippy = instance; addTriggersToEventListenersTarget(); if (!props.lazy) { createPopperInstance(); } if (props.showOnCreate) { scheduleShow(); } // Prevent a tippy with a delay from hiding if the cursor left then returned // before it started hiding popper.addEventListener('mouseenter', function () { if (instance.props.interactive && instance.state.isVisible && lastTriggerEventType === 'mouseenter') { instance.clearDelayTimeouts(); } }); popper.addEventListener('mouseleave', function () { if (instance.props.interactive && lastTriggerEventType === 'mouseenter') { document.addEventListener('mousemove', debouncedOnMouseMove); } }); props.onCreate(instance); return instance; /* ======================= 🔒 Private methods 🔒 ======================= */ function getNormalizedTouchSettings() { var touch = instance.props.touch; return Array.isArray(touch) ? touch : [touch, 0]; } function getIsCustomTouchBehavior() { return getNormalizedTouchSettings()[0] === 'hold'; } function getTransitionableElements() { return [tooltip, content, instance.popperChildren.backdrop]; } function getEventListenersTarget() { return instance.props.triggerTarget || reference; } function cleanupInteractiveMouseListeners() { document.body.removeEventListener('mouseleave', scheduleHide); document.removeEventListener('mousemove', debouncedOnMouseMove); mouseMoveListeners = mouseMoveListeners.filter(function (listener) { return listener !== debouncedOnMouseMove; }); } function onDocumentMouseDown(event) { // Clicked on interactive popper if (instance.props.interactive && popper.contains(event.target)) { return; } // Clicked on the event listeners target if (getEventListenersTarget().contains(event.target)) { if (currentInput.isTouch) { return; } if (instance.state.isVisible && includes(instance.props.trigger, 'click')) { return; } } if (instance.props.hideOnClick === true) { instance.clearDelayTimeouts(); instance.hide(); // `mousedown` event is fired right before `focus`. This lets a tippy with // `focus` trigger know that it should not show didHideDueToDocumentMouseDown = true; setTimeout(function () { didHideDueToDocumentMouseDown = false; }); // The listener gets added in `scheduleShow()`, but this may be hiding it // before it shows, and hide()'s early bail-out behavior can prevent it // from being cleaned up if (!instance.state.isMounted) { removeDocumentMouseDownListener(); } } } function addDocumentMouseDownListener() { document.addEventListener('mousedown', onDocumentMouseDown, true); } function removeDocumentMouseDownListener() { document.removeEventListener('mousedown', onDocumentMouseDown, true); } function makeSticky() { setTransitionDuration([popper], isIE ? 0 : instance.props.updateDuration); var prevRefRect = reference.getBoundingClientRect(); function updatePosition() { var currentRefRect = reference.getBoundingClientRect(); // Only schedule an update if the reference rect has changed if (prevRefRect.top !== currentRefRect.top || prevRefRect.right !== currentRefRect.right || prevRefRect.bottom !== currentRefRect.bottom || prevRefRect.left !== currentRefRect.left) { instance.popperInstance.scheduleUpdate(); } prevRefRect = currentRefRect; if (instance.state.isMounted) { requestAnimationFrame(updatePosition); } } updatePosition(); } function onTransitionedOut(duration, callback) { onTransitionEnd(duration, function () { if (!instance.state.isVisible && popper.parentNode && popper.parentNode.contains(popper)) { callback(); } }); } function onTransitionedIn(duration, callback) { onTransitionEnd(duration, callback); } function onTransitionEnd(duration, callback) { /** * Listener added as the `transitionend` handler */ function listener(event) { if (event.target === tooltip) { updateTransitionEndListener(tooltip, 'remove', listener); callback(); } } // Make callback synchronous if duration is 0 // `transitionend` won't fire otherwise if (duration === 0) { return callback(); } updateTransitionEndListener(tooltip, 'remove', currentTransitionEndListener); updateTransitionEndListener(tooltip, 'add', listener); currentTransitionEndListener = listener; } function on(eventType, handler, options) { if (options === void 0) { options = false; } getEventListenersTarget().addEventListener(eventType, handler, options); listeners.push({ eventType: eventType, handler: handler, options: options }); } function addTriggersToEventListenersTarget() { if (getIsCustomTouchBehavior()) { on('touchstart', onTrigger, PASSIVE); on('touchend', onMouseLeave, PASSIVE); } // `click` for keyboard. Mouse uses `mousedown` (onDocumentMouseDown) if (!includes(instance.props.trigger, 'click')) { on('click', function () { if (!currentInput.isTouch && instance.props.hideOnClick === true) { instance.hide(); } }); } instance.props.trigger.trim().split(' ').forEach(function (eventType) { if (eventType === 'manual') { return; } on(eventType, onTrigger); switch (eventType) { case 'mouseenter': on('mouseleave', onMouseLeave); break; case 'focus': on(isIE ? 'focusout' : 'blur', onBlur); break; } }); } function removeTriggersFromEventListenersTarget() { listeners.forEach(function (_ref) { var eventType = _ref.eventType, handler = _ref.handler, options = _ref.options; getEventListenersTarget().removeEventListener(eventType, handler, options); }); listeners = []; } function onTrigger(event) { if (didHideDueToDocumentMouseDown || !instance.state.isEnabled || isEventListenerStopped(event)) { return; } if (!instance.state.isVisible) { lastTriggerEventType = event.type; if (event instanceof MouseEvent) { // If scrolling, `mouseenter` events can be fired if the cursor lands // over a new target, but `mousemove` events don't get fired. This // causes interactive tooltips to get stuck open until the cursor is // moved mouseMoveListeners.forEach(function (listener) { return listener(event); }); } } // Toggle show/hide when clicking click-triggered tooltips if (event.type === 'click' && instance.props.hideOnClick !== false && instance.state.isVisible) { scheduleHide(event); } else { var _getNormalizedTouchSe = getNormalizedTouchSettings(), value = _getNormalizedTouchSe[0], duration = _getNormalizedTouchSe[1]; if (currentInput.isTouch && value === 'hold' && duration) { // We can hijack the show timeout here, it will be cleared by // `scheduleHide()` when necessary showTimeout = setTimeout(function () { scheduleShow(event); }, duration); } else { scheduleShow(event); } } } function onMouseMove(event) { var isCursorOverReferenceOrPopper = closestCallback(event.target, function (el) { return el === reference || el === popper; }); if (isCursorOverReferenceOrPopper) { return; } if (isCursorOutsideInteractiveBorder(getBasePlacement(instance.state.currentPlacement), popper.getBoundingClientRect(), event, instance.props)) { cleanupInteractiveMouseListeners(); scheduleHide(event); } } function onMouseLeave(event) { if (isEventListenerStopped(event)) { return; } if (instance.props.interactive) { document.body.addEventListener('mouseleave', scheduleHide); document.addEventListener('mousemove', debouncedOnMouseMove); mouseMoveListeners.push(debouncedOnMouseMove); return; } scheduleHide(event); } function onBlur(event) { if (event.target !== getEventListenersTarget()) { return; } // If focus was moved to within the popper if (instance.props.interactive && event.relatedTarget && popper.contains(event.relatedTarget)) { return; } scheduleHide(event); } function isEventListenerStopped(event) { var supportsTouch = 'ontouchstart' in window; var isTouchEvent = includes(event.type, 'touch'); var isCustomTouch = getIsCustomTouchBehavior(); return supportsTouch && currentInput.isTouch && isCustomTouch && !isTouchEvent || currentInput.isTouch && !isCustomTouch && isTouchEvent; } function createPopperInstance() { var popperOptions = instance.props.popperOptions; var arrow = instance.popperChildren.arrow; var preventOverflowModifier = getModifier(popperOptions, 'preventOverflow'); function applyMutations(data) { instance.state.currentPlacement = data.placement; if (instance.props.flip && !instance.props.flipOnUpdate) { if (data.flipped) { instance.popperInstance.options.placement = data.placement; } setFlipModifierEnabled(instance.popperInstance.modifiers, false); } tooltip.setAttribute('data-placement', data.placement); if (data.attributes['x-out-of-boundaries'] !== false) { tooltip.setAttribute('data-out-of-boundaries', ''); } else { tooltip.removeAttribute('data-out-of-boundaries'); } var basePlacement = getBasePlacement(data.placement); var isVerticalPlacement = includes(['top', 'bottom'], basePlacement); var isSecondaryPlacement = includes(['bottom', 'right'], basePlacement); // Apply `distance` prop var tooltipStyles = tooltip.style; tooltipStyles.top = '0'; tooltipStyles.left = '0'; tooltipStyles[isVerticalPlacement ? 'top' : 'left'] = (isSecondaryPlacement ? 1 : -1) * instance.props.distance + "px"; } var config = _extends$1({ eventsEnabled: false, placement: instance.props.placement }, popperOptions, { modifiers: _extends$1({}, popperOptions && popperOptions.modifiers, { preventOverflow: _extends$1({ boundariesElement: instance.props.boundary, padding: PREVENT_OVERFLOW_PADDING }, preventOverflowModifier), // Adds the `distance` calculation to preventOverflow padding tippySetPreventOverflowPadding: { enabled: true, order: 299, fn: function fn(data) { var basePlacement = getBasePlacement(data.placement); var padding = preventOverflowModifier && preventOverflowModifier.padding !== undefined ? preventOverflowModifier.padding : PREVENT_OVERFLOW_PADDING; var isPaddingNumber = typeof padding === 'number'; var paddingObject = { top: 0, bottom: 0, left: 0, right: 0 }; var computedPadding = Object.keys(paddingObject).reduce(function (obj, key) { obj[key] = isPaddingNumber ? padding : padding[key]; if (basePlacement === key) { obj[key] = isPaddingNumber ? padding + instance.props.distance : (padding[basePlacement] || 0) + instance.props.distance; } return obj; }, paddingObject); instance.popperInstance.modifiers.filter(function (m) { return m.name === 'preventOverflow'; })[0].padding = computedPadding; return data; } }, arrow: _extends$1({ element: arrow, enabled: !!arrow }, getModifier(popperOptions, 'arrow')), flip: _extends$1({ enabled: instance.props.flip, padding: instance.props.distance + PREVENT_OVERFLOW_PADDING, behavior: instance.props.flipBehavior }, getModifier(popperOptions, 'flip')), offset: _extends$1({ offset: instance.props.offset }, getModifier(popperOptions, 'offset')) }), onCreate: function onCreate(data) { applyMutations(data); preserveInvocation(popperOptions && popperOptions.onCreate, config.onCreate, [data]); runMountCallback(); }, onUpdate: function onUpdate(data) { applyMutations(data); preserveInvocation(popperOptions && popperOptions.onUpdate, config.onUpdate, [data]); runMountCallback(); } }); instance.popperInstance = new Popper(reference, popper, config); } function runMountCallback() { if (!hasMountCallbackRun && currentMountCallback) { hasMountCallbackRun = true; reflow(popper); currentMountCallback(); } } function mount() { // The mounting callback (`currentMountCallback`) is only run due to a // popperInstance update/create hasMountCallbackRun = false; var appendTo = instance.props.appendTo; var parentNode = appendTo === 'parent' ? reference.parentNode : invokeWithArgsOrReturn(appendTo, [reference]); // The popper element needs to exist on the DOM before its position can be // updated as Popper.js needs to read its dimensions if (!parentNode.contains(popper)) { parentNode.appendChild(popper); } if (instance.popperInstance) { setFlipModifierEnabled(instance.popperInstance.modifiers, instance.props.flip); instance.popperInstance.enableEventListeners(); // Mounting callback invoked in `onUpdate` instance.popperInstance.scheduleUpdate(); } else { // Mounting callback invoked in `onCreate` createPopperInstance(); instance.popperInstance.enableEventListeners(); } } function scheduleShow(event) { instance.clearDelayTimeouts(); instance.state.isScheduledToShow = true; if (!instance.popperInstance) { createPopperInstance(); } if (event) { instance.props.onTrigger(instance, event); } addDocumentMouseDownListener(); var delay = getValueAtIndexOrReturn(instance.props.delay, 0, defaultProps.delay); if (delay) { showTimeout = setTimeout(function () { instance.show(); }, delay); } else { instance.show(); } } function scheduleHide(event) { instance.clearDelayTimeouts(); instance.props.onUntrigger(instance, event); if (!instance.state.isVisible) { removeDocumentMouseDownListener(); return; } instance.state.isScheduledToShow = false; var delay = getValueAtIndexOrReturn(instance.props.delay, 1, defaultProps.delay); if (delay) { hideTimeout = setTimeout(function () { if (instance.state.isVisible) { instance.hide(); } }, delay); } else { // Fixes a `transitionend` problem when it fires 1 frame too // late sometimes, we don't want hide() to be called. scheduleHideAnimationFrame = requestAnimationFrame(function () { instance.hide(); }); } } /* ======================= 🔑 Public methods 🔑 ======================= */ function enable() { instance.state.isEnabled = true; } function disable() { // Disabling the instance should also hide it // https://github.com/atomiks/tippy.js-react/issues/106 instance.hide(); instance.state.isEnabled = false; } function clearDelayTimeouts() { clearTimeout(showTimeout); clearTimeout(hideTimeout); cancelAnimationFrame(scheduleHideAnimationFrame); } // Cloning as we're deleting non-updateable props in DEV mode function setProps(_ref2) { var partialProps = _extends$1({}, _ref2); if (instance.state.isDestroyed) { return; } removeTriggersFromEventListenersTarget(); var prevProps = instance.props; var nextProps = evaluateProps(reference, _extends$1({}, instance.props, {}, partialProps, { ignoreAttributes: true })); nextProps.ignoreAttributes = hasOwnProperty$1(partialProps, 'ignoreAttributes') ? partialProps.ignoreAttributes || false : prevProps.ignoreAttributes; instance.props = nextProps; addTriggersToEventListenersTarget(); cleanupInteractiveMouseListeners(); debouncedOnMouseMove = debounce(onMouseMove, nextProps.interactiveDebounce); updatePopperElement(popper, prevProps, nextProps, instance.state.isVisible); instance.popperChildren = getChildren(popper); if (instance.popperInstance) { if (POPPER_INSTANCE_DEPENDENCIES.some(function (prop) { return hasOwnProperty$1(partialProps, prop) && partialProps[prop] !== prevProps[prop]; })) { instance.popperInstance.destroy(); createPopperInstance(); if (instance.state.isVisible) { instance.popperInstance.enableEventListeners(); } } else { instance.popperInstance.update(); } } } function setContent(content) { instance.setProps({ content: content }); } function show(duration, shouldPreventPopperTransition) { if (duration === void 0) { duration = getValueAtIndexOrReturn(instance.props.duration, 0, defaultProps.duration); } if (shouldPreventPopperTransition === void 0) { shouldPreventPopperTransition = true; } var isAlreadyVisible = instance.state.isVisible; var isDestroyed = instance.state.isDestroyed; var isDisabled = !instance.state.isEnabled; var isTouchAndTouchDisabled = currentInput.isTouch && !instance.props.touch; if (isAlreadyVisible || isDestroyed || isDisabled || isTouchAndTouchDisabled) { return; } // Normalize `disabled` behavior across browsers. // Firefox allows events on disabled elements, but Chrome doesn't. // Using a wrapper element (i.e. <span>) is recommended. if (getEventListenersTarget().hasAttribute('disabled')) { return; } if (instance.props.onShow(instance) === false) { return; } addDocumentMouseDownListener(); popper.style.visibility = 'visible'; instance.state.isVisible = true; // Prevent a transition of the popper from its previous position and of the // elements at a different placement. var transitionableElements = getTransitionableElements(); setTransitionDuration(shouldPreventPopperTransition ? transitionableElements.concat(popper) : transitionableElements, 0); currentMountCallback = function currentMountCallback() { if (!instance.state.isVisible) { return; } // Double update will apply correct mutations instance.popperInstance.update(); instance.props.onMount(instance); instance.state.isMounted = true; // The content should fade in after the backdrop has mostly filled the // tooltip element. `clip-path` is the other alternative but is not well- // supported and is buggy on some devices. content.style.transitionDelay = instance.popperChildren.backdrop ? Math.round(duration / 12) + "ms" : ''; if (instance.props.sticky) { makeSticky(); } setTransitionDuration([popper], instance.props.updateDuration); setTransitionDuration(transitionableElements, duration); setVisibilityState(transitionableElements, 'visible'); onTransitionedIn(duration, function () { if (instance.props.aria) { var node = getEventListenersTarget(); var attrName = "aria-" + instance.props.aria; var currentAttrValue = node.getAttribute(attrName); var nextAttrValue = currentAttrValue ? currentAttrValue + " " + tooltip.id : tooltip.id; node.setAttribute(attrName, nextAttrValue); } instance.props.onShown(instance); instance.state.isShown = true; }); }; mount(); } function hide(duration) { if (duration === void 0) { duration = getValueAtIndexOrReturn(instance.props.duration, 1, defaultProps.duration); } var isAlreadyHidden = !instance.state.isVisible && !isBeingDestroyed; var isDestroyed = instance.state.isDestroyed; var isDisabled = !instance.state.isEnabled && !isBeingDestroyed; if (isAlreadyHidden || isDestroyed || isDisabled) { return; } if (instance.props.onHide(instance) === false && !isBeingDestroyed) { return; } removeDocumentMouseDownListener(); popper.style.visibility = 'hidden'; instance.state.isVisible = false; instance.state.isShown = false; var transitionableElements = getTransitionableElements(); setTransitionDuration(transitionableElements, duration); setVisibilityState(transitionableElements, 'hidden'); onTransitionedOut(duration, function () { if (instance.props.aria) { var node = getEventListenersTarget(); var attrName = "aria-" + instance.props.aria; var currentAttrValue = node.getAttribute(attrName); var nextAttrValue = currentAttrValue ? currentAttrValue.replace(tooltip.id, '').trim() : null; if (nextAttrValue) { node.setAttribute(attrName, nextAttrValue); } else { node.removeAttribute(attrName); } } instance.popperInstance.disableEventListeners(); instance.popperInstance.options.placement = instance.props.placement; popper.parentNode.removeChild(popper); instance.props.onHidden(instance); instance.state.isMounted = false; }); } function destroy() { if (instance.state.isDestroyed) { return; } isBeingDestroyed = true; instance.hide(0); removeTriggersFromEventListenersTarget(); delete reference._tippy; if (instance.popperInstance) { instance.popperInstance.destroy(); } isBeingDestroyed = false; instance.state.isDestroyed = true; } } /** * Exported module */ function tippy(targets, optionalProps) { bindGlobalEventListeners(); var props = _extends$1({}, defaultProps, {}, optionalProps); var elements = getArrayOfElements(targets); var instances = elements.reduce(function (acc, reference) { var instance = reference && createTippy(reference, props); if (instance) { acc.push(instance); } return acc; }, []); return isRealElement(targets) ? instances[0] : instances; } tippy.version = version; tippy.defaultProps = defaultProps; tippy.currentInput = currentInput; /** * Mutates the defaultProps object by setting the props specified */ tippy.setDefaultProps = function (partialProps) { Object.keys(partialProps).forEach(function (key) { // @ts-ignore defaultProps[key] = partialProps[key]; }); }; /** * Hides all visible poppers on the document */ tippy.hideAll = function (_temp) { var _ref = _temp === void 0 ? {} : _temp, excludedReferenceOrInstance = _ref.exclude, duration = _ref.duration; arrayFrom(document.querySelectorAll(POPPER_SELECTOR)).forEach(function (popper) { var instance = popper._tippy; if (instance) { var isExcluded = false; if (excludedReferenceOrInstance) { isExcluded = isReferenceElement(excludedReferenceOrInstance) ? instance.reference === excludedReferenceOrInstance : popper === excludedReferenceOrInstance.popper; } if (!isExcluded) { instance.hide(duration); } } }); }; /** * Auto-init tooltips for elements with a `data-tippy="..."` attribute */ function autoInit() { arrayFrom(document.querySelectorAll('[data-tippy]')).forEach(function (el) { var content = el.getAttribute('data-tippy'); if (content) { tippy(el, { content: content }); } }); } if (isBrowser) { setTimeout(autoInit); } /**! * tippy.js v5.0.0-beta.1 * (c) 2017-2019 atomiks * MIT License */ var css = ".tippy-tooltip[data-animation=fade][data-state=hidden]{opacity:0}.tippy-iOS{cursor:pointer!important;-webkit-tap-highlight-color:transparent}.tippy-popper{pointer-events:none;max-width:calc(100% - 10px);transition-timing-function:cubic-bezier(.165,.84,.44,1)}.tippy-tooltip{position:relative;color:#fff;border-radius:.25rem;font-size:.875rem;line-height:1.4;background-color:#333;overflow:hidden;transition-property:visibility,opacity,transform;outline:0}.tippy-tooltip[data-placement^=top] .tippy-arrow{border-width:8px 8px 0;border-top-color:#333;margin:0 3px;transform-origin:50% 0;bottom:-7px}.tippy-tooltip[data-placement^=bottom] .tippy-arrow{border-width:0 8px 8px;border-bottom-color:#333;margin:0 3px;transform-origin:50% 7px;top:-7px}.tippy-tooltip[data-placement^=left] .tippy-arrow{border-width:8px 0 8px 8px;border-left-color:#333;margin:3px 0;transform-origin:0 50%;right:-7px}.tippy-tooltip[data-placement^=right] .tippy-arrow{border-width:8px 8px 8px 0;border-right-color:#333;margin:3px 0;transform-origin:7px 50%;left:-7px}.tippy-tooltip[data-arrow]{overflow:visible}.tippy-tooltip[data-animatefill]{background-color:transparent!important}.tippy-tooltip[data-interactive]{pointer-events:auto}.tippy-tooltip[data-inertia][data-state=visible]{transition-timing-function:cubic-bezier(.54,1.5,.38,1.11)}.tippy-tooltip[data-inertia][data-state=hidden]{transition-timing-function:ease}.tippy-arrow{border-color:transparent;border-style:solid;position:absolute}.tippy-arrow[data-state=hidden]{opacity:0}.tippy-content{padding:.3125rem .5625rem}"; /** * Injects a string of CSS styles to a style node in <head> */ function injectCSS(css) { var style = document.createElement('style'); style.textContent = css; style.setAttribute('data-tippy-stylesheet', ''); var head = document.head; var firstStyleOrLinkTag = head.querySelector('style,link'); if (firstStyleOrLinkTag) { head.insertBefore(style, firstStyleOrLinkTag); } else { head.appendChild(style); } } if (isBrowser) { injectCSS(css); } /** * Ensure class prefix ends in `-` * @param {string} prefix The prefix to prepend to the class names generated by nano-css * @return {string} The prefix ending in `-` */ function normalizePrefix(prefix) { if (!isString(prefix) || prefix === '') { return ''; } return prefix.charAt(prefix.length - 1) !== '-' ? prefix + "-" : prefix; } /** * Checks if options.attachTo.element is a string, and if so, tries to find the element * @param {Step} step The step instance * @returns {{element, on}} * `element` is a qualified HTML Element * `on` is a string position value */ function parseAttachTo(step) { var options = step.options.attachTo || {}; var returnOpts = _extends({}, options); if (isString(options.element)) { // Can't override the element in user opts reference because we can't // guarantee that the element will exist in the future. try { returnOpts.element = document.querySelector(options.element); } catch (e) {// TODO } if (!returnOpts.element) { console.error("The element for this Shepherd step was not found " + options.element); } } return returnOpts; } /** * Determines options for the tooltip and initializes * `step.tooltip` as a Tippy.js instance. * @param {Step} step The step instance */ function setupTooltip(step) { if (isUndefined(tippy)) { throw new Error('Using the attachment feature of Shepherd requires the Tippy.js library'); } if (step.tooltip) { step.tooltip.destroy(); } var attachToOpts = parseAttachTo(step); step.tooltip = _makeTippyInstance(attachToOpts, step); step.target = attachToOpts.element; } /** * Generates a `Tippy` instance from a set of base `attachTo` options * @param attachToOptions * @param {Step} step The step instance * @return {tippy|Instance | Instance[]} The final tippy instance * @private */ function _makeTippyInstance(attachToOptions, step) { var tippyOptions = {}; var element = document.body; if (!attachToOptions.element || !attachToOptions.on) { tippyOptions = makeCenteredTippy(step); } else { tippyOptions = makeAttachedTippyOptions(attachToOptions, step); element = attachToOptions.element; } return tippy(element, tippyOptions); } /** * Remove any leftover modal target classes and add the modal target class to the currentElement * @param {HTMLElement} currentElement The element for the current step * @param {string} classPrefix The prefix to add to the class name */ function toggleShepherdModalClass(currentElement, classPrefix) { var shepherdModalTarget = document.querySelector("." + classPrefix + "shepherd-modal-target"); if (shepherdModalTarget) { shepherdModalTarget.classList.remove(classPrefix + "shepherd-modal-target"); } currentElement.classList.add(classPrefix + "shepherd-modal-target"); } var Component$1 = preact.Component; var ShepherdButton = /*#__PURE__*/ function (_Component) { _inheritsLoose(ShepherdButton, _Component); function ShepherdButton() { return _Component.apply(this, arguments) || this; } var _proto = ShepherdButton.prototype; _proto.render = function render(props) { var classPrefix = props.classPrefix, config = props.config, step = props.step, styles = props.styles; var action = config.action, classes = config.classes, secondary = config.secondary, text = config.text; return preact.h("button", { className: (classes || '') + styles.button + (secondary ? " " + classPrefix + "shepherd-button-secondary" : ''), onClick: action ? action.bind(step.tour) : null, tabindex: "0" }, text); }; return ShepherdButton; }(Component$1); var Component$2 = preact.Component; var ShepherdFooter = /*#__PURE__*/ function (_Component) { _inheritsLoose(ShepherdFooter, _Component); function ShepherdFooter() { return _Component.apply(this, arguments) || this; } var _proto = ShepherdFooter.prototype; _proto.render = function render(props) { var classPrefix = props.classPrefix, step = props.step, styles = props.styles; var buttons = step.options.buttons; return preact.h("footer", { className: styles.footer.trim() }, this._addButtons(buttons, classPrefix, step, styles)); }; _proto._addButtons = function _addButtons(buttons, classPrefix, step, styles) { if (buttons) { return buttons.map(function (config) { return preact.h(ShepherdButton, { classPrefix: classPrefix, config: config, key: config.toString(), step: step, styles: styles }); }); } return null; }; return ShepherdFooter; }(Component$2); var Component$3 = preact.Component; var ShepherdHeader = /*#__PURE__*/ function (_Component) { _inheritsLoose(ShepherdHeader, _Component); function ShepherdHeader(props) { var _this; _this = _Component.call(this, props) || this; _this.step = props.step; _this.handleCancelClick = _this.handleCancelClick.bind(_assertThisInitialized(_this)); return _this; } var _proto = ShepherdHeader.prototype; _proto.render = function render(props) { var labelId = props.labelId, step = props.step, styles = props.styles; var _step$options = step.options, cancelIcon = _step$options.cancelIcon, title = _step$options.title; return preact.h("header", { className: styles.header.trim() }, this.constructor._addTitle(labelId, styles, title), this._addCancelLink(cancelIcon, styles)); } /** * Add a click listener to the cancel link that cancels the tour */ ; _proto.handleCancelClick = function handleCancelClick(e) { e.preventDefault(); this.step.cancel(); }; ShepherdHeader._addTitle = function _addTitle(labelId, styles, title) { if (title) { return preact.h("h3", { id: labelId, className: styles.title.trim() }, title); } return null; } /** * If enabled, add the cancel "x" icon * @param {object} cancelIcon The options for the cancel icon * @param styles * @return {null|*} * @private */ ; _proto._addCancelLink = function _addCancelLink(cancelIcon, styles) { if (cancelIcon && cancelIcon.enabled) { return preact.h("button", { "aria-label": cancelIcon.label ? cancelIcon.label : 'Close Tour', className: styles['cancel-icon'].trim(), onClick: this.handleCancelClick, type: "button" }, preact.h("span", { "aria-hidden": "true" }, "\xD7")); } return null; }; return ShepherdHeader; }(Component$3); var Component$4 = preact.Component; var ShepherdText = /*#__PURE__*/ function (_Component) { _inheritsLoose(ShepherdText, _Component); function ShepherdText() { return _Component.apply(this, arguments) || this; } var _proto = ShepherdText.prototype; _proto.shouldComponentUpdate = function shouldComponentUpdate() { return false; }; _proto.componentDidMount = function componentDidMount() { var step = this.props.step; var text = step.options.text; if (isFunction(text)) { text = text.call(step); } if (isElement(text)) { this.base.appendChild(text); } }; _proto.render = function render(props) { var descriptionId = props.descriptionId, step = props.step, styles = props.styles; var text = step.options.text; if (isFunction(text)) { text = text.call(step); } return preact.h("div", { className: styles.text.trim(), dangerouslySetInnerHTML: { __html: !isElement(text) ? text : null }, id: descriptionId }); }; return ShepherdText; }(Component$4); var Component$5 = preact.Component; var ShepherdContent = /*#__PURE__*/ function (_Component) { _inheritsLoose(ShepherdContent, _Component); function ShepherdContent() { return _Component.apply(this, arguments) || this; } var _proto = ShepherdContent.prototype; _proto.render = function render(props) { var classPrefix = props.classPrefix, descriptionId = props.descriptionId, labelId = props.labelId, step = props.step, styles = props.styles; return preact.h("div", { className: styles.content.trim() }, preact.h(ShepherdHeader, { labelId: labelId, step: step, styles: styles }), ShepherdContent._addShepherdText(descriptionId, step, styles), ShepherdContent._addShepherdFooter(classPrefix, step, styles)); }; ShepherdContent._addShepherdText = function _addShepherdText(descriptionId, step, styles) { if (!isUndefined(step.options.text)) { return preact.h(ShepherdText, { descriptionId: descriptionId, step: step, styles: styles }); } return null; }; ShepherdContent._addShepherdFooter = function _addShepherdFooter(classPrefix, step, styles) { if (Array.isArray(step.options.buttons) && step.options.buttons.length) { return preact.h(ShepherdFooter, { classPrefix: classPrefix, step: step, styles: styles }); } return null; }; return ShepherdContent; }(Component$5); var Component$6 = preact.Component; var KEY_TAB = 9; var KEY_ESC = 27; var LEFT_ARROW = 37; var RIGHT_ARROW = 39; var ShepherdElement = /*#__PURE__*/ function (_Component) { _inheritsLoose(ShepherdElement, _Component); function ShepherdElement(props) { var _this; _this = _Component.call(this, props) || this; _this.step = props.step; _this.handleKeyDown = _this.handleKeyDown.bind(_assertThisInitialized(_this)); return _this; } var _proto = ShepherdElement.prototype; _proto.componentDidMount = function componentDidMount() { // Get all elements that are focusable var focusableElements = this.element.querySelectorAll('a[href], area[href], input:not([disabled]), select:not([disabled]), textarea:not([disabled]), button:not([disabled]), [tabindex="0"]'); var firstFocusableElement = focusableElements[0]; var lastFocusableElement = focusableElements[focusableElements.length - 1]; this.focusableElements = focusableElements; this.firstFocusableElement = firstFocusableElement; this.lastFocusableElement = lastFocusableElement; }; _proto.render = function render(props) { var _dataStepId, _this2 = this; var classes = props.classes, classPrefix = props.classPrefix, descriptionId = props.descriptionId, labelId = props.labelId, step = props.step, styles = props.styles; var dataStepId = (_dataStepId = {}, _dataStepId["data-" + classPrefix + "shepherd-step-id"] = step.id, _dataStepId); return preact.h("div", _extends({ "aria-describedby": !isUndefined(step.options.text) ? descriptionId : null, "aria-labeledby": step.options.title ? labelId : null, className: classes + styles.element }, dataStepId, { onKeyDown: this.handleKeyDown, ref: function ref(c) { return _this2.element = c; }, role: "dialog", tabindex: "0" }), preact.h(ShepherdContent, { classPrefix: classPrefix, descriptionId: descriptionId, labelId: labelId, step: step, styles: styles })); } /** * Setup keydown events to allow closing the modal with ESC * * Borrowed from this great post! https://bitsofco.de/accessible-modal-dialog/ * * @private */ ; _proto.handleKeyDown = function handleKeyDown(e) { var tour = this.step.tour; switch (e.keyCode) { case KEY_TAB: if (this.focusableElements.length === 1) { e.preventDefault(); break; } // Backward tab if (e.shiftKey) { if (document.activeElement === this.firstFocusableElement) { e.preventDefault(); this.lastFocusableElement.focus(); } } else { if (document.activeElement === this.lastFocusableElement) { e.preventDefault(); this.firstFocusableElement.focus(); } } break; case KEY_ESC: if (tour.options.exitOnEsc) { this.step.cancel(); } break; case LEFT_ARROW: if (tour.options.keyboardNavigation) { tour.back(); } break; case RIGHT_ARROW: if (tour.options.keyboardNavigation) { tour.next(); } break; default: break; } }; return ShepherdElement; }(Component$6); if (!Element.prototype.matches) { Element.prototype.matches = Element.prototype.matchesSelector || Element.prototype.msMatchesSelector || Element.prototype.webkitMatchesSelector; } var smoothscroll = createCommonjsModule(function (module, exports) { /* smoothscroll v0.4.4 - 2019 - Dustan Kasten, Jeremias Menichelli - MIT License */ (function () { // polyfill function polyfill() { // aliases var w = window; var d = document; // return if scroll behavior is supported and polyfill is not forced if ( 'scrollBehavior' in d.documentElement.style && w.__forceSmoothScrollPolyfill__ !== true ) { return; } // globals var Element = w.HTMLElement || w.Element; var SCROLL_TIME = 468; // object gathering original scroll methods var original = { scroll: w.scroll || w.scrollTo, scrollBy: w.scrollBy, elementScroll: Element.prototype.scroll || scrollElement, scrollIntoView: Element.prototype.scrollIntoView }; // define timing method var now = w.performance && w.performance.now ? w.performance.now.bind(w.performance) : Date.now; /** * indicates if a the current browser is made by Microsoft * @method isMicrosoftBrowser * @param {String} userAgent * @returns {Boolean} */ function isMicrosoftBrowser(userAgent) { var userAgentPatterns = ['MSIE ', 'Trident/', 'Edge/']; return new RegExp(userAgentPatterns.join('|')).test(userAgent); } /* * IE has rounding bug rounding down clientHeight and clientWidth and * rounding up scrollHeight and scrollWidth causing false positives * on hasScrollableSpace */ var ROUNDING_TOLERANCE = isMicrosoftBrowser(w.navigator.userAgent) ? 1 : 0; /** * changes scroll position inside an element * @method scrollElement * @param {Number} x * @param {Number} y * @returns {undefined} */ function scrollElement(x, y) { this.scrollLeft = x; this.scrollTop = y; } /** * returns result of applying ease math function to a number * @method ease * @param {Number} k * @returns {Number} */ function ease(k) { return 0.5 * (1 - Math.cos(Math.PI * k)); } /** * indicates if a smooth behavior should be applied * @method shouldBailOut * @param {Number|Object} firstArg * @returns {Boolean} */ function shouldBailOut(firstArg) { if ( firstArg === null || typeof firstArg !== 'object' || firstArg.behavior === undefined || firstArg.behavior === 'auto' || firstArg.behavior === 'instant' ) { // first argument is not an object/null // or behavior is auto, instant or undefined return true; } if (typeof firstArg === 'object' && firstArg.behavior === 'smooth') { // first argument is an object and behavior is smooth return false; } // throw error when behavior is not supported throw new TypeError( 'behavior member of ScrollOptions ' + firstArg.behavior + ' is not a valid value for enumeration ScrollBehavior.' ); } /** * indicates if an element has scrollable space in the provided axis * @method hasScrollableSpace * @param {Node} el * @param {String} axis * @returns {Boolean} */ function hasScrollableSpace(el, axis) { if (axis === 'Y') { return el.clientHeight + ROUNDING_TOLERANCE < el.scrollHeight; } if (axis === 'X') { return el.clientWidth + ROUNDING_TOLERANCE < el.scrollWidth; } } /** * indicates if an element has a scrollable overflow property in the axis * @method canOverflow * @param {Node} el * @param {String} axis * @returns {Boolean} */ function canOverflow(el, axis) { var overflowValue = w.getComputedStyle(el, null)['overflow' + axis]; return overflowValue === 'auto' || overflowValue === 'scroll'; } /** * indicates if an element can be scrolled in either axis * @method isScrollable * @param {Node} el * @param {String} axis * @returns {Boolean} */ function isScrollable(el) { var isScrollableY = hasScrollableSpace(el, 'Y') && canOverflow(el, 'Y'); var isScrollableX = hasScrollableSpace(el, 'X') && canOverflow(el, 'X'); return isScrollableY || isScrollableX; } /** * finds scrollable parent of an element * @method findScrollableParent * @param {Node} el * @returns {Node} el */ function findScrollableParent(el) { while (el !== d.body && isScrollable(el) === false) { el = el.parentNode || el.host; } return el; } /** * self invoked function that, given a context, steps through scrolling * @method step * @param {Object} context * @returns {undefined} */ function step(context) { var time = now(); var value; var currentX; var currentY; var elapsed = (time - context.startTime) / SCROLL_TIME; // avoid elapsed times higher than one elapsed = elapsed > 1 ? 1 : elapsed; // apply easing to elapsed time value = ease(elapsed); currentX = context.startX + (context.x - context.startX) * value; currentY = context.startY + (context.y - context.startY) * value; context.method.call(context.scrollable, currentX, currentY); // scroll more if we have not reached our destination if (currentX !== context.x || currentY !== context.y) { w.requestAnimationFrame(step.bind(w, context)); } } /** * scrolls window or element with a smooth behavior * @method smoothScroll * @param {Object|Node} el * @param {Number} x * @param {Number} y * @returns {undefined} */ function smoothScroll(el, x, y) { var scrollable; var startX; var startY; var method; var startTime = now(); // define scroll context if (el === d.body) { scrollable = w; startX = w.scrollX || w.pageXOffset; startY = w.scrollY || w.pageYOffset; method = original.scroll; } else { scrollable = el; startX = el.scrollLeft; startY = el.scrollTop; method = scrollElement; } // scroll looping over a frame step({ scrollable: scrollable, method: method, startTime: startTime, startX: startX, startY: startY, x: x, y: y }); } // ORIGINAL METHODS OVERRIDES // w.scroll and w.scrollTo w.scroll = w.scrollTo = function() { // avoid action when no arguments are passed if (arguments[0] === undefined) { return; } // avoid smooth behavior if not required if (shouldBailOut(arguments[0]) === true) { original.scroll.call( w, arguments[0].left !== undefined ? arguments[0].left : typeof arguments[0] !== 'object' ? arguments[0] : w.scrollX || w.pageXOffset, // use top prop, second argument if present or fallback to scrollY arguments[0].top !== undefined ? arguments[0].top : arguments[1] !== undefined ? arguments[1] : w.scrollY || w.pageYOffset ); return; } // LET THE SMOOTHNESS BEGIN! smoothScroll.call( w, d.body, arguments[0].left !== undefined ? ~~arguments[0].left : w.scrollX || w.pageXOffset, arguments[0].top !== undefined ? ~~arguments[0].top : w.scrollY || w.pageYOffset ); }; // w.scrollBy w.scrollBy = function() { // avoid action when no arguments are passed if (arguments[0] === undefined) { return; } // avoid smooth behavior if not required if (shouldBailOut(arguments[0])) { original.scrollBy.call( w, arguments[0].left !== undefined ? arguments[0].left : typeof arguments[0] !== 'object' ? arguments[0] : 0, arguments[0].top !== undefined ? arguments[0].top : arguments[1] !== undefined ? arguments[1] : 0 ); return; } // LET THE SMOOTHNESS BEGIN! smoothScroll.call( w, d.body, ~~arguments[0].left + (w.scrollX || w.pageXOffset), ~~arguments[0].top + (w.scrollY || w.pageYOffset) ); }; // Element.prototype.scroll and Element.prototype.scrollTo Element.prototype.scroll = Element.prototype.scrollTo = function() { // avoid action when no arguments are passed if (arguments[0] === undefined) { return; } // avoid smooth behavior if not required if (shouldBailOut(arguments[0]) === true) { // if one number is passed, throw error to match Firefox implementation if (typeof arguments[0] === 'number' && arguments[1] === undefined) { throw new SyntaxError('Value could not be converted'); } original.elementScroll.call( this, // use left prop, first number argument or fallback to scrollLeft arguments[0].left !== undefined ? ~~arguments[0].left : typeof arguments[0] !== 'object' ? ~~arguments[0] : this.scrollLeft, // use top prop, second argument or fallback to scrollTop arguments[0].top !== undefined ? ~~arguments[0].top : arguments[1] !== undefined ? ~~arguments[1] : this.scrollTop ); return; } var left = arguments[0].left; var top = arguments[0].top; // LET THE SMOOTHNESS BEGIN! smoothScroll.call( this, this, typeof left === 'undefined' ? this.scrollLeft : ~~left, typeof top === 'undefined' ? this.scrollTop : ~~top ); }; // Element.prototype.scrollBy Element.prototype.scrollBy = function() { // avoid action when no arguments are passed if (arguments[0] === undefined) { return; } // avoid smooth behavior if not required if (shouldBailOut(arguments[0]) === true) { original.elementScroll.call( this, arguments[0].left !== undefined ? ~~arguments[0].left + this.scrollLeft : ~~arguments[0] + this.scrollLeft, arguments[0].top !== undefined ? ~~arguments[0].top + this.scrollTop : ~~arguments[1] + this.scrollTop ); return; } this.scroll({ left: ~~arguments[0].left + this.scrollLeft, top: ~~arguments[0].top + this.scrollTop, behavior: arguments[0].behavior }); }; // Element.prototype.scrollIntoView Element.prototype.scrollIntoView = function() { // avoid smooth behavior if not required if (shouldBailOut(arguments[0]) === true) { original.scrollIntoView.call( this, arguments[0] === undefined ? true : arguments[0] ); return; } // LET THE SMOOTHNESS BEGIN! var scrollableParent = findScrollableParent(this); var parentRects = scrollableParent.getBoundingClientRect(); var clientRects = this.getBoundingClientRect(); if (scrollableParent !== d.body) { // reveal element inside parent smoothScroll.call( this, scrollableParent, scrollableParent.scrollLeft + clientRects.left - parentRects.left, scrollableParent.scrollTop + clientRects.top - parentRects.top ); // reveal parent in viewport unless is fixed if (w.getComputedStyle(scrollableParent).position !== 'fixed') { w.scrollBy({ left: parentRects.left, top: parentRects.top, behavior: 'smooth' }); } } else { // reveal element in viewport w.scrollBy({ left: clientRects.left, top: clientRects.top, behavior: 'smooth' }); } }; } { // commonjs module.exports = { polyfill: polyfill }; } }()); }); var smoothscroll_1 = smoothscroll.polyfill; smoothscroll.polyfill(); var render$1 = preact.render; /** * Creates incremented ID for each newly created step * * @return {Function} A function that returns the unique id for the step * @private */ var uniqueId = function () { var id = 0; return function () { return ++id; }; }(); /** * A class representing steps to be added to a tour. * @extends {Evented} */ var Step = /*#__PURE__*/ function (_Evented) { _inheritsLoose(Step, _Evented); /** * Create a step * @param {Tour} tour The tour for the step * @param {Object} options The options for the step * @param {Object} options.attachTo What element the step should be attached to on the page. * It should be an object with the properties `element` and `on`, where `element` is an element selector string * or a DOM element and `on` is the optional direction to place the Tippy tooltip. * * ```js * const new Step(tour, { * attachTo: { element: '.some .selector-path', on: 'left' }, * ...moreOptions * })' * ``` * * If you don’t specify an attachTo the element will appear in the middle of the screen. * If you omit the `on` portion of `attachTo`, the element will still be highlighted, but the tooltip will appear * in the middle of the screen, without an arrow pointing to the target. * @param {HTMLElement|string} options.attachTo.element * @param {string} options.attachTo.on * @param {Object} options.advanceOn An action on the page which should advance shepherd to the next step. * It should be an object with a string `selector` and an `event` name * ```js * const new Step(tour, { * advanceOn: { selector: '.some .selector-path', event: 'click' }, * ...moreOptions * })' * ``` * `event` doesn’t have to be an event inside the tour, it can be any event fired on any element on the page. * You can also always manually advance the Tour by calling `myTour.next()`. * @param {function} options.beforeShowPromise A function that returns a promise. * When the promise resolves, the rest of the `show` code for the step will execute. * @param {Object[]} options.buttons An array of buttons to add to the step. These will be rendered in a * footer below the main body text. * @param {function} options.buttons.button.action A function executed when the button is clicked on. * It is automatically bound to the `tour` the step is associated with, so things like `this.next` will * work inside the action. * You can use action to skip steps or navigate to specific steps, with something like: * ```js * action() { * return this.show('some_step_name'); * } * ``` * @param {string} options.buttons.button.classes Extra classes to apply to the `<a>` * @param {boolean} options.buttons.button.secondary If true, a shepherd-button-secondary class is applied to the button * @param {string} options.buttons.button.text The HTML text of the button * @param {boolean} options.canClickTarget A boolean, that when set to false, will set `pointer-events: none` on the target * @param {object} options.cancelIcon Options for the cancel icon * @param {boolean} options.cancelIcon.enabled Should a cancel “✕” be shown in the header of the step? * @param {string} options.cancelIcon.label The label to add for `aria-label` * @param {string} options.classes A string of extra classes to add to the step's content element. * @param {string} options.highlightClass An extra class to apply to the `attachTo` element when it is * highlighted (that is, when its step is active). You can then target that selector in your CSS. * @param {string} options.id The string to use as the `id` for the step. * @param {Object} options.tippyOptions Extra [options to pass to tippy.js]{@link https://atomiks.github.io/tippyjs/#all-options} * @param {boolean|Object} options.scrollTo Should the element be scrolled to when this step is shown? If true, uses the default `scrollIntoView`, * if an object, passes that object as the params to `scrollIntoView` i.e. `{behavior: 'smooth', block: 'center'}` * @param {function} options.scrollToHandler A function that lets you override the default scrollTo behavior and * define a custom action to do the scrolling, and possibly other logic. * @param {function} options.showOn A function that, when it returns `true`, will show the step. * If it returns false, the step will be skipped. * @param {string} options.text The text in the body of the step. It can be one of three types: * ``` * - HTML string * - `HTMLElement` object * - `Function` to be executed when the step is built. It must return one the two options above. * ``` * @param {string} options.title The step's title. It becomes an `h3` at the top of the step. * @param {Object} options.when You can define `show`, `hide`, etc events inside `when`. For example: * ```js * when: { * show: function() { * window.scrollTo(0, 0); * } * } * ``` * @param {Number} options.modalOverlayOpeningPadding An amount of padding to add around the modal overlay opening * @return {Step} The newly created Step instance */ function Step(tour, options) { var _this; if (options === void 0) { options = {}; } _this = _Evented.call(this, tour, options) || this; _this.tour = tour; _this.classPrefix = _this.tour.options ? normalizePrefix(_this.tour.options.classPrefix) : ''; _this.styles = tour.styles; autoBind(_assertThisInitialized(_this)); _this._setOptions(options); return _assertThisInitialized(_this) || _assertThisInitialized(_this); } /** * Cancel the tour * Triggers the `cancel` event */ var _proto = Step.prototype; _proto.cancel = function cancel() { this.tour.cancel(); this.trigger('cancel'); } /** * Complete the tour * Triggers the `complete` event */ ; _proto.complete = function complete() { this.tour.complete(); this.trigger('complete'); } /** * Remove the step, delete the step's element, and destroy the tippy instance for the step * Triggers `destroy` event */ ; _proto.destroy = function destroy() { if (this.tooltip) { this.tooltip.destroy(); this.tooltip = null; } if (isElement(this.el) && this.el.parentNode) { this.el.parentNode.removeChild(this.el); this.el = null; } if (this.target) { this._updateStepTargetOnHide(); } this.trigger('destroy'); } /** * Returns the tour for the step * @return {Tour} The tour instance */ ; _proto.getTour = function getTour() { return this.tour; } /** * Hide the step and destroy the tippy instance */ ; _proto.hide = function hide() { this.tour.modal.hide(); this.trigger('before-hide'); document.body.removeAttribute("data-" + this.classPrefix + "shepherd-step"); if (this.target) { this._updateStepTargetOnHide(); } if (this.tooltip) { this.tooltip.hide(); } this.trigger('hide'); } /** * Check if the step is open and visible * @return {boolean} True if the step is open and visible */ ; _proto.isOpen = function isOpen() { return Boolean(this.tooltip && this.tooltip.state && this.tooltip.state.isVisible); } /** * Wraps `_show` and ensures `beforeShowPromise` resolves before calling show * @return {*|Promise} */ ; _proto.show = function show() { var _this2 = this; if (isFunction(this.options.beforeShowPromise)) { var beforeShowPromise = this.options.beforeShowPromise(); if (!isUndefined(beforeShowPromise)) { return beforeShowPromise.then(function () { return _this2._show(); }); } } this._show(); } /** * Creates Shepherd element for step based on options * * @return {Element} The DOM element for the step tooltip * @private */ ; _proto._createTooltipContent = function _createTooltipContent() { var cancelIconEnabled = getValue(this, 'options.cancelIcon.enabled'); var classes = this.options.classes || ''; var descriptionId = this.id + "-description"; var labelId = this.id + "-label"; if (cancelIconEnabled) { classes += " " + this.classPrefix + "shepherd-has-cancel-icon"; } return render$1(preact.h(ShepherdElement, { classPrefix: this.classPrefix, classes: classes, descriptionId: descriptionId, labelId: labelId, step: this, styles: this.styles }), null); } /** * If a custom scrollToHandler is defined, call that, otherwise do the generic * scrollIntoView call. * * @param {boolean|Object} scrollToOptions If true, uses the default `scrollIntoView`, * if an object, passes that object as the params to `scrollIntoView` i.e. `{ behavior: 'smooth', block: 'center' }` * @private */ ; _proto._scrollTo = function _scrollTo(scrollToOptions) { var _parseAttachTo = parseAttachTo(this), element = _parseAttachTo.element; if (isFunction(this.options.scrollToHandler)) { this.options.scrollToHandler(element); } else if (isElement(element)) { element.scrollIntoView(scrollToOptions); } } /** * Sets the options for the step, maps `when` to events, sets up buttons * @param {Object} options The options for the step * @private */ ; _proto._setOptions = function _setOptions(options) { var _this3 = this; if (options === void 0) { options = {}; } this.options = options; var when = this.options.when; this.destroy(); this.id = this.options.id || "step-" + uniqueId(); if (when) { Object.keys(when).forEach(function (event) { _this3.on(event, when[event], _this3); }); } } /** * Create the element and set up the tippy instance * @private */ ; _proto._setupElements = function _setupElements() { if (!isUndefined(this.el)) { this.destroy(); } this.el = this._createTooltipContent(); if (this.options.advanceOn) { bindAdvance(this); } setupTooltip(this); } /** * Triggers `before-show`, generates the tooltip DOM content, * sets up a tippy instance for the tooltip, then triggers `show`. * @private */ ; _proto._show = function _show() { var _this4 = this; this.trigger('before-show'); if (!this.el) { this._setupElements(); } this.tour.modal.setupForStep(this); this._styleTargetElementForStep(this); var target = this.target || document.body; target.classList.add(this.classPrefix + "shepherd-enabled", this.classPrefix + "shepherd-target"); document.body.setAttribute("data-" + this.classPrefix + "shepherd-step", this.id); if (this.options.scrollTo) { setTimeout(function () { _this4._scrollTo(_this4.options.scrollTo); }); } this.tooltip.show(); this.trigger('show'); this.el.focus(); } /** * Modulates the styles of the passed step's target element, based on the step's options and * the tour's `modal` option, to visually emphasize the element * * @param step The step object that attaches to the element * @private */ ; _proto._styleTargetElementForStep = function _styleTargetElementForStep(step) { var targetElement = step.target; if (!targetElement) { return; } toggleShepherdModalClass(targetElement, step.classPrefix); if (step.options.highlightClass) { targetElement.classList.add(step.options.highlightClass); } if (step.options.canClickTarget === false) { targetElement.style.pointerEvents = 'none'; } } /** * When a step is hidden, remove the highlightClass and 'shepherd-enabled' * and 'shepherd-target' classes * @private */ ; _proto._updateStepTargetOnHide = function _updateStepTargetOnHide() { if (this.options.highlightClass) { this.target.classList.remove(this.options.highlightClass); } this.target.classList.remove(this.classPrefix + "shepherd-enabled", this.classPrefix + "shepherd-target"); }; return Step; }(Evented); var bodyScrollLock_min = createCommonjsModule(function (module, exports) { !function(e,t){t(exports);}(commonjsGlobal,function(exports){function r(e){if(Array.isArray(e)){for(var t=0,o=Array(e.length);t<e.length;t++)o[t]=e[t];return o}return Array.from(e)}Object.defineProperty(exports,"__esModule",{value:!0});var l=!1;if("undefined"!=typeof window){var e={get passive(){l=!0;}};window.addEventListener("testPassive",null,e),window.removeEventListener("testPassive",null,e);}var d="undefined"!=typeof window&&window.navigator&&window.navigator.platform&&/iP(ad|hone|od)/.test(window.navigator.platform),c=[],u=!1,a=-1,s=void 0,v=void 0,f=function(t){return c.some(function(e){return !(!e.options.allowTouchMove||!e.options.allowTouchMove(t))})},m=function(e){var t=e||window.event;return !!f(t.target)||(1<t.touches.length||(t.preventDefault&&t.preventDefault(),!1))},o=function(){setTimeout(function(){void 0!==v&&(document.body.style.paddingRight=v,v=void 0),void 0!==s&&(document.body.style.overflow=s,s=void 0);});};exports.disableBodyScroll=function(i,e){if(d){if(!i)return void console.error("disableBodyScroll unsuccessful - targetElement must be provided when calling disableBodyScroll on IOS devices.");if(i&&!c.some(function(e){return e.targetElement===i})){var t={targetElement:i,options:e||{}};c=[].concat(r(c),[t]),i.ontouchstart=function(e){1===e.targetTouches.length&&(a=e.targetTouches[0].clientY);},i.ontouchmove=function(e){var t,o,n,r;1===e.targetTouches.length&&(o=i,r=(t=e).targetTouches[0].clientY-a,!f(t.target)&&(o&&0===o.scrollTop&&0<r?m(t):(n=o)&&n.scrollHeight-n.scrollTop<=n.clientHeight&&r<0?m(t):t.stopPropagation()));},u||(document.addEventListener("touchmove",m,l?{passive:!1}:void 0),u=!0);}}else{n=e,setTimeout(function(){if(void 0===v){var e=!!n&&!0===n.reserveScrollBarGap,t=window.innerWidth-document.documentElement.clientWidth;e&&0<t&&(v=document.body.style.paddingRight,document.body.style.paddingRight=t+"px");}void 0===s&&(s=document.body.style.overflow,document.body.style.overflow="hidden");});var o={targetElement:i,options:e||{}};c=[].concat(r(c),[o]);}var n;},exports.clearAllBodyScrollLocks=function(){d?(c.forEach(function(e){e.targetElement.ontouchstart=null,e.targetElement.ontouchmove=null;}),u&&(document.removeEventListener("touchmove",m,l?{passive:!1}:void 0),u=!1),c=[],a=-1):(o(),c=[]);},exports.enableBodyScroll=function(t){if(d){if(!t)return void console.error("enableBodyScroll unsuccessful - targetElement must be provided when calling enableBodyScroll on IOS devices.");t.ontouchstart=null,t.ontouchmove=null,c=c.filter(function(e){return e.targetElement!==t}),u&&0===c.length&&(document.removeEventListener("touchmove",m,l?{passive:!1}:void 0),u=!1);}else(c=c.filter(function(e){return e.targetElement!==t})).length||o();};}); }); var bodyScrollLock = unwrapExports(bodyScrollLock_min); var defaults = { trigger: 'manual', arrow: true, animation: 'fade', duration: 420, flip: true, animateFill: false, // https://atomiks.github.io/tippyjs/#animate-fill-option interactive: true, // https://atomiks.github.io/tippyjs/#interactive-option hideOnClick: 'toggle', // https://atomiks.github.io/tippyjs/#hide-on-click-option multiple: true // https://atomiks.github.io/tippyjs/#multiple-option }; /** * Cleanup the steps and set pointerEvents back to 'auto' * @param tour The tour object */ function cleanupSteps(tour) { if (tour) { var steps = tour.steps; steps.forEach(function (step) { if (step.options && step.options.canClickTarget === false && step.options.attachTo) { var stepElement = step.target; if (stepElement instanceof HTMLElement) { stepElement.style.pointerEvents = 'auto'; } } }); } } function _extends$3() { _extends$3 = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return _extends$3.apply(this, arguments); } function _assertThisInitialized$1(self) { if (self === void 0) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return self; } function _inheritsLoose$1(subClass, superClass) { subClass.prototype = Object.create(superClass.prototype); subClass.prototype.constructor = subClass; subClass.__proto__ = superClass; } function _getPrototypeOf(o) { _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { return o.__proto__ || Object.getPrototypeOf(o); }; return _getPrototypeOf(o); } function _setPrototypeOf(o, p) { _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { o.__proto__ = p; return o; }; return _setPrototypeOf(o, p); } function _isNativeFunction(fn) { return Function.toString.call(fn).indexOf("[native code]") !== -1; } function isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === "function") return true; try { Date.prototype.toString.call(Reflect.construct(Date, [], function () {})); return true; } catch (e) { return false; } } function _construct(Parent, args, Class) { if (isNativeReflectConstruct()) { _construct = Reflect.construct; } else { _construct = function _construct(Parent, args, Class) { var a = [null]; a.push.apply(a, args); var Constructor = Function.bind.apply(Parent, a); var instance = new Constructor(); if (Class) _setPrototypeOf(instance, Class.prototype); return instance; }; } return _construct.apply(null, arguments); } function _wrapNativeSuper(Class) { var _cache = typeof Map === "function" ? new Map() : undefined; _wrapNativeSuper = function _wrapNativeSuper(Class) { if (Class === null || !_isNativeFunction(Class)) return Class; if (typeof Class !== "function") { throw new TypeError("Super expression must either be null or a function"); } if (typeof _cache !== "undefined") { if (_cache.has(Class)) return _cache.get(Class); _cache.set(Class, Wrapper); } function Wrapper() { return _construct(Class, arguments, _getPrototypeOf(this).constructor); } Wrapper.prototype = Object.create(Class.prototype, { constructor: { value: Wrapper, enumerable: false, writable: true, configurable: true } }); return _setPrototypeOf(Wrapper, Class); }; return _wrapNativeSuper(Class); } /** * Create an error file out of errors.md for development and a simple web link to the full errors * in production mode. * @private */ var PolishedError = /*#__PURE__*/ function (_Error) { _inheritsLoose$1(PolishedError, _Error); function PolishedError(code) { var _this; { _this = _Error.call(this, "An error occurred. See https://github.com/styled-components/polished/blob/master/src/internalHelpers/errors.md#" + code + " for more information.") || this; } return _assertThisInitialized$1(_this); } return PolishedError; }( /*#__PURE__*/ _wrapNativeSuper(Error)); function colorToInt(color) { return Math.round(color * 255); } function convertToInt(red, green, blue) { return colorToInt(red) + "," + colorToInt(green) + "," + colorToInt(blue); } function hslToRgb(hue, saturation, lightness, convert) { if (convert === void 0) { convert = convertToInt; } if (saturation === 0) { // achromatic return convert(lightness, lightness, lightness); } // formulae from https://en.wikipedia.org/wiki/HSL_and_HSV var huePrime = (hue % 360 + 360) % 360 / 60; var chroma = (1 - Math.abs(2 * lightness - 1)) * saturation; var secondComponent = chroma * (1 - Math.abs(huePrime % 2 - 1)); var red = 0; var green = 0; var blue = 0; if (huePrime >= 0 && huePrime < 1) { red = chroma; green = secondComponent; } else if (huePrime >= 1 && huePrime < 2) { red = secondComponent; green = chroma; } else if (huePrime >= 2 && huePrime < 3) { green = chroma; blue = secondComponent; } else if (huePrime >= 3 && huePrime < 4) { green = secondComponent; blue = chroma; } else if (huePrime >= 4 && huePrime < 5) { red = secondComponent; blue = chroma; } else if (huePrime >= 5 && huePrime < 6) { red = chroma; blue = secondComponent; } var lightnessModification = lightness - chroma / 2; var finalRed = red + lightnessModification; var finalGreen = green + lightnessModification; var finalBlue = blue + lightnessModification; return convert(finalRed, finalGreen, finalBlue); } var namedColorMap = { aliceblue: 'f0f8ff', antiquewhite: 'faebd7', aqua: '00ffff', aquamarine: '7fffd4', azure: 'f0ffff', beige: 'f5f5dc', bisque: 'ffe4c4', black: '000', blanchedalmond: 'ffebcd', blue: '0000ff', blueviolet: '8a2be2', brown: 'a52a2a', burlywood: 'deb887', cadetblue: '5f9ea0', chartreuse: '7fff00', chocolate: 'd2691e', coral: 'ff7f50', cornflowerblue: '6495ed', cornsilk: 'fff8dc', crimson: 'dc143c', cyan: '00ffff', darkblue: '00008b', darkcyan: '008b8b', darkgoldenrod: 'b8860b', darkgray: 'a9a9a9', darkgreen: '006400', darkgrey: 'a9a9a9', darkkhaki: 'bdb76b', darkmagenta: '8b008b', darkolivegreen: '556b2f', darkorange: 'ff8c00', darkorchid: '9932cc', darkred: '8b0000', darksalmon: 'e9967a', darkseagreen: '8fbc8f', darkslateblue: '483d8b', darkslategray: '2f4f4f', darkslategrey: '2f4f4f', darkturquoise: '00ced1', darkviolet: '9400d3', deeppink: 'ff1493', deepskyblue: '00bfff', dimgray: '696969', dimgrey: '696969', dodgerblue: '1e90ff', firebrick: 'b22222', floralwhite: 'fffaf0', forestgreen: '228b22', fuchsia: 'ff00ff', gainsboro: 'dcdcdc', ghostwhite: 'f8f8ff', gold: 'ffd700', goldenrod: 'daa520', gray: '808080', green: '008000', greenyellow: 'adff2f', grey: '808080', honeydew: 'f0fff0', hotpink: 'ff69b4', indianred: 'cd5c5c', indigo: '4b0082', ivory: 'fffff0', khaki: 'f0e68c', lavender: 'e6e6fa', lavenderblush: 'fff0f5', lawngreen: '7cfc00', lemonchiffon: 'fffacd', lightblue: 'add8e6', lightcoral: 'f08080', lightcyan: 'e0ffff', lightgoldenrodyellow: 'fafad2', lightgray: 'd3d3d3', lightgreen: '90ee90', lightgrey: 'd3d3d3', lightpink: 'ffb6c1', lightsalmon: 'ffa07a', lightseagreen: '20b2aa', lightskyblue: '87cefa', lightslategray: '789', lightslategrey: '789', lightsteelblue: 'b0c4de', lightyellow: 'ffffe0', lime: '0f0', limegreen: '32cd32', linen: 'faf0e6', magenta: 'f0f', maroon: '800000', mediumaquamarine: '66cdaa', mediumblue: '0000cd', mediumorchid: 'ba55d3', mediumpurple: '9370db', mediumseagreen: '3cb371', mediumslateblue: '7b68ee', mediumspringgreen: '00fa9a', mediumturquoise: '48d1cc', mediumvioletred: 'c71585', midnightblue: '191970', mintcream: 'f5fffa', mistyrose: 'ffe4e1', moccasin: 'ffe4b5', navajowhite: 'ffdead', navy: '000080', oldlace: 'fdf5e6', olive: '808000', olivedrab: '6b8e23', orange: 'ffa500', orangered: 'ff4500', orchid: 'da70d6', palegoldenrod: 'eee8aa', palegreen: '98fb98', paleturquoise: 'afeeee', palevioletred: 'db7093', papayawhip: 'ffefd5', peachpuff: 'ffdab9', peru: 'cd853f', pink: 'ffc0cb', plum: 'dda0dd', powderblue: 'b0e0e6', purple: '800080', rebeccapurple: '639', red: 'f00', rosybrown: 'bc8f8f', royalblue: '4169e1', saddlebrown: '8b4513', salmon: 'fa8072', sandybrown: 'f4a460', seagreen: '2e8b57', seashell: 'fff5ee', sienna: 'a0522d', silver: 'c0c0c0', skyblue: '87ceeb', slateblue: '6a5acd', slategray: '708090', slategrey: '708090', snow: 'fffafa', springgreen: '00ff7f', steelblue: '4682b4', tan: 'd2b48c', teal: '008080', thistle: 'd8bfd8', tomato: 'ff6347', turquoise: '40e0d0', violet: 'ee82ee', wheat: 'f5deb3', white: 'fff', whitesmoke: 'f5f5f5', yellow: 'ff0', yellowgreen: '9acd32' /** * Checks if a string is a CSS named color and returns its equivalent hex value, otherwise returns the original color. * @private */ }; function nameToHex(color) { if (typeof color !== 'string') return color; var normalizedColorName = color.toLowerCase(); return namedColorMap[normalizedColorName] ? "#" + namedColorMap[normalizedColorName] : color; } var hexRegex = /^#[a-fA-F0-9]{6}$/; var hexRgbaRegex = /^#[a-fA-F0-9]{8}$/; var reducedHexRegex = /^#[a-fA-F0-9]{3}$/; var reducedRgbaHexRegex = /^#[a-fA-F0-9]{4}$/; var rgbRegex = /^rgb\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*\)$/i; var rgbaRegex = /^rgba\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*([-+]?[0-9]*[.]?[0-9]+)\s*\)$/i; var hslRegex = /^hsl\(\s*(\d{0,3}[.]?[0-9]+)\s*,\s*(\d{1,3})%\s*,\s*(\d{1,3})%\s*\)$/i; var hslaRegex = /^hsla\(\s*(\d{0,3}[.]?[0-9]+)\s*,\s*(\d{1,3})%\s*,\s*(\d{1,3})%\s*,\s*([-+]?[0-9]*[.]?[0-9]+)\s*\)$/i; /** * Returns an RgbColor or RgbaColor object. This utility function is only useful * if want to extract a color component. With the color util `toColorString` you * can convert a RgbColor or RgbaColor object back to a string. * * @example * // Assigns `{ red: 255, green: 0, blue: 0 }` to color1 * const color1 = parseToRgb('rgb(255, 0, 0)'); * // Assigns `{ red: 92, green: 102, blue: 112, alpha: 0.75 }` to color2 * const color2 = parseToRgb('hsla(210, 10%, 40%, 0.75)'); */ function parseToRgb(color) { if (typeof color !== 'string') { throw new PolishedError(3); } var normalizedColor = nameToHex(color); if (normalizedColor.match(hexRegex)) { return { red: parseInt("" + normalizedColor[1] + normalizedColor[2], 16), green: parseInt("" + normalizedColor[3] + normalizedColor[4], 16), blue: parseInt("" + normalizedColor[5] + normalizedColor[6], 16) }; } if (normalizedColor.match(hexRgbaRegex)) { var alpha = parseFloat((parseInt("" + normalizedColor[7] + normalizedColor[8], 16) / 255).toFixed(2)); return { red: parseInt("" + normalizedColor[1] + normalizedColor[2], 16), green: parseInt("" + normalizedColor[3] + normalizedColor[4], 16), blue: parseInt("" + normalizedColor[5] + normalizedColor[6], 16), alpha: alpha }; } if (normalizedColor.match(reducedHexRegex)) { return { red: parseInt("" + normalizedColor[1] + normalizedColor[1], 16), green: parseInt("" + normalizedColor[2] + normalizedColor[2], 16), blue: parseInt("" + normalizedColor[3] + normalizedColor[3], 16) }; } if (normalizedColor.match(reducedRgbaHexRegex)) { var _alpha = parseFloat((parseInt("" + normalizedColor[4] + normalizedColor[4], 16) / 255).toFixed(2)); return { red: parseInt("" + normalizedColor[1] + normalizedColor[1], 16), green: parseInt("" + normalizedColor[2] + normalizedColor[2], 16), blue: parseInt("" + normalizedColor[3] + normalizedColor[3], 16), alpha: _alpha }; } var rgbMatched = rgbRegex.exec(normalizedColor); if (rgbMatched) { return { red: parseInt("" + rgbMatched[1], 10), green: parseInt("" + rgbMatched[2], 10), blue: parseInt("" + rgbMatched[3], 10) }; } var rgbaMatched = rgbaRegex.exec(normalizedColor); if (rgbaMatched) { return { red: parseInt("" + rgbaMatched[1], 10), green: parseInt("" + rgbaMatched[2], 10), blue: parseInt("" + rgbaMatched[3], 10), alpha: parseFloat("" + rgbaMatched[4]) }; } var hslMatched = hslRegex.exec(normalizedColor); if (hslMatched) { var hue = parseInt("" + hslMatched[1], 10); var saturation = parseInt("" + hslMatched[2], 10) / 100; var lightness = parseInt("" + hslMatched[3], 10) / 100; var rgbColorString = "rgb(" + hslToRgb(hue, saturation, lightness) + ")"; var hslRgbMatched = rgbRegex.exec(rgbColorString); if (!hslRgbMatched) { throw new PolishedError(4, normalizedColor, rgbColorString); } return { red: parseInt("" + hslRgbMatched[1], 10), green: parseInt("" + hslRgbMatched[2], 10), blue: parseInt("" + hslRgbMatched[3], 10) }; } var hslaMatched = hslaRegex.exec(normalizedColor); if (hslaMatched) { var _hue = parseInt("" + hslaMatched[1], 10); var _saturation = parseInt("" + hslaMatched[2], 10) / 100; var _lightness = parseInt("" + hslaMatched[3], 10) / 100; var _rgbColorString = "rgb(" + hslToRgb(_hue, _saturation, _lightness) + ")"; var _hslRgbMatched = rgbRegex.exec(_rgbColorString); if (!_hslRgbMatched) { throw new PolishedError(4, normalizedColor, _rgbColorString); } return { red: parseInt("" + _hslRgbMatched[1], 10), green: parseInt("" + _hslRgbMatched[2], 10), blue: parseInt("" + _hslRgbMatched[3], 10), alpha: parseFloat("" + hslaMatched[4]) }; } throw new PolishedError(5); } function rgbToHsl(color) { // make sure rgb are contained in a set of [0, 255] var red = color.red / 255; var green = color.green / 255; var blue = color.blue / 255; var max = Math.max(red, green, blue); var min = Math.min(red, green, blue); var lightness = (max + min) / 2; if (max === min) { // achromatic if (color.alpha !== undefined) { return { hue: 0, saturation: 0, lightness: lightness, alpha: color.alpha }; } else { return { hue: 0, saturation: 0, lightness: lightness }; } } var hue; var delta = max - min; var saturation = lightness > 0.5 ? delta / (2 - max - min) : delta / (max + min); switch (max) { case red: hue = (green - blue) / delta + (green < blue ? 6 : 0); break; case green: hue = (blue - red) / delta + 2; break; default: // blue case hue = (red - green) / delta + 4; break; } hue *= 60; if (color.alpha !== undefined) { return { hue: hue, saturation: saturation, lightness: lightness, alpha: color.alpha }; } return { hue: hue, saturation: saturation, lightness: lightness }; } /** * Returns an HslColor or HslaColor object. This utility function is only useful * if want to extract a color component. With the color util `toColorString` you * can convert a HslColor or HslaColor object back to a string. * * @example * // Assigns `{ hue: 0, saturation: 1, lightness: 0.5 }` to color1 * const color1 = parseToHsl('rgb(255, 0, 0)'); * // Assigns `{ hue: 128, saturation: 1, lightness: 0.5, alpha: 0.75 }` to color2 * const color2 = parseToHsl('hsla(128, 100%, 50%, 0.75)'); */ function parseToHsl(color) { // Note: At a later stage we can optimize this function as right now a hsl // color would be parsed converted to rgb values and converted back to hsl. return rgbToHsl(parseToRgb(color)); } /** * Reduces hex values if possible e.g. #ff8866 to #f86 * @private */ var reduceHexValue = function reduceHexValue(value) { if (value.length === 7 && value[1] === value[2] && value[3] === value[4] && value[5] === value[6]) { return "#" + value[1] + value[3] + value[5]; } return value; }; function numberToHex(value) { var hex = value.toString(16); return hex.length === 1 ? "0" + hex : hex; } function colorToHex(color) { return numberToHex(Math.round(color * 255)); } function convertToHex(red, green, blue) { return reduceHexValue("#" + colorToHex(red) + colorToHex(green) + colorToHex(blue)); } function hslToHex(hue, saturation, lightness) { return hslToRgb(hue, saturation, lightness, convertToHex); } /** * Returns a string value for the color. The returned result is the smallest possible hex notation. * * @example * // Styles as object usage * const styles = { * background: hsl(359, 0.75, 0.4), * background: hsl({ hue: 360, saturation: 0.75, lightness: 0.4 }), * } * * // styled-components usage * const div = styled.div` * background: ${hsl(359, 0.75, 0.4)}; * background: ${hsl({ hue: 360, saturation: 0.75, lightness: 0.4 })}; * ` * * // CSS in JS Output * * element { * background: "#b3191c"; * background: "#b3191c"; * } */ function hsl(value, saturation, lightness) { if (typeof value === 'number' && typeof saturation === 'number' && typeof lightness === 'number') { return hslToHex(value, saturation, lightness); } else if (typeof value === 'object' && saturation === undefined && lightness === undefined) { return hslToHex(value.hue, value.saturation, value.lightness); } throw new PolishedError(1); } /** * Returns a string value for the color. The returned result is the smallest possible rgba or hex notation. * * @example * // Styles as object usage * const styles = { * background: hsla(359, 0.75, 0.4, 0.7), * background: hsla({ hue: 360, saturation: 0.75, lightness: 0.4, alpha: 0,7 }), * background: hsla(359, 0.75, 0.4, 1), * } * * // styled-components usage * const div = styled.div` * background: ${hsla(359, 0.75, 0.4, 0.7)}; * background: ${hsla({ hue: 360, saturation: 0.75, lightness: 0.4, alpha: 0,7 })}; * background: ${hsla(359, 0.75, 0.4, 1)}; * ` * * // CSS in JS Output * * element { * background: "rgba(179,25,28,0.7)"; * background: "rgba(179,25,28,0.7)"; * background: "#b3191c"; * } */ function hsla(value, saturation, lightness, alpha) { if (typeof value === 'number' && typeof saturation === 'number' && typeof lightness === 'number' && typeof alpha === 'number') { return alpha >= 1 ? hslToHex(value, saturation, lightness) : "rgba(" + hslToRgb(value, saturation, lightness) + "," + alpha + ")"; } else if (typeof value === 'object' && saturation === undefined && lightness === undefined && alpha === undefined) { return value.alpha >= 1 ? hslToHex(value.hue, value.saturation, value.lightness) : "rgba(" + hslToRgb(value.hue, value.saturation, value.lightness) + "," + value.alpha + ")"; } throw new PolishedError(2); } /** * Returns a string value for the color. The returned result is the smallest possible hex notation. * * @example * // Styles as object usage * const styles = { * background: rgb(255, 205, 100), * background: rgb({ red: 255, green: 205, blue: 100 }), * } * * // styled-components usage * const div = styled.div` * background: ${rgb(255, 205, 100)}; * background: ${rgb({ red: 255, green: 205, blue: 100 })}; * ` * * // CSS in JS Output * * element { * background: "#ffcd64"; * background: "#ffcd64"; * } */ function rgb(value, green, blue) { if (typeof value === 'number' && typeof green === 'number' && typeof blue === 'number') { return reduceHexValue("#" + numberToHex(value) + numberToHex(green) + numberToHex(blue)); } else if (typeof value === 'object' && green === undefined && blue === undefined) { return reduceHexValue("#" + numberToHex(value.red) + numberToHex(value.green) + numberToHex(value.blue)); } throw new PolishedError(6); } /** * Returns a string value for the color. The returned result is the smallest possible rgba or hex notation. * * Can also be used to fade a color by passing a hex value or named CSS color along with an alpha value. * * @example * // Styles as object usage * const styles = { * background: rgba(255, 205, 100, 0.7), * background: rgba({ red: 255, green: 205, blue: 100, alpha: 0.7 }), * background: rgba(255, 205, 100, 1), * background: rgba('#ffffff', 0.4), * background: rgba('black', 0.7), * } * * // styled-components usage * const div = styled.div` * background: ${rgba(255, 205, 100, 0.7)}; * background: ${rgba({ red: 255, green: 205, blue: 100, alpha: 0.7 })}; * background: ${rgba(255, 205, 100, 1)}; * background: ${rgba('#ffffff', 0.4)}; * background: ${rgba('black', 0.7)}; * ` * * // CSS in JS Output * * element { * background: "rgba(255,205,100,0.7)"; * background: "rgba(255,205,100,0.7)"; * background: "#ffcd64"; * background: "rgba(255,255,255,0.4)"; * background: "rgba(0,0,0,0.7)"; * } */ function rgba(firstValue, secondValue, thirdValue, fourthValue) { if (typeof firstValue === 'string' && typeof secondValue === 'number') { var rgbValue = parseToRgb(firstValue); return "rgba(" + rgbValue.red + "," + rgbValue.green + "," + rgbValue.blue + "," + secondValue + ")"; } else if (typeof firstValue === 'number' && typeof secondValue === 'number' && typeof thirdValue === 'number' && typeof fourthValue === 'number') { return fourthValue >= 1 ? rgb(firstValue, secondValue, thirdValue) : "rgba(" + firstValue + "," + secondValue + "," + thirdValue + "," + fourthValue + ")"; } else if (typeof firstValue === 'object' && secondValue === undefined && thirdValue === undefined && fourthValue === undefined) { return firstValue.alpha >= 1 ? rgb(firstValue.red, firstValue.green, firstValue.blue) : "rgba(" + firstValue.red + "," + firstValue.green + "," + firstValue.blue + "," + firstValue.alpha + ")"; } throw new PolishedError(7); } var isRgb = function isRgb(color) { return typeof color.red === 'number' && typeof color.green === 'number' && typeof color.blue === 'number' && (typeof color.alpha !== 'number' || typeof color.alpha === 'undefined'); }; var isRgba = function isRgba(color) { return typeof color.red === 'number' && typeof color.green === 'number' && typeof color.blue === 'number' && typeof color.alpha === 'number'; }; var isHsl = function isHsl(color) { return typeof color.hue === 'number' && typeof color.saturation === 'number' && typeof color.lightness === 'number' && (typeof color.alpha !== 'number' || typeof color.alpha === 'undefined'); }; var isHsla = function isHsla(color) { return typeof color.hue === 'number' && typeof color.saturation === 'number' && typeof color.lightness === 'number' && typeof color.alpha === 'number'; }; /** * Converts a RgbColor, RgbaColor, HslColor or HslaColor object to a color string. * This util is useful in case you only know on runtime which color object is * used. Otherwise we recommend to rely on `rgb`, `rgba`, `hsl` or `hsla`. * * @example * // Styles as object usage * const styles = { * background: toColorString({ red: 255, green: 205, blue: 100 }), * background: toColorString({ red: 255, green: 205, blue: 100, alpha: 0.72 }), * background: toColorString({ hue: 240, saturation: 1, lightness: 0.5 }), * background: toColorString({ hue: 360, saturation: 0.75, lightness: 0.4, alpha: 0.72 }), * } * * // styled-components usage * const div = styled.div` * background: ${toColorString({ red: 255, green: 205, blue: 100 })}; * background: ${toColorString({ red: 255, green: 205, blue: 100, alpha: 0.72 })}; * background: ${toColorString({ hue: 240, saturation: 1, lightness: 0.5 })}; * background: ${toColorString({ hue: 360, saturation: 0.75, lightness: 0.4, alpha: 0.72 })}; * ` * * // CSS in JS Output * element { * background: "#ffcd64"; * background: "rgba(255,205,100,0.72)"; * background: "#00f"; * background: "rgba(179,25,25,0.72)"; * } */ function toColorString(color) { if (typeof color !== 'object') throw new PolishedError(8); if (isRgba(color)) return rgba(color); if (isRgb(color)) return rgb(color); if (isHsla(color)) return hsla(color); if (isHsl(color)) return hsl(color); throw new PolishedError(8); } // Type definitions taken from https://github.com/gcanti/flow-static-land/blob/master/src/Fun.js // eslint-disable-next-line no-unused-vars // eslint-disable-next-line no-unused-vars // eslint-disable-next-line no-redeclare function curried(f, length, acc) { return function fn() { // eslint-disable-next-line prefer-rest-params var combined = acc.concat(Array.prototype.slice.call(arguments)); return combined.length >= length ? f.apply(this, combined) : curried(f, length, combined); }; } // eslint-disable-next-line no-redeclare function curry(f) { // eslint-disable-line no-redeclare return curried(f, f.length, []); } function guard(lowerBoundary, upperBoundary, value) { return Math.max(lowerBoundary, Math.min(upperBoundary, value)); } /** * Returns a string value for the darkened color. * * @example * // Styles as object usage * const styles = { * background: darken(0.2, '#FFCD64'), * background: darken('0.2', 'rgba(255,205,100,0.7)'), * } * * // styled-components usage * const div = styled.div` * background: ${darken(0.2, '#FFCD64')}; * background: ${darken('0.2', 'rgba(255,205,100,0.7)')}; * ` * * // CSS in JS Output * * element { * background: "#ffbd31"; * background: "rgba(255,189,49,0.7)"; * } */ function darken(amount, color) { if (color === 'transparent') return color; var hslColor = parseToHsl(color); return toColorString(_extends$3({}, hslColor, { lightness: guard(0, 1, hslColor.lightness - parseFloat(amount)) })); } // prettier-ignore var curriedDarken = /*#__PURE__*/ curry /* ::<number | string, string, string> */ (darken); /** * Decreases the intensity of a color. Its range is between 0 to 1. The first * argument of the desaturate function is the amount by how much the color * intensity should be decreased. * * @example * // Styles as object usage * const styles = { * background: desaturate(0.2, '#CCCD64'), * background: desaturate('0.2', 'rgba(204,205,100,0.7)'), * } * * // styled-components usage * const div = styled.div` * background: ${desaturate(0.2, '#CCCD64')}; * background: ${desaturate('0.2', 'rgba(204,205,100,0.7)')}; * ` * * // CSS in JS Output * element { * background: "#b8b979"; * background: "rgba(184,185,121,0.7)"; * } */ function desaturate(amount, color) { if (color === 'transparent') return color; var hslColor = parseToHsl(color); return toColorString(_extends$3({}, hslColor, { saturation: guard(0, 1, hslColor.saturation - parseFloat(amount)) })); } // prettier-ignore var curriedDesaturate = /*#__PURE__*/ curry /* ::<number | string, string, string> */ (desaturate); /** * Returns a number (float) representing the luminance of a color. * * @example * // Styles as object usage * const styles = { * background: getLuminance('#CCCD64') >= getLuminance('#0000ff') ? '#CCCD64' : '#0000ff', * background: getLuminance('rgba(58, 133, 255, 1)') >= getLuminance('rgba(255, 57, 149, 1)') ? * 'rgba(58, 133, 255, 1)' : * 'rgba(255, 57, 149, 1)', * } * * // styled-components usage * const div = styled.div` * background: ${getLuminance('#CCCD64') >= getLuminance('#0000ff') ? '#CCCD64' : '#0000ff'}; * background: ${getLuminance('rgba(58, 133, 255, 1)') >= getLuminance('rgba(255, 57, 149, 1)') ? * 'rgba(58, 133, 255, 1)' : * 'rgba(255, 57, 149, 1)'}; * * // CSS in JS Output * * div { * background: "#CCCD64"; * background: "rgba(58, 133, 255, 1)"; * } */ function getLuminance(color) { if (color === 'transparent') return 0; var rgbColor = parseToRgb(color); var _Object$keys$map = Object.keys(rgbColor).map(function (key) { var channel = rgbColor[key] / 255; return channel <= 0.03928 ? channel / 12.92 : Math.pow((channel + 0.055) / 1.055, 2.4); }), r = _Object$keys$map[0], g = _Object$keys$map[1], b = _Object$keys$map[2]; return parseFloat((0.2126 * r + 0.7152 * g + 0.0722 * b).toFixed(3)); } /** * Returns a string value for the lightened color. * * @example * // Styles as object usage * const styles = { * background: lighten(0.2, '#CCCD64'), * background: lighten('0.2', 'rgba(204,205,100,0.7)'), * } * * // styled-components usage * const div = styled.div` * background: ${lighten(0.2, '#FFCD64')}; * background: ${lighten('0.2', 'rgba(204,205,100,0.7)')}; * ` * * // CSS in JS Output * * element { * background: "#e5e6b1"; * background: "rgba(229,230,177,0.7)"; * } */ function lighten(amount, color) { if (color === 'transparent') return color; var hslColor = parseToHsl(color); return toColorString(_extends$3({}, hslColor, { lightness: guard(0, 1, hslColor.lightness + parseFloat(amount)) })); } // prettier-ignore var curriedLighten = /*#__PURE__*/ curry /* ::<number | string, string, string> */ (lighten); /** * Returns black or white (or optional light and dark return colors) for best contrast depending on the luminosity of the given color. * Follows [W3C specs for readability](https://www.w3.org/TR/WCAG20-TECHS/G18.html). * * @example * // Styles as object usage * const styles = { * color: readableColor('#000'), * color: readableColor('black', '#001', '#ff8'), * color: readableColor('white', '#001', '#ff8'), * } * * // styled-components usage * const div = styled.div` * color: ${readableColor('#000')}; * color: ${readableColor('black', '#001', '#ff8')}; * color: ${readableColor('white', '#001', '#ff8')}; * ` * * // CSS in JS Output * * element { * color: "#fff"; * color: "#ff8"; * color: "#001"; * } */ function readableColor(color, lightReturnColor, darkReturnColor) { if (lightReturnColor === void 0) { lightReturnColor = '#000'; } if (darkReturnColor === void 0) { darkReturnColor = '#fff'; } return getLuminance(color) > 0.179 ? lightReturnColor : darkReturnColor; } /** * Decreases the opacity of a color. Its range for the amount is between 0 to 1. * * * @example * // Styles as object usage * const styles = { * background: transparentize(0.1, '#fff'); * background: transparentize(0.2, 'hsl(0, 0%, 100%)'), * background: transparentize('0.5', 'rgba(255, 0, 0, 0.8)'), * } * * // styled-components usage * const div = styled.div` * background: ${transparentize(0.1, '#fff')}; * background: ${transparentize(0.2, 'hsl(0, 0%, 100%)')}, * background: ${transparentize('0.5', 'rgba(255, 0, 0, 0.8)')}, * ` * * // CSS in JS Output * * element { * background: "rgba(255,255,255,0.9)"; * background: "rgba(255,255,255,0.8)"; * background: "rgba(255,0,0,0.3)"; * } */ function transparentize(amount, color) { if (color === 'transparent') return color; var parsedColor = parseToRgb(color); var alpha = typeof parsedColor.alpha === 'number' ? parsedColor.alpha : 1; var colorWithAlpha = _extends$3({}, parsedColor, { alpha: guard(0, 1, (alpha * 100 - parseFloat(amount) * 100) / 100) }); return rgba(colorWithAlpha); } // prettier-ignore var curriedTransparentize = /*#__PURE__*/ curry /* ::<number | string, string, string> */ (transparentize); var styles = { arrowSize: 2.1, overlayOpacity: 0.25, shepherdButtonBorderRadius: '3px', shepherdElementBorderRadius: '5px', shepherdElementMaxHeight: '100%', shepherdElementMaxWidth: '100%', shepherdElementZIndex: 999901, shepherdTextBackground: '#ffffff', shepherdTextLineHeight: '1.3em', shepherdTextFontSize: '1rem', shepherdThemePrimary: '#3288e6' }; function getVariables(options) { if (options.styleVariables) { _extends(styles, options.styleVariables); } if (!styles.shepherdHeaderBackground) { styles.shepherdHeaderBackground = curriedDarken(0.1, styles.shepherdTextBackground); } if (!styles.shepherdThemeSecondary) { styles.shepherdThemeSecondary = curriedDesaturate(0.7, curriedLighten(0.4, styles.shepherdThemePrimary)); } _setTextColors(); return styles; } /** * Set all the text colors to contrasting ones, for readability, if not already defined. * @private */ function _setTextColors() { if (!styles.shepherdThemeTextPrimary) { styles.shepherdThemeTextPrimary = curriedTransparentize(0.25, readableColor(styles.shepherdThemePrimary)); } if (!styles.shepherdThemeTextSecondary) { styles.shepherdThemeTextSecondary = curriedTransparentize(0.25, readableColor(styles.shepherdThemeSecondary)); } if (!styles.shepherdThemeTextHeader) { styles.shepherdThemeTextHeader = curriedTransparentize(0.25, readableColor(styles.shepherdHeaderBackground)); } if (!styles.shepherdThemeTextColor) { styles.shepherdThemeTextColor = curriedTransparentize(0.25, readableColor(styles.shepherdTextBackground)); } } /** * Code refactored from Mozilla Developer Network: * https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/assign */ function assign$1(target, firstSource) { if (target === undefined || target === null) { throw new TypeError('Cannot convert first argument to object'); } var to = Object(target); for (var i = 1; i < arguments.length; i++) { var nextSource = arguments[i]; if (nextSource === undefined || nextSource === null) { continue; } var keysArray = Object.keys(Object(nextSource)); for (var nextIndex = 0, len = keysArray.length; nextIndex < len; nextIndex++) { var nextKey = keysArray[nextIndex]; var desc = Object.getOwnPropertyDescriptor(nextSource, nextKey); if (desc !== undefined && desc.enumerable) { to[nextKey] = nextSource[nextKey]; } } } return to; } function polyfill$1() { if (!Object.assign) { Object.defineProperty(Object, 'assign', { enumerable: false, configurable: true, writable: true, value: assign$1 }); } } var es6ObjectAssign = { assign: assign$1, polyfill: polyfill$1 }; var es6ObjectAssign_1 = es6ObjectAssign.assign; var KEBAB_REGEX = /[A-Z]/g; var _hash = function hash(str) { var hash = 5381, i = str.length; while (i) { hash = hash * 33 ^ str.charCodeAt(--i); } return '_' + (hash >>> 0).toString(36); }; var create$2 = function create(config) { config = config || {}; var assign = config.assign || Object.assign; var client = typeof window === 'object'; // Check if we are really in browser environment. var renderer = assign({ raw: '', pfx: '_', client: client, assign: assign, stringify: JSON.stringify, kebab: function kebab(prop) { return prop.replace(KEBAB_REGEX, '-$&').toLowerCase(); }, decl: function decl(key, value) { key = renderer.kebab(key); return key + ':' + value + ';'; }, hash: function hash(obj) { return _hash(renderer.stringify(obj)); }, selector: function selector(parent, _selector) { return parent + (_selector[0] === ':' ? '' : ' ') + _selector; }, putRaw: function putRaw(rawCssRule) { renderer.raw += rawCssRule; } }, config); if (renderer.client) { if (!renderer.sh) document.head.appendChild(renderer.sh = document.createElement('style')); renderer.putRaw = function (rawCssRule) { // .insertRule() is faster than .appendChild(), that's why we use it in PROD. // But CSS injected using .insertRule() is not displayed in Chrome Devtools, // that's why we use .appendChild in DEV. { var sheet = renderer.sh.sheet; // Unknown pseudo-selectors will throw, this try/catch swallows all errors. try { sheet.insertRule(rawCssRule, sheet.cssRules.length); // eslint-disable-next-line no-empty } catch (error) {} } }; } renderer.put = function (selector, decls, atrule) { var str = ''; var prop, value; var postponed = []; for (prop in decls) { value = decls[prop]; if (value instanceof Object && !(value instanceof Array)) { postponed.push(prop); } else { { str += renderer.decl(prop, value, selector, atrule); } } } if (str) { { str = selector + '{' + str + '}'; } renderer.putRaw(atrule ? atrule + '{' + str + '}' : str); } for (var i = 0; i < postponed.length; i++) { prop = postponed[i]; if (prop[0] === "@" && prop !== "@font-face") { renderer.putAt(selector, decls[prop], prop); } else { renderer.put(renderer.selector(selector, prop), decls[prop], atrule); } } }; renderer.putAt = renderer.put; return renderer; }; var addon = function addon(renderer) { var cache = {}; renderer.cache = function (css) { if (!css) return ''; var key = renderer.hash(css); if (!cache[key]) { cache[key] = renderer.rule(css, key); } return cache[key]; }; }; var addon$1 = function addon(renderer) { renderer.selector = function (parentSelectors, selector) { var parents = parentSelectors.split(','); var result = []; var selectors = selector.split(','); var len1 = parents.length; var len2 = selectors.length; var i, j, sel, pos, parent, replacedSelector; for (i = 0; i < len2; i++) { sel = selectors[i]; pos = sel.indexOf('&'); if (pos > -1) { for (j = 0; j < len1; j++) { parent = parents[j]; replacedSelector = sel.replace(/&/g, parent); result.push(replacedSelector); } } else { for (j = 0; j < len1; j++) { parent = parents[j]; if (parent) { result.push(parent + ' ' + sel); } else { result.push(sel); } } } } return result.join(','); }; }; var addon$2 = function addon(renderer) { renderer.rule = function (css, block) { block = block || renderer.hash(css); block = renderer.pfx + block; renderer.put('.' + block, css); return ' ' + block; }; }; var addon$3 = function addon(renderer) { renderer.sheet = function (map, block) { var result = {}; if (!block) { block = renderer.hash(map); } var onElementModifier = function onElementModifier(elementModifier) { var styles = map[elementModifier]; { Object.defineProperty(result, elementModifier, { configurable: true, enumerable: true, get: function get() { var classNames = renderer.rule(styles, block + '-' + elementModifier); Object.defineProperty(result, elementModifier, { value: classNames, enumerable: true }); return classNames; } }); } }; for (var elementModifier in map) { onElementModifier(elementModifier); } return result; }; }; var nano = create$2({ assign: es6ObjectAssign_1, h: h, pfx: '' }); addon(nano); addon$1(nano); addon$2(nano); addon$3(nano); var rule = nano.rule, sheet = nano.sheet; function buttonStyles(classPrefix, variables, includeStyles) { if (includeStyles) { var _button; return { button: (_button = { background: variables.shepherdThemePrimary, borderRadius: variables.shepherdButtonBorderRadius, border: 0, color: variables.shepherdThemeTextPrimary, cursor: 'pointer', display: 'inline-block', fontFamily: 'inherit', fontSize: '0.8em', letterSpacing: '0.1em', lineHeight: '1em', marginRight: '0.5em', padding: '0.75em 2em', textTransform: 'uppercase', transition: 'all 0.5s ease', verticalAlign: 'middle', '&:hover': { background: curriedDarken(0.1, variables.shepherdThemePrimary) } }, _button["&." + classPrefix + "shepherd-button-secondary"] = { background: variables.shepherdThemeSecondary, color: variables.shepherdThemeTextSecondary, '&:hover': { background: curriedDarken(0.1, variables.shepherdThemeSecondary), color: curriedDarken(0.1, variables.shepherdThemeTextSecondary) } }, _button) }; } return { button: {} }; } function contentStyles(variables, includeStyles) { if (includeStyles) { return { content: { background: variables.shepherdTextBackground, borderRadius: variables.shepherdElementBorderRadius, fontSize: 'inherit', outline: 'none', padding: 0 } }; } return { content: {} }; } function elementStyles() { return { element: { 'outline': 'none', // We need box-sizing: border-box on shepherd-element and everything under it '&, *': { '&, &:after, &:before': { boxSizing: 'border-box' } } } }; } function footerStyles(classPrefix, variables, includeStyles) { if (includeStyles) { var _footer; return { footer: (_footer = { borderBottomLeftRadius: variables.shepherdElementBorderRadius, borderBottomRightRadius: variables.shepherdElementBorderRadius, display: 'flex', justifyContent: 'flex-end', padding: '0 0.75em 0.75em' }, _footer["." + classPrefix + "shepherd-button"] = { '&:last-child': { marginRight: 0 } }, _footer) }; } return { footer: {} }; } /** * Check the luminance of the color and lighten or darken accordingly * @param {string} color The color to check * @return {string} The lightened or darkened color */ function getLighterOrDarker(color) { var l = getLuminance(color); if (l > 0.6) { return curriedDarken(l / 2, color); } return curriedLighten((1 - l) / 2, color); } function headerStyles(classPrefix, variables, includeStyles) { var _header, _cancelIcon; var header = (_header = { alignItems: 'center', borderTopLeftRadius: variables.shepherdElementBorderRadius, borderTopRightRadius: variables.shepherdElementBorderRadius, display: 'flex', justifyContent: 'flex-end', lineHeight: '2em', padding: '0.75em 0.75em 0' }, _header["." + classPrefix + "shepherd-has-title ." + classPrefix + "shepherd-content &"] = { background: variables.shepherdHeaderBackground, padding: '1em' }, _header); var title = { color: variables.shepherdThemeTextHeader, display: 'flex', flex: '1 0 auto', fontSize: '1.1em', fontWeight: 'normal', margin: 0, padding: 0, position: 'relative', verticalAlign: 'middle' }; var styles = { 'cancel-icon': (_cancelIcon = { background: 'transparent', border: 'none', color: getLighterOrDarker(variables.shepherdThemeTextColor), fontSize: '2em', fontWeight: 'normal', margin: 0, padding: 0, position: 'relative', textDecoration: 'none', transition: 'color 0.5s ease', verticalAlign: 'middle', '&:hover': { color: variables.shepherdThemeTextColor, cursor: 'pointer' } }, _cancelIcon["." + classPrefix + "shepherd-has-title ." + classPrefix + "shepherd-content &"] = { color: getLighterOrDarker(variables.shepherdThemeTextHeader), '&:hover': { color: variables.shepherdThemeTextHeader } }, _cancelIcon) }; if (includeStyles) { styles = _extends({}, styles, { header: header, title: title }); } else { styles = _extends({}, styles, { header: {}, title: {} }); } return styles; } function modalStyles(classPrefix, variables) { var _modalOverlayContai; return { 'modal-overlay-container': (_modalOverlayContai = { '-ms-filter': 'progid:dximagetransform.microsoft.gradient.alpha(Opacity=50)', filter: 'alpha(opacity=35)', height: 0, left: 0, opacity: 0, overflow: 'hidden', position: 'fixed', top: 0, transition: 'all 0.3s ease-out, height 0ms 0.3s, opacity 0.3s 0ms', width: '100vw', zIndex: variables.shepherdElementZIndex - 2 }, _modalOverlayContai["." + classPrefix + "shepherd-modal-is-visible &"] = { height: '100vh', opacity: variables.overlayOpacity, transition: 'all 0.3s ease-out, height 0s 0s, opacity 0.3s 0s' }, _modalOverlayContai), 'modal-mask-rect': { height: '100vh', width: '100vw' } }; } function textStyles(variables, includeStyles) { if (includeStyles) { return { text: { color: variables.shepherdThemeTextColor, fontSize: variables.shepherdTextFontSize, lineHeight: variables.shepherdTextLineHeight, padding: '0.75em', p: { marginTop: 0, '&:last-child': { marginBottom: 0 } } } }; } return { text: {} }; } function generateStyles(options) { var _ref, _active, _xPlacementTop, _ref2, _xPlacementBott, _xPlacementLeft, _xPlacementRigh, _ref3, _extends2, _rule; var variables = getVariables(options); var classPrefix = normalizePrefix(options.classPrefix); var tippyPrefix = normalizePrefix(options.tippyClassPrefix); var includeStyles = options.includeStyles; var styles = _extends({ active: (_active = {}, _active["&." + classPrefix + "shepherd-modal-is-visible"] = (_ref = {}, _ref[":not(." + classPrefix + "shepherd-target)"] = { pointerEvents: 'none' }, _ref["." + classPrefix + "shepherd-button, ." + classPrefix + "shepherd-cancel-icon, ." + classPrefix + "shepherd-element, ." + classPrefix + "shepherd-target"] = { pointerEvents: 'auto', '*': { pointerEvents: 'auto' } }, _ref), _active) }, buttonStyles(classPrefix, variables, includeStyles), {}, contentStyles(variables, includeStyles), {}, elementStyles(), {}, footerStyles(classPrefix, variables, includeStyles), {}, headerStyles(classPrefix, variables, includeStyles), {}, modalStyles(classPrefix, variables), {}, textStyles(variables, includeStyles)); if (variables.useDropShadow) { styles.element.filter = 'drop-shadow(0 1px 4px rgba(0, 0, 0, 0.2))'; } var classes = sheet(styles, classPrefix + "shepherd"); var arrowMargin = "calc((" + variables.arrowSize + " / 2.1) * 16px)"; var popperThemeArrows = { '&[x-placement^="top"]': (_xPlacementTop = { marginBottom: arrowMargin }, _xPlacementTop["." + tippyPrefix + "tippy-arrow"] = { borderTopColor: variables.shepherdTextBackground }, _xPlacementTop), '&[x-placement^="bottom"]': (_xPlacementBott = { marginTop: arrowMargin }, _xPlacementBott["." + tippyPrefix + "tippy-arrow"] = { borderBottomColor: variables.shepherdTextBackground }, _xPlacementBott["&." + classPrefix + "shepherd-has-title"] = (_ref2 = {}, _ref2["." + tippyPrefix + "tippy-arrow"] = { borderBottomColor: variables.shepherdHeaderBackground }, _ref2), _xPlacementBott), '&[x-placement^="left"]': (_xPlacementLeft = { marginRight: arrowMargin }, _xPlacementLeft["." + tippyPrefix + "tippy-arrow"] = { borderLeftColor: variables.shepherdTextBackground }, _xPlacementLeft), '&[x-placement^="right"]': (_xPlacementRigh = { marginLeft: arrowMargin }, _xPlacementRigh["." + tippyPrefix + "tippy-arrow"] = { borderRightColor: variables.shepherdTextBackground }, _xPlacementRigh) }; // We have to add the root shepherd class separately classes.shepherd = rule((_rule = {}, _rule["&." + tippyPrefix + "tippy-popper"] = _extends({}, popperThemeArrows, (_extends2 = { zIndex: variables.shepherdElementZIndex }, _extends2["." + tippyPrefix + "tippy-tooltip"] = (_ref3 = { backgroundColor: variables.shepherdTextBackground }, _ref3["." + tippyPrefix + "tippy-arrow"] = { transform: "scale(" + variables.arrowSize + ")", zIndex: variables.shepherdElementZIndex + 1 }, _ref3["." + tippyPrefix + "tippy-content"] = { maxHeight: variables.shepherdElementMaxHeight, maxWidth: variables.shepherdElementMaxWidth, padding: 0, textAlign: 'center' }, _ref3), _extends2)), _rule), classPrefix + "shepherd"); return classes; } var Component$7 = preact.Component; var ShepherdModal = /*#__PURE__*/ function (_Component) { _inheritsLoose(ShepherdModal, _Component); function ShepherdModal(props) { var _this; _this = _Component.call(this, props) || this; _this._onScreenChange = null; _this.classPrefix = props.classPrefix; autoBind(_assertThisInitialized(_this)); // Setup initial state _this.closeModalOpening(); return _this; } var _proto = ShepherdModal.prototype; _proto.render = function render(props, state) { var classPrefix = props.classPrefix, styles = props.styles; return preact.h("svg", { className: styles['modal-overlay-container'], onTouchMove: ShepherdModal.handlePreventModalOverlayTouch }, preact.h("defs", null, preact.h("mask", { className: classPrefix + "shepherd-modal-mask", height: "100%", id: classPrefix + "shepherd-modal-mask", width: "100%", x: "0", y: "0" }, preact.h("rect", { className: styles['modal-mask-rect'], fill: "#FFFFFF", height: "100%", width: "100%", x: "0", y: "0" }), preact.h("rect", { className: classPrefix + "shepherd-modal-mask-opening", fill: "#000000", height: state.openingProperties.height, x: state.openingProperties.x, y: state.openingProperties.y, width: state.openingProperties.width }))), preact.h("rect", { height: "100%", width: "100%", x: "0", y: "0", mask: "url(#" + classPrefix + "shepherd-modal-mask)" })); }; _proto.closeModalOpening = function closeModalOpening() { this.setState({ openingProperties: { height: 0, x: 0, y: 0, width: 0 } }); } /** * Hide the modal overlay */ ; _proto.hide = function hide() { document.body.classList.remove(this.classPrefix + "shepherd-modal-is-visible"); // Ensure we cleanup all event listeners when we hide the modal this._cleanupStepEventListeners(); } /** * Uses the bounds of the element we want the opening overtop of to set the dimensions of the opening and position it * @param {HTMLElement} targetElement The element the opening will expose * @param {Number} modalOverlayOpeningPadding An amount of padding to add around the modal overlay opening */ ; _proto.positionModalOpening = function positionModalOpening(targetElement, modalOverlayOpeningPadding) { if (modalOverlayOpeningPadding === void 0) { modalOverlayOpeningPadding = 0; } if (targetElement.getBoundingClientRect) { var _targetElement$getBou = targetElement.getBoundingClientRect(), x = _targetElement$getBou.x, y = _targetElement$getBou.y, width = _targetElement$getBou.width, height = _targetElement$getBou.height, left = _targetElement$getBou.left, top = _targetElement$getBou.top; // getBoundingClientRect is not consistent. Some browsers use x and y, while others use left and top this.setState({ openingProperties: { x: (x || left) - modalOverlayOpeningPadding, y: (y || top) - modalOverlayOpeningPadding, width: width + modalOverlayOpeningPadding * 2, height: height + modalOverlayOpeningPadding * 2 } }); } } /** * If modal is enabled, setup the svg mask opening and modal overlay for the step * @param {Step} step The step instance */ ; _proto.setupForStep = function setupForStep(step) { // Ensure we move listeners from the previous step, before we setup new ones this._cleanupStepEventListeners(); if (step.tour.options.useModalOverlay) { this._styleForStep(step); this.show(); } else { this.hide(); } } /** * Show the modal overlay */ ; _proto.show = function show() { document.body.classList.add(this.classPrefix + "shepherd-modal-is-visible"); } /** * Add touchmove event listener * @private */ ; _proto._addStepEventListeners = function _addStepEventListeners() { // Prevents window from moving on touch. window.addEventListener('touchmove', ShepherdModal._preventModalBodyTouch, { passive: false }); } /** * Cancel the requestAnimationFrame loop and remove touchmove event listeners * @private */ ; _proto._cleanupStepEventListeners = function _cleanupStepEventListeners() { if (this.rafId) { cancelAnimationFrame(this.rafId); this.rafId = undefined; } window.removeEventListener('touchmove', ShepherdModal._preventModalBodyTouch, { passive: false }); } /** * Style the modal for the step * @param {Step} step The step to style the opening for * @private */ ; _proto._styleForStep = function _styleForStep(step) { var _this2 = this; var modalOverlayOpeningPadding = step.options.modalOverlayOpeningPadding; if (step.target) { // Setup recursive function to call requestAnimationFrame to update the modal opening position var rafLoop = function rafLoop() { _this2.rafId = undefined; _this2.positionModalOpening(step.target, modalOverlayOpeningPadding); _this2.rafId = requestAnimationFrame(rafLoop); }; rafLoop(); this._addStepEventListeners(); } else { this.closeModalOpening(); } }; ShepherdModal._preventModalBodyTouch = function _preventModalBodyTouch(e) { e.preventDefault(); }; ShepherdModal.handlePreventModalOverlayTouch = function handlePreventModalOverlayTouch(e) { e.stopPropagation(); }; return ShepherdModal; }(Component$7); var render$2 = preact.render; /** * Creates incremented ID for each newly created tour * * @return {Function} A function that returns the unique id for the tour * @private */ var uniqueId$1 = function () { var id = 0; return function () { return ++id; }; }(); var Shepherd = new Evented(); /** * Class representing the site tour * @extends {Evented} */ var Tour = /*#__PURE__*/ function (_Evented) { _inheritsLoose(Tour, _Evented); /** * @param {Object} options The options for the tour * @param {boolean} options.confirmCancel If true, will issue a `window.confirm` before cancelling * @param {string} options.confirmCancelMessage The message to display in the confirm dialog * @param {string} options.classPrefix The prefix to add to all the `shepherd-*` class names. * @param {Object} options.defaultStepOptions Default options for Steps ({@link Step#constructor}), created through `addStep` * @param {boolean} options.disableScroll When set to true, will keep the user from scrolling with the scrollbar, * mousewheel, arrow keys, etc. You may want to use this to ensure you are driving the scroll position with the tour. * @param {boolean} options.exitOnEsc Exiting the tour with the escape key will be enabled unless this is explicitly * set to false. * @param {boolean} options.includeStyles If false, the majority of the Shepherd styles will not be included. * You may want to use this option if you find yourself overriding a lot of the Shepherd styles. * @param {boolean} options.keyboardNavigation Navigating the tour via left and right arrow keys will be enabled * unless this is explicitly set to false. * @param {HTMLElement} options.modalContainer An optional container element for the modal. * If not set, the modal will be appended to `document.body`. * @param {object[] | Step[]} options.steps An array of step options objects or Step instances to initialize the tour with * @param {object} options.styleVariables An object hash of style variables to override * @param {string} options.tourName An optional "name" for the tour. This will be appended to the the tour's * dynamically generated `id` property -- which is also set on the `body` element as the `data-shepherd-active-tour` attribute * whenever the tour becomes active. * @param {boolean} options.useModalOverlay Whether or not steps should be placed above a darkened * modal overlay. If true, the overlay will create an opening around the target element so that it * can remain interactive * @returns {Tour} */ function Tour(options) { var _this; if (options === void 0) { options = {}; } _this = _Evented.call(this, options) || this; autoBind(_assertThisInitialized(_this)); var defaultTourOptions = { exitOnEsc: true, includeStyles: true, keyboardNavigation: true }; _this.options = _extends({}, defaultTourOptions, options); _this.classPrefix = _this.options ? normalizePrefix(_this.options.classPrefix) : ''; _this.styles = generateStyles(_this.options); _this.steps = []; _this.addSteps(_this.options.steps); // Pass these events onto the global Shepherd object var events = ['active', 'cancel', 'complete', 'inactive', 'show', 'start']; events.map(function (event) { (function (e) { _this.on(e, function (opts) { opts = opts || {}; opts.tour = _assertThisInitialized(_this); Shepherd.trigger(e, opts); }); })(event); }); var existingModal = document.querySelector("." + _this.classPrefix + "shepherd-modal-overlay-container"); render$2(preact.h(ShepherdModal, { classPrefix: _this.classPrefix, ref: function ref(c) { return _this.modal = c; }, styles: _this.styles }), options.modalContainer || document.body, existingModal); _this._setTooltipDefaults(); _this._setTourID(); return _assertThisInitialized(_this) || _assertThisInitialized(_this); } /** * Adds a new step to the tour * @param {Object|Step} options An object containing step options or a Step instance * @return {Step} The newly added step */ var _proto = Tour.prototype; _proto.addStep = function addStep(options) { var step = options; if (!(step instanceof Step)) { step = this._setupStep(step); } else { step.tour = this; } this.steps.push(step); return step; } /** * Add multiple steps to the tour * @param {Array<object> | Array<Step>} steps The steps to add to the tour */ ; _proto.addSteps = function addSteps(steps) { var _this2 = this; if (Array.isArray(steps)) { steps.forEach(function (step) { _this2.addStep(step); }); } return this; } /** * Go to the previous step in the tour */ ; _proto.back = function back() { var index = this.steps.indexOf(this.currentStep); this.show(index - 1, false); } /** * Calls _done() triggering the 'cancel' event * If `confirmCancel` is true, will show a window.confirm before cancelling */ ; _proto.cancel = function cancel() { if (this.options.confirmCancel) { var cancelMessage = this.options.confirmCancelMessage || 'Are you sure you want to stop the tour?'; var stopTour = window.confirm(cancelMessage); if (stopTour) { this._done('cancel'); } } else { this._done('cancel'); } } /** * Calls _done() triggering the `complete` event */ ; _proto.complete = function complete() { this._done('complete'); } /** * Gets the step from a given id * @param {Number|String} id The id of the step to retrieve * @return {Step} The step corresponding to the `id` */ ; _proto.getById = function getById(id) { return this.steps.find(function (step) { return step.id === id; }); } /** * Gets the current step * @returns {Step|null} */ ; _proto.getCurrentStep = function getCurrentStep() { return this.currentStep; } /** * Hide the current step */ ; _proto.hide = function hide() { var currentStep = this.getCurrentStep(); if (currentStep) { return currentStep.hide(); } } /** * Check if the tour is active * @return {boolean} */ ; _proto.isActive = function isActive() { return Shepherd.activeTour === this; } /** * Go to the next step in the tour * If we are at the end, call `complete` */ ; _proto.next = function next() { var index = this.steps.indexOf(this.currentStep); if (index === this.steps.length - 1) { this.complete(); } else { this.show(index + 1, true); } } /** * Removes the step from the tour * @param {String} name The id for the step to remove */ ; _proto.removeStep = function removeStep(name) { var _this3 = this; var current = this.getCurrentStep(); // Find the step, destroy it and remove it from this.steps this.steps.some(function (step, i) { if (step.id === name) { if (step.isOpen()) { step.hide(); } step.destroy(); _this3.steps.splice(i, 1); return true; } }); if (current && current.id === name) { this.currentStep = undefined; // If we have steps left, show the first one, otherwise just cancel the tour this.steps.length ? this.show(0) : this.cancel(); } } /** * Show a specific step in the tour * @param {Number|String} key The key to look up the step by * @param {Boolean} forward True if we are going forward, false if backward */ ; _proto.show = function show(key, forward) { if (key === void 0) { key = 0; } if (forward === void 0) { forward = true; } var step = isString(key) ? this.getById(key) : this.steps[key]; if (step) { this._updateStateBeforeShow(); var shouldSkipStep = isFunction(step.options.showOn) && !step.options.showOn(); // If `showOn` returns false, we want to skip the step, otherwise, show the step like normal if (shouldSkipStep) { this._skipStep(step, forward); } else { this.trigger('show', { step: step, previous: this.currentStep }); this.currentStep = step; step.show(); } } } /** * Start the tour */ ; _proto.start = function start() { this.trigger('start'); if (this.options.disableScroll) { bodyScrollLock.disableBodyScroll(); } // Save the focused element before the tour opens this.focusedElBeforeOpen = document.activeElement; this.currentStep = null; this._setupActiveTour(); this.next(); } /** * Called whenever the tour is cancelled or completed, basically anytime we exit the tour * @param {String} event The event name to trigger * @private */ ; _proto._done = function _done(event) { var index = this.steps.indexOf(this.currentStep); if (Array.isArray(this.steps)) { this.steps.forEach(function (step) { return step.destroy(); }); } cleanupSteps(this); this.trigger(event, { index: index }); Shepherd.activeTour = null; this._removeBodyAttrs(); this.trigger('inactive', { tour: this }); if (this.options.disableScroll) { bodyScrollLock.clearAllBodyScrollLocks(); } this.modal.hide(); // Focus the element that was focused before the tour started if (isElement(this.focusedElBeforeOpen)) { this.focusedElBeforeOpen.focus(); } } /** * Make this tour "active" * @private */ ; _proto._setupActiveTour = function _setupActiveTour() { this._addBodyAttrs(); this.trigger('active', { tour: this }); Shepherd.activeTour = this; } /** * Setup a new step object * @param {Object} stepOptions The object describing the options for the step * @return {Step} The step instance * @private */ ; _proto._setupStep = function _setupStep(stepOptions) { stepOptions = _extends({}, this.options.defaultStepOptions, stepOptions); return new Step(this, stepOptions); } /** * Called when `showOn` evaluates to false, to skip the step * @param {Step} step The step to skip * @param {Boolean} forward True if we are going forward, false if backward * @private */ ; _proto._skipStep = function _skipStep(step, forward) { var index = this.steps.indexOf(step); var nextIndex = forward ? index + 1 : index - 1; this.show(nextIndex, forward); } /** * Set the tippy defaults * @private */ ; _proto._setTooltipDefaults = function _setTooltipDefaults() { tippy.setDefaultProps(defaults); } /** * Before showing, hide the current step and if the tour is not * already active, call `this._setupActiveTour`. * @private */ ; _proto._updateStateBeforeShow = function _updateStateBeforeShow() { if (this.currentStep) { this.currentStep.hide(); } if (!this.isActive()) { this._setupActiveTour(); } } /** * Sets this.id to `${tourName}--${uuid}` * @private */ ; _proto._setTourID = function _setTourID() { var tourName = this.options.tourName || 'tour'; var uuid = uniqueId$1(); this.id = tourName + "--" + uuid; } /** * Adds the data-shepherd-active-tour attribute and the 'shepherd-active' * class to the body. * @private */ ; _proto._addBodyAttrs = function _addBodyAttrs() { document.body.setAttribute("data-" + this.classPrefix + "shepherd-active-tour", this.id); document.body.classList.add(this.styles.active.trim()); } /** * Removes the data-shepherd-active-tour attribute and the 'shepherd-active' * class from the body. * @private */ ; _proto._removeBodyAttrs = function _removeBodyAttrs() { document.body.removeAttribute("data-" + this.classPrefix + "shepherd-active-tour"); document.body.classList.remove(this.styles.active.trim()); }; return Tour; }(Evented); _extends(Shepherd, { Tour: Tour, Step: Step }); return Shepherd; })); //# sourceMappingURL=shepherd.js.map
/home/batcwwjx/public_html/wp-content/plugins/charitable/././assets/js/libraries/./shepherd.js